From 869aafc83605fc83718551fe3bfdc797b8e6feee Mon Sep 17 00:00:00 2001 From: Kenneth Shaw Date: Sat, 6 May 2017 08:20:24 +0700 Subject: [PATCH] Adding script to generate domains from protocol.json and updating to latest protocol.json --- cdp/accessibility/easyjson.go | 2 +- cdp/animation/easyjson.go | 2 +- cdp/applicationcache/easyjson.go | 2 +- cdp/browser/easyjson.go | 2 +- cdp/cachestorage/easyjson.go | 2 +- cdp/cdp.go | 99 +- cdp/cdputil/cdputil.go | 80 +- cdp/css/easyjson.go | 2 +- cdp/database/easyjson.go | 2 +- cdp/debugger/easyjson.go | 2 +- cdp/deviceorientation/easyjson.go | 2 +- cdp/dom/dom.go | 248 ---- cdp/dom/easyjson.go | 2109 ++++++--------------------- cdp/dom/events.go | 13 - cdp/dom/types.go | 72 +- cdp/domdebugger/easyjson.go | 2 +- cdp/domstorage/easyjson.go | 2 +- cdp/easyjson.go | 2 +- cdp/emulation/easyjson.go | 2 +- cdp/heapprofiler/easyjson.go | 2 +- cdp/indexeddb/easyjson.go | 2 +- cdp/input/easyjson.go | 2 +- cdp/inspector/easyjson.go | 2 +- cdp/io/easyjson.go | 2 +- cdp/layertree/easyjson.go | 2 +- cdp/log/easyjson.go | 2 +- cdp/memory/easyjson.go | 2 +- cdp/network/easyjson.go | 2 +- cdp/overlay/easyjson.go | 1794 +++++++++++++++++++++++ cdp/overlay/events.go | 26 + cdp/overlay/overlay.go | 449 ++++++ cdp/overlay/types.go | 73 + cdp/page/easyjson.go | 141 +- cdp/page/page.go | 32 - cdp/profiler/easyjson.go | 2 +- cdp/profiler/events.go | 2 +- cdp/rendering/easyjson.go | 354 ----- cdp/rendering/rendering.go | 124 -- cdp/runtime/easyjson.go | 2 +- cdp/runtime/events.go | 2 +- cdp/schema/easyjson.go | 2 +- cdp/security/easyjson.go | 2 +- cdp/serviceworker/easyjson.go | 2 +- cdp/storage/easyjson.go | 2 +- cdp/systeminfo/easyjson.go | 2 +- cdp/target/easyjson.go | 2 +- cdp/tethering/easyjson.go | 2 +- cdp/tracing/easyjson.go | 2 +- cmd/chromedp-gen/domain-gen.go | 102 ++ cmd/chromedp-gen/fixup/fixup.go | 2 - cmd/chromedp-gen/internal/domain.go | 144 ++ cmd/chromedp-gen/internal/enum.go | 180 --- cmd/chromedp-gen/main.go | 5 +- cmd/chromedp-gen/protocol.json | 597 ++++---- contrib/meta.sh | 4 +- handler.go | 6 - input_test.go | 3 +- sel_test.go | 26 +- util.go | 4 - 59 files changed, 3541 insertions(+), 3214 deletions(-) create mode 100644 cdp/overlay/easyjson.go create mode 100644 cdp/overlay/events.go create mode 100644 cdp/overlay/overlay.go create mode 100644 cdp/overlay/types.go delete mode 100644 cdp/rendering/easyjson.go delete mode 100644 cdp/rendering/rendering.go create mode 100644 cmd/chromedp-gen/domain-gen.go create mode 100644 cmd/chromedp-gen/internal/domain.go diff --git a/cdp/accessibility/easyjson.go b/cdp/accessibility/easyjson.go index ae74bde..89a1b1a 100644 --- a/cdp/accessibility/easyjson.go +++ b/cdp/accessibility/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package accessibility diff --git a/cdp/animation/easyjson.go b/cdp/animation/easyjson.go index 7deb5cf..22ee6d7 100644 --- a/cdp/animation/easyjson.go +++ b/cdp/animation/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package animation diff --git a/cdp/applicationcache/easyjson.go b/cdp/applicationcache/easyjson.go index 0c487bc..8396742 100644 --- a/cdp/applicationcache/easyjson.go +++ b/cdp/applicationcache/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package applicationcache diff --git a/cdp/browser/easyjson.go b/cdp/browser/easyjson.go index 4b8bfdd..18ba1c8 100644 --- a/cdp/browser/easyjson.go +++ b/cdp/browser/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package browser diff --git a/cdp/cachestorage/easyjson.go b/cdp/cachestorage/easyjson.go index 9f19e83..bca6a98 100644 --- a/cdp/cachestorage/easyjson.go +++ b/cdp/cachestorage/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package cachestorage diff --git a/cdp/cdp.go b/cdp/cdp.go index c6c2f79..9f74962 100644 --- a/cdp/cdp.go +++ b/cdp/cdp.go @@ -93,17 +93,29 @@ const ( CommandPageStopScreencast MethodType = "Page.stopScreencast" CommandPageScreencastFrameAck MethodType = "Page.screencastFrameAck" CommandPageHandleJavaScriptDialog MethodType = "Page.handleJavaScriptDialog" - CommandPageConfigureOverlay MethodType = "Page.configureOverlay" CommandPageGetAppManifest MethodType = "Page.getAppManifest" CommandPageRequestAppBanner MethodType = "Page.requestAppBanner" CommandPageSetControlNavigations MethodType = "Page.setControlNavigations" CommandPageProcessNavigation MethodType = "Page.processNavigation" CommandPageGetLayoutMetrics MethodType = "Page.getLayoutMetrics" - CommandRenderingSetShowPaintRects MethodType = "Rendering.setShowPaintRects" - CommandRenderingSetShowDebugBorders MethodType = "Rendering.setShowDebugBorders" - CommandRenderingSetShowFPSCounter MethodType = "Rendering.setShowFPSCounter" - CommandRenderingSetShowScrollBottleneckRects MethodType = "Rendering.setShowScrollBottleneckRects" - CommandRenderingSetShowViewportSizeOnResize MethodType = "Rendering.setShowViewportSizeOnResize" + EventOverlayNodeHighlightRequested MethodType = "Overlay.nodeHighlightRequested" + EventOverlayInspectNodeRequested MethodType = "Overlay.inspectNodeRequested" + CommandOverlayEnable MethodType = "Overlay.enable" + CommandOverlayDisable MethodType = "Overlay.disable" + CommandOverlaySetShowPaintRects MethodType = "Overlay.setShowPaintRects" + CommandOverlaySetShowDebugBorders MethodType = "Overlay.setShowDebugBorders" + CommandOverlaySetShowFPSCounter MethodType = "Overlay.setShowFPSCounter" + CommandOverlaySetShowScrollBottleneckRects MethodType = "Overlay.setShowScrollBottleneckRects" + CommandOverlaySetShowViewportSizeOnResize MethodType = "Overlay.setShowViewportSizeOnResize" + CommandOverlaySetPausedInDebuggerMessage MethodType = "Overlay.setPausedInDebuggerMessage" + CommandOverlaySetSuspended MethodType = "Overlay.setSuspended" + CommandOverlaySetInspectMode MethodType = "Overlay.setInspectMode" + CommandOverlayHighlightRect MethodType = "Overlay.highlightRect" + CommandOverlayHighlightQuad MethodType = "Overlay.highlightQuad" + CommandOverlayHighlightNode MethodType = "Overlay.highlightNode" + CommandOverlayHighlightFrame MethodType = "Overlay.highlightFrame" + CommandOverlayHideHighlight MethodType = "Overlay.hideHighlight" + CommandOverlayGetHighlightObjectForTest MethodType = "Overlay.getHighlightObjectForTest" EventEmulationVirtualTimeBudgetExpired MethodType = "Emulation.virtualTimeBudgetExpired" CommandEmulationSetDeviceMetricsOverride MethodType = "Emulation.setDeviceMetricsOverride" CommandEmulationClearDeviceMetricsOverride MethodType = "Emulation.clearDeviceMetricsOverride" @@ -197,7 +209,6 @@ const ( CommandApplicationCacheGetManifestForFrame MethodType = "ApplicationCache.getManifestForFrame" CommandApplicationCacheGetApplicationCacheForFrame MethodType = "ApplicationCache.getApplicationCacheForFrame" EventDOMDocumentUpdated MethodType = "DOM.documentUpdated" - EventDOMInspectNodeRequested MethodType = "DOM.inspectNodeRequested" EventDOMSetChildNodes MethodType = "DOM.setChildNodes" EventDOMAttributeModified MethodType = "DOM.attributeModified" EventDOMAttributeRemoved MethodType = "DOM.attributeRemoved" @@ -211,7 +222,6 @@ const ( EventDOMPseudoElementAdded MethodType = "DOM.pseudoElementAdded" EventDOMPseudoElementRemoved MethodType = "DOM.pseudoElementRemoved" EventDOMDistributedNodesUpdated MethodType = "DOM.distributedNodesUpdated" - EventDOMNodeHighlightRequested MethodType = "DOM.nodeHighlightRequested" CommandDOMEnable MethodType = "DOM.enable" CommandDOMDisable MethodType = "DOM.disable" CommandDOMGetDocument MethodType = "DOM.getDocument" @@ -232,12 +242,6 @@ const ( CommandDOMGetSearchResults MethodType = "DOM.getSearchResults" CommandDOMDiscardSearchResults MethodType = "DOM.discardSearchResults" CommandDOMRequestNode MethodType = "DOM.requestNode" - CommandDOMSetInspectMode MethodType = "DOM.setInspectMode" - CommandDOMHighlightRect MethodType = "DOM.highlightRect" - CommandDOMHighlightQuad MethodType = "DOM.highlightQuad" - CommandDOMHighlightNode MethodType = "DOM.highlightNode" - CommandDOMHideHighlight MethodType = "DOM.hideHighlight" - CommandDOMHighlightFrame MethodType = "DOM.highlightFrame" CommandDOMPushNodeByPathToFrontend MethodType = "DOM.pushNodeByPathToFrontend" CommandDOMPushNodesByBackendIdsToFrontend MethodType = "DOM.pushNodesByBackendIdsToFrontend" CommandDOMSetInspectedNode MethodType = "DOM.setInspectedNode" @@ -253,7 +257,6 @@ const ( CommandDOMGetBoxModel MethodType = "DOM.getBoxModel" CommandDOMGetNodeForLocation MethodType = "DOM.getNodeForLocation" CommandDOMGetRelayoutBoundary MethodType = "DOM.getRelayoutBoundary" - CommandDOMGetHighlightObjectForTest MethodType = "DOM.getHighlightObjectForTest" EventCSSMediaQueryResultChanged MethodType = "CSS.mediaQueryResultChanged" EventCSSFontsUpdated MethodType = "CSS.fontsUpdated" EventCSSStyleSheetChanged MethodType = "CSS.styleSheetChanged" @@ -563,8 +566,6 @@ func (t *MethodType) UnmarshalEasyJSON(in *jlexer.Lexer) { *t = CommandPageScreencastFrameAck case CommandPageHandleJavaScriptDialog: *t = CommandPageHandleJavaScriptDialog - case CommandPageConfigureOverlay: - *t = CommandPageConfigureOverlay case CommandPageGetAppManifest: *t = CommandPageGetAppManifest case CommandPageRequestAppBanner: @@ -575,16 +576,42 @@ func (t *MethodType) UnmarshalEasyJSON(in *jlexer.Lexer) { *t = CommandPageProcessNavigation case CommandPageGetLayoutMetrics: *t = CommandPageGetLayoutMetrics - case CommandRenderingSetShowPaintRects: - *t = CommandRenderingSetShowPaintRects - case CommandRenderingSetShowDebugBorders: - *t = CommandRenderingSetShowDebugBorders - case CommandRenderingSetShowFPSCounter: - *t = CommandRenderingSetShowFPSCounter - case CommandRenderingSetShowScrollBottleneckRects: - *t = CommandRenderingSetShowScrollBottleneckRects - case CommandRenderingSetShowViewportSizeOnResize: - *t = CommandRenderingSetShowViewportSizeOnResize + case EventOverlayNodeHighlightRequested: + *t = EventOverlayNodeHighlightRequested + case EventOverlayInspectNodeRequested: + *t = EventOverlayInspectNodeRequested + case CommandOverlayEnable: + *t = CommandOverlayEnable + case CommandOverlayDisable: + *t = CommandOverlayDisable + case CommandOverlaySetShowPaintRects: + *t = CommandOverlaySetShowPaintRects + case CommandOverlaySetShowDebugBorders: + *t = CommandOverlaySetShowDebugBorders + case CommandOverlaySetShowFPSCounter: + *t = CommandOverlaySetShowFPSCounter + case CommandOverlaySetShowScrollBottleneckRects: + *t = CommandOverlaySetShowScrollBottleneckRects + case CommandOverlaySetShowViewportSizeOnResize: + *t = CommandOverlaySetShowViewportSizeOnResize + case CommandOverlaySetPausedInDebuggerMessage: + *t = CommandOverlaySetPausedInDebuggerMessage + case CommandOverlaySetSuspended: + *t = CommandOverlaySetSuspended + case CommandOverlaySetInspectMode: + *t = CommandOverlaySetInspectMode + case CommandOverlayHighlightRect: + *t = CommandOverlayHighlightRect + case CommandOverlayHighlightQuad: + *t = CommandOverlayHighlightQuad + case CommandOverlayHighlightNode: + *t = CommandOverlayHighlightNode + case CommandOverlayHighlightFrame: + *t = CommandOverlayHighlightFrame + case CommandOverlayHideHighlight: + *t = CommandOverlayHideHighlight + case CommandOverlayGetHighlightObjectForTest: + *t = CommandOverlayGetHighlightObjectForTest case EventEmulationVirtualTimeBudgetExpired: *t = EventEmulationVirtualTimeBudgetExpired case CommandEmulationSetDeviceMetricsOverride: @@ -771,8 +798,6 @@ func (t *MethodType) UnmarshalEasyJSON(in *jlexer.Lexer) { *t = CommandApplicationCacheGetApplicationCacheForFrame case EventDOMDocumentUpdated: *t = EventDOMDocumentUpdated - case EventDOMInspectNodeRequested: - *t = EventDOMInspectNodeRequested case EventDOMSetChildNodes: *t = EventDOMSetChildNodes case EventDOMAttributeModified: @@ -799,8 +824,6 @@ func (t *MethodType) UnmarshalEasyJSON(in *jlexer.Lexer) { *t = EventDOMPseudoElementRemoved case EventDOMDistributedNodesUpdated: *t = EventDOMDistributedNodesUpdated - case EventDOMNodeHighlightRequested: - *t = EventDOMNodeHighlightRequested case CommandDOMEnable: *t = CommandDOMEnable case CommandDOMDisable: @@ -841,18 +864,6 @@ func (t *MethodType) UnmarshalEasyJSON(in *jlexer.Lexer) { *t = CommandDOMDiscardSearchResults case CommandDOMRequestNode: *t = CommandDOMRequestNode - case CommandDOMSetInspectMode: - *t = CommandDOMSetInspectMode - case CommandDOMHighlightRect: - *t = CommandDOMHighlightRect - case CommandDOMHighlightQuad: - *t = CommandDOMHighlightQuad - case CommandDOMHighlightNode: - *t = CommandDOMHighlightNode - case CommandDOMHideHighlight: - *t = CommandDOMHideHighlight - case CommandDOMHighlightFrame: - *t = CommandDOMHighlightFrame case CommandDOMPushNodeByPathToFrontend: *t = CommandDOMPushNodeByPathToFrontend case CommandDOMPushNodesByBackendIdsToFrontend: @@ -883,8 +894,6 @@ func (t *MethodType) UnmarshalEasyJSON(in *jlexer.Lexer) { *t = CommandDOMGetNodeForLocation case CommandDOMGetRelayoutBoundary: *t = CommandDOMGetRelayoutBoundary - case CommandDOMGetHighlightObjectForTest: - *t = CommandDOMGetHighlightObjectForTest case EventCSSMediaQueryResultChanged: *t = EventCSSMediaQueryResultChanged case EventCSSFontsUpdated: diff --git a/cdp/cdputil/cdputil.go b/cdp/cdputil/cdputil.go index 56fd806..9902c16 100644 --- a/cdp/cdputil/cdputil.go +++ b/cdp/cdputil/cdputil.go @@ -26,6 +26,7 @@ import ( logdom "github.com/knq/chromedp/cdp/log" "github.com/knq/chromedp/cdp/memory" "github.com/knq/chromedp/cdp/network" + "github.com/knq/chromedp/cdp/overlay" "github.com/knq/chromedp/cdp/page" "github.com/knq/chromedp/cdp/profiler" "github.com/knq/chromedp/cdp/runtime" @@ -128,9 +129,6 @@ func UnmarshalMessage(msg *cdp.Message) (interface{}, error) { case cdp.CommandPageHandleJavaScriptDialog: return emptyVal, nil - case cdp.CommandPageConfigureOverlay: - return emptyVal, nil - case cdp.CommandPageGetAppManifest: v = new(page.GetAppManifestReturns) @@ -197,21 +195,60 @@ func UnmarshalMessage(msg *cdp.Message) (interface{}, error) { case cdp.EventPageNavigationRequested: v = new(page.EventNavigationRequested) - case cdp.CommandRenderingSetShowPaintRects: + case cdp.CommandOverlayEnable: return emptyVal, nil - case cdp.CommandRenderingSetShowDebugBorders: + case cdp.CommandOverlayDisable: return emptyVal, nil - case cdp.CommandRenderingSetShowFPSCounter: + case cdp.CommandOverlaySetShowPaintRects: return emptyVal, nil - case cdp.CommandRenderingSetShowScrollBottleneckRects: + case cdp.CommandOverlaySetShowDebugBorders: return emptyVal, nil - case cdp.CommandRenderingSetShowViewportSizeOnResize: + case cdp.CommandOverlaySetShowFPSCounter: return emptyVal, nil + case cdp.CommandOverlaySetShowScrollBottleneckRects: + return emptyVal, nil + + case cdp.CommandOverlaySetShowViewportSizeOnResize: + return emptyVal, nil + + case cdp.CommandOverlaySetPausedInDebuggerMessage: + return emptyVal, nil + + case cdp.CommandOverlaySetSuspended: + return emptyVal, nil + + case cdp.CommandOverlaySetInspectMode: + return emptyVal, nil + + case cdp.CommandOverlayHighlightRect: + return emptyVal, nil + + case cdp.CommandOverlayHighlightQuad: + return emptyVal, nil + + case cdp.CommandOverlayHighlightNode: + return emptyVal, nil + + case cdp.CommandOverlayHighlightFrame: + return emptyVal, nil + + case cdp.CommandOverlayHideHighlight: + return emptyVal, nil + + case cdp.CommandOverlayGetHighlightObjectForTest: + v = new(overlay.GetHighlightObjectForTestReturns) + + case cdp.EventOverlayNodeHighlightRequested: + v = new(overlay.EventNodeHighlightRequested) + + case cdp.EventOverlayInspectNodeRequested: + v = new(overlay.EventInspectNodeRequested) + case cdp.CommandEmulationSetDeviceMetricsOverride: return emptyVal, nil @@ -548,24 +585,6 @@ func UnmarshalMessage(msg *cdp.Message) (interface{}, error) { case cdp.CommandDOMRequestNode: v = new(dom.RequestNodeReturns) - case cdp.CommandDOMSetInspectMode: - return emptyVal, nil - - case cdp.CommandDOMHighlightRect: - return emptyVal, nil - - case cdp.CommandDOMHighlightQuad: - return emptyVal, nil - - case cdp.CommandDOMHighlightNode: - return emptyVal, nil - - case cdp.CommandDOMHideHighlight: - return emptyVal, nil - - case cdp.CommandDOMHighlightFrame: - return emptyVal, nil - case cdp.CommandDOMPushNodeByPathToFrontend: v = new(dom.PushNodeByPathToFrontendReturns) @@ -611,15 +630,9 @@ func UnmarshalMessage(msg *cdp.Message) (interface{}, error) { case cdp.CommandDOMGetRelayoutBoundary: v = new(dom.GetRelayoutBoundaryReturns) - case cdp.CommandDOMGetHighlightObjectForTest: - v = new(dom.GetHighlightObjectForTestReturns) - case cdp.EventDOMDocumentUpdated: v = new(dom.EventDocumentUpdated) - case cdp.EventDOMInspectNodeRequested: - v = new(dom.EventInspectNodeRequested) - case cdp.EventDOMSetChildNodes: v = new(dom.EventSetChildNodes) @@ -659,9 +672,6 @@ func UnmarshalMessage(msg *cdp.Message) (interface{}, error) { case cdp.EventDOMDistributedNodesUpdated: v = new(dom.EventDistributedNodesUpdated) - case cdp.EventDOMNodeHighlightRequested: - v = new(dom.EventNodeHighlightRequested) - case cdp.CommandCSSEnable: return emptyVal, nil diff --git a/cdp/css/easyjson.go b/cdp/css/easyjson.go index 090e5f8..461fcd9 100644 --- a/cdp/css/easyjson.go +++ b/cdp/css/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package css diff --git a/cdp/database/easyjson.go b/cdp/database/easyjson.go index fa68999..a99468b 100644 --- a/cdp/database/easyjson.go +++ b/cdp/database/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package database diff --git a/cdp/debugger/easyjson.go b/cdp/debugger/easyjson.go index baae41a..2743aa3 100644 --- a/cdp/debugger/easyjson.go +++ b/cdp/debugger/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package debugger diff --git a/cdp/deviceorientation/easyjson.go b/cdp/deviceorientation/easyjson.go index 75e5b6c..f8ac649 100644 --- a/cdp/deviceorientation/easyjson.go +++ b/cdp/deviceorientation/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package deviceorientation diff --git a/cdp/dom/dom.go b/cdp/dom/dom.go index 1259961..cec7f71 100644 --- a/cdp/dom/dom.go +++ b/cdp/dom/dom.go @@ -21,7 +21,6 @@ import ( cdp "github.com/knq/chromedp/cdp" "github.com/knq/chromedp/cdp/runtime" - "github.com/mailru/easyjson" ) // EnableParams enables DOM agent for the given page. @@ -705,217 +704,6 @@ func (p *RequestNodeParams) Do(ctxt context.Context, h cdp.Handler) (nodeID cdp. return res.NodeID, nil } -// SetInspectModeParams enters the 'inspect' mode. In this mode, elements -// that user is hovering over are highlighted. Backend then generates -// 'inspectNodeRequested' event upon element selection. -type SetInspectModeParams struct { - Mode InspectMode `json:"mode"` // Set an inspection mode. - HighlightConfig *HighlightConfig `json:"highlightConfig,omitempty"` // A descriptor for the highlight appearance of hovered-over nodes. May be omitted if enabled == false. -} - -// SetInspectMode enters the 'inspect' mode. In this mode, elements that user -// is hovering over are highlighted. Backend then generates -// 'inspectNodeRequested' event upon element selection. -// -// parameters: -// mode - Set an inspection mode. -func SetInspectMode(mode InspectMode) *SetInspectModeParams { - return &SetInspectModeParams{ - Mode: mode, - } -} - -// WithHighlightConfig a descriptor for the highlight appearance of -// hovered-over nodes. May be omitted if enabled == false. -func (p SetInspectModeParams) WithHighlightConfig(highlightConfig *HighlightConfig) *SetInspectModeParams { - p.HighlightConfig = highlightConfig - return &p -} - -// Do executes DOM.setInspectMode against the provided context and -// target handler. -func (p *SetInspectModeParams) Do(ctxt context.Context, h cdp.Handler) (err error) { - return h.Execute(ctxt, cdp.CommandDOMSetInspectMode, p, nil) -} - -// HighlightRectParams highlights given rectangle. Coordinates are absolute -// with respect to the main frame viewport. -type HighlightRectParams struct { - X int64 `json:"x"` // X coordinate - Y int64 `json:"y"` // Y coordinate - Width int64 `json:"width"` // Rectangle width - Height int64 `json:"height"` // Rectangle height - Color *cdp.RGBA `json:"color,omitempty"` // The highlight fill color (default: transparent). - OutlineColor *cdp.RGBA `json:"outlineColor,omitempty"` // The highlight outline color (default: transparent). -} - -// HighlightRect highlights given rectangle. Coordinates are absolute with -// respect to the main frame viewport. -// -// parameters: -// x - X coordinate -// y - Y coordinate -// width - Rectangle width -// height - Rectangle height -func HighlightRect(x int64, y int64, width int64, height int64) *HighlightRectParams { - return &HighlightRectParams{ - X: x, - Y: y, - Width: width, - Height: height, - } -} - -// WithColor the highlight fill color (default: transparent). -func (p HighlightRectParams) WithColor(color *cdp.RGBA) *HighlightRectParams { - p.Color = color - return &p -} - -// WithOutlineColor the highlight outline color (default: transparent). -func (p HighlightRectParams) WithOutlineColor(outlineColor *cdp.RGBA) *HighlightRectParams { - p.OutlineColor = outlineColor - return &p -} - -// Do executes DOM.highlightRect against the provided context and -// target handler. -func (p *HighlightRectParams) Do(ctxt context.Context, h cdp.Handler) (err error) { - return h.Execute(ctxt, cdp.CommandDOMHighlightRect, p, nil) -} - -// HighlightQuadParams highlights given quad. Coordinates are absolute with -// respect to the main frame viewport. -type HighlightQuadParams struct { - Quad Quad `json:"quad"` // Quad to highlight - Color *cdp.RGBA `json:"color,omitempty"` // The highlight fill color (default: transparent). - OutlineColor *cdp.RGBA `json:"outlineColor,omitempty"` // The highlight outline color (default: transparent). -} - -// HighlightQuad highlights given quad. Coordinates are absolute with respect -// to the main frame viewport. -// -// parameters: -// quad - Quad to highlight -func HighlightQuad(quad Quad) *HighlightQuadParams { - return &HighlightQuadParams{ - Quad: quad, - } -} - -// WithColor the highlight fill color (default: transparent). -func (p HighlightQuadParams) WithColor(color *cdp.RGBA) *HighlightQuadParams { - p.Color = color - return &p -} - -// WithOutlineColor the highlight outline color (default: transparent). -func (p HighlightQuadParams) WithOutlineColor(outlineColor *cdp.RGBA) *HighlightQuadParams { - p.OutlineColor = outlineColor - return &p -} - -// Do executes DOM.highlightQuad against the provided context and -// target handler. -func (p *HighlightQuadParams) Do(ctxt context.Context, h cdp.Handler) (err error) { - return h.Execute(ctxt, cdp.CommandDOMHighlightQuad, p, nil) -} - -// HighlightNodeParams highlights DOM node with given id or with the given -// JavaScript object wrapper. Either nodeId or objectId must be specified. -type HighlightNodeParams struct { - HighlightConfig *HighlightConfig `json:"highlightConfig"` // A descriptor for the highlight appearance. - NodeID cdp.NodeID `json:"nodeId,omitempty"` // Identifier of the node to highlight. - BackendNodeID cdp.BackendNodeID `json:"backendNodeId,omitempty"` // Identifier of the backend node to highlight. - ObjectID runtime.RemoteObjectID `json:"objectId,omitempty"` // JavaScript object id of the node to be highlighted. -} - -// HighlightNode highlights DOM node with given id or with the given -// JavaScript object wrapper. Either nodeId or objectId must be specified. -// -// parameters: -// highlightConfig - A descriptor for the highlight appearance. -func HighlightNode(highlightConfig *HighlightConfig) *HighlightNodeParams { - return &HighlightNodeParams{ - HighlightConfig: highlightConfig, - } -} - -// WithNodeID identifier of the node to highlight. -func (p HighlightNodeParams) WithNodeID(nodeID cdp.NodeID) *HighlightNodeParams { - p.NodeID = nodeID - return &p -} - -// WithBackendNodeID identifier of the backend node to highlight. -func (p HighlightNodeParams) WithBackendNodeID(backendNodeID cdp.BackendNodeID) *HighlightNodeParams { - p.BackendNodeID = backendNodeID - return &p -} - -// WithObjectID javaScript object id of the node to be highlighted. -func (p HighlightNodeParams) WithObjectID(objectID runtime.RemoteObjectID) *HighlightNodeParams { - p.ObjectID = objectID - return &p -} - -// Do executes DOM.highlightNode against the provided context and -// target handler. -func (p *HighlightNodeParams) Do(ctxt context.Context, h cdp.Handler) (err error) { - return h.Execute(ctxt, cdp.CommandDOMHighlightNode, p, nil) -} - -// HideHighlightParams hides DOM node highlight. -type HideHighlightParams struct{} - -// HideHighlight hides DOM node highlight. -func HideHighlight() *HideHighlightParams { - return &HideHighlightParams{} -} - -// Do executes DOM.hideHighlight against the provided context and -// target handler. -func (p *HideHighlightParams) Do(ctxt context.Context, h cdp.Handler) (err error) { - return h.Execute(ctxt, cdp.CommandDOMHideHighlight, nil, nil) -} - -// HighlightFrameParams highlights owner element of the frame with given id. -type HighlightFrameParams struct { - FrameID cdp.FrameID `json:"frameId"` // Identifier of the frame to highlight. - ContentColor *cdp.RGBA `json:"contentColor,omitempty"` // The content box highlight fill color (default: transparent). - ContentOutlineColor *cdp.RGBA `json:"contentOutlineColor,omitempty"` // The content box highlight outline color (default: transparent). -} - -// HighlightFrame highlights owner element of the frame with given id. -// -// parameters: -// frameID - Identifier of the frame to highlight. -func HighlightFrame(frameID cdp.FrameID) *HighlightFrameParams { - return &HighlightFrameParams{ - FrameID: frameID, - } -} - -// WithContentColor the content box highlight fill color (default: -// transparent). -func (p HighlightFrameParams) WithContentColor(contentColor *cdp.RGBA) *HighlightFrameParams { - p.ContentColor = contentColor - return &p -} - -// WithContentOutlineColor the content box highlight outline color (default: -// transparent). -func (p HighlightFrameParams) WithContentOutlineColor(contentOutlineColor *cdp.RGBA) *HighlightFrameParams { - p.ContentOutlineColor = contentOutlineColor - return &p -} - -// Do executes DOM.highlightFrame against the provided context and -// target handler. -func (p *HighlightFrameParams) Do(ctxt context.Context, h cdp.Handler) (err error) { - return h.Execute(ctxt, cdp.CommandDOMHighlightFrame, p, nil) -} - // PushNodeByPathToFrontendParams requests that the node is sent to the // caller given its path. // FIXME, use XPath. type PushNodeByPathToFrontendParams struct { @@ -1400,39 +1188,3 @@ func (p *GetRelayoutBoundaryParams) Do(ctxt context.Context, h cdp.Handler) (nod return res.NodeID, nil } - -// GetHighlightObjectForTestParams for testing. -type GetHighlightObjectForTestParams struct { - NodeID cdp.NodeID `json:"nodeId"` // Id of the node to get highlight object for. -} - -// GetHighlightObjectForTest for testing. -// -// parameters: -// nodeID - Id of the node to get highlight object for. -func GetHighlightObjectForTest(nodeID cdp.NodeID) *GetHighlightObjectForTestParams { - return &GetHighlightObjectForTestParams{ - NodeID: nodeID, - } -} - -// GetHighlightObjectForTestReturns return values. -type GetHighlightObjectForTestReturns struct { - Highlight easyjson.RawMessage `json:"highlight,omitempty"` -} - -// Do executes DOM.getHighlightObjectForTest against the provided context and -// target handler. -// -// returns: -// highlight - Highlight data for the node. -func (p *GetHighlightObjectForTestParams) Do(ctxt context.Context, h cdp.Handler) (highlight easyjson.RawMessage, err error) { - // execute - var res GetHighlightObjectForTestReturns - err = h.Execute(ctxt, cdp.CommandDOMGetHighlightObjectForTest, p, &res) - if err != nil { - return nil, err - } - - return res.Highlight, nil -} diff --git a/cdp/dom/easyjson.go b/cdp/dom/easyjson.go index 08ee939..aaadeb4 100644 --- a/cdp/dom/easyjson.go +++ b/cdp/dom/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package dom @@ -624,96 +624,7 @@ func (v *SetInspectedNodeParams) UnmarshalJSON(data []byte) error { func (v *SetInspectedNodeParams) UnmarshalEasyJSON(l *jlexer.Lexer) { easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom6(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom7(in *jlexer.Lexer, out *SetInspectModeParams) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "mode": - (out.Mode).UnmarshalEasyJSON(in) - case "highlightConfig": - if in.IsNull() { - in.Skip() - out.HighlightConfig = nil - } else { - if out.HighlightConfig == nil { - out.HighlightConfig = new(HighlightConfig) - } - (*out.HighlightConfig).UnmarshalEasyJSON(in) - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom7(out *jwriter.Writer, in SetInspectModeParams) { - out.RawByte('{') - first := true - _ = first - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"mode\":") - (in.Mode).MarshalEasyJSON(out) - if in.HighlightConfig != nil { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"highlightConfig\":") - if in.HighlightConfig == nil { - out.RawString("null") - } else { - (*in.HighlightConfig).MarshalEasyJSON(out) - } - } - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v SetInspectModeParams) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom7(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v SetInspectModeParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom7(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *SetInspectModeParams) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom7(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *SetInspectModeParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom7(l, v) -} -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom8(in *jlexer.Lexer, out *SetFileInputFilesParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom7(in *jlexer.Lexer, out *SetFileInputFilesParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -767,7 +678,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom8(in *jlexer.Lexer, out *Se in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom8(out *jwriter.Writer, in SetFileInputFilesParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom7(out *jwriter.Writer, in SetFileInputFilesParams) { out.RawByte('{') first := true _ = first @@ -800,27 +711,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom8(out *jwriter.Writer, in S // MarshalJSON supports json.Marshaler interface func (v SetFileInputFilesParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom8(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom7(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v SetFileInputFilesParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom8(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom7(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *SetFileInputFilesParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom8(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom7(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *SetFileInputFilesParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom8(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom7(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom9(in *jlexer.Lexer, out *SetAttributesAsTextParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom8(in *jlexer.Lexer, out *SetAttributesAsTextParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -855,7 +766,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom9(in *jlexer.Lexer, out *Se in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom9(out *jwriter.Writer, in SetAttributesAsTextParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom8(out *jwriter.Writer, in SetAttributesAsTextParams) { out.RawByte('{') first := true _ = first @@ -885,27 +796,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom9(out *jwriter.Writer, in S // MarshalJSON supports json.Marshaler interface func (v SetAttributesAsTextParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom9(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom8(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v SetAttributesAsTextParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom9(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom8(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *SetAttributesAsTextParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom9(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom8(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *SetAttributesAsTextParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom9(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom8(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom10(in *jlexer.Lexer, out *SetAttributeValueParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom9(in *jlexer.Lexer, out *SetAttributeValueParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -940,7 +851,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom10(in *jlexer.Lexer, out *S in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom10(out *jwriter.Writer, in SetAttributeValueParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom9(out *jwriter.Writer, in SetAttributeValueParams) { out.RawByte('{') first := true _ = first @@ -968,27 +879,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom10(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v SetAttributeValueParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom10(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom9(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v SetAttributeValueParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom10(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom9(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *SetAttributeValueParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom10(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom9(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *SetAttributeValueParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom10(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom9(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom11(in *jlexer.Lexer, out *ResolveNodeReturns) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom10(in *jlexer.Lexer, out *ResolveNodeReturns) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -1027,7 +938,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom11(in *jlexer.Lexer, out *R in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom11(out *jwriter.Writer, in ResolveNodeReturns) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom10(out *jwriter.Writer, in ResolveNodeReturns) { out.RawByte('{') first := true _ = first @@ -1049,27 +960,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom11(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v ResolveNodeReturns) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom11(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom10(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v ResolveNodeReturns) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom11(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom10(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *ResolveNodeReturns) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom11(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom10(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *ResolveNodeReturns) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom11(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom10(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom12(in *jlexer.Lexer, out *ResolveNodeParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom11(in *jlexer.Lexer, out *ResolveNodeParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -1102,7 +1013,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom12(in *jlexer.Lexer, out *R in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom12(out *jwriter.Writer, in ResolveNodeParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom11(out *jwriter.Writer, in ResolveNodeParams) { out.RawByte('{') first := true _ = first @@ -1126,27 +1037,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom12(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v ResolveNodeParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom12(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom11(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v ResolveNodeParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom12(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom11(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *ResolveNodeParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom12(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom11(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *ResolveNodeParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom12(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom11(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom13(in *jlexer.Lexer, out *RequestNodeReturns) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom12(in *jlexer.Lexer, out *RequestNodeReturns) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -1177,7 +1088,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom13(in *jlexer.Lexer, out *R in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom13(out *jwriter.Writer, in RequestNodeReturns) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom12(out *jwriter.Writer, in RequestNodeReturns) { out.RawByte('{') first := true _ = first @@ -1195,27 +1106,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom13(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v RequestNodeReturns) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom13(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom12(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v RequestNodeReturns) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom13(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom12(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *RequestNodeReturns) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom13(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom12(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *RequestNodeReturns) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom13(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom12(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom14(in *jlexer.Lexer, out *RequestNodeParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom13(in *jlexer.Lexer, out *RequestNodeParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -1246,7 +1157,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom14(in *jlexer.Lexer, out *R in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom14(out *jwriter.Writer, in RequestNodeParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom13(out *jwriter.Writer, in RequestNodeParams) { out.RawByte('{') first := true _ = first @@ -1262,27 +1173,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom14(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v RequestNodeParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom14(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom13(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v RequestNodeParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom14(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom13(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *RequestNodeParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom14(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom13(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *RequestNodeParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom14(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom13(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom15(in *jlexer.Lexer, out *RequestChildNodesParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom14(in *jlexer.Lexer, out *RequestChildNodesParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -1317,7 +1228,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom15(in *jlexer.Lexer, out *R in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom15(out *jwriter.Writer, in RequestChildNodesParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom14(out *jwriter.Writer, in RequestChildNodesParams) { out.RawByte('{') first := true _ = first @@ -1349,27 +1260,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom15(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v RequestChildNodesParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom15(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom14(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v RequestChildNodesParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom15(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom14(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *RequestChildNodesParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom15(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom14(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *RequestChildNodesParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom15(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom14(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom16(in *jlexer.Lexer, out *RemoveNodeParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom15(in *jlexer.Lexer, out *RemoveNodeParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -1400,7 +1311,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom16(in *jlexer.Lexer, out *R in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom16(out *jwriter.Writer, in RemoveNodeParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom15(out *jwriter.Writer, in RemoveNodeParams) { out.RawByte('{') first := true _ = first @@ -1416,27 +1327,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom16(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v RemoveNodeParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom16(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom15(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v RemoveNodeParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom16(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom15(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *RemoveNodeParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom16(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom15(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *RemoveNodeParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom16(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom15(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom17(in *jlexer.Lexer, out *RemoveAttributeParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom16(in *jlexer.Lexer, out *RemoveAttributeParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -1469,7 +1380,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom17(in *jlexer.Lexer, out *R in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom17(out *jwriter.Writer, in RemoveAttributeParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom16(out *jwriter.Writer, in RemoveAttributeParams) { out.RawByte('{') first := true _ = first @@ -1491,27 +1402,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom17(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v RemoveAttributeParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom17(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom16(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v RemoveAttributeParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom17(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom16(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *RemoveAttributeParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom17(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom16(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *RemoveAttributeParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom17(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom16(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom18(in *jlexer.Lexer, out *RedoParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom17(in *jlexer.Lexer, out *RedoParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -1540,7 +1451,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom18(in *jlexer.Lexer, out *R in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom18(out *jwriter.Writer, in RedoParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom17(out *jwriter.Writer, in RedoParams) { out.RawByte('{') first := true _ = first @@ -1550,27 +1461,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom18(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v RedoParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom18(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom17(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v RedoParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom18(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom17(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *RedoParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom18(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom17(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *RedoParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom18(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom17(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom19(in *jlexer.Lexer, out *Rect) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom18(in *jlexer.Lexer, out *Rect) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -1607,7 +1518,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom19(in *jlexer.Lexer, out *R in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom19(out *jwriter.Writer, in Rect) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom18(out *jwriter.Writer, in Rect) { out.RawByte('{') first := true _ = first @@ -1649,27 +1560,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom19(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v Rect) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom19(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom18(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v Rect) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom19(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom18(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *Rect) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom19(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom18(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *Rect) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom19(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom18(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom20(in *jlexer.Lexer, out *QuerySelectorReturns) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom19(in *jlexer.Lexer, out *QuerySelectorReturns) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -1700,7 +1611,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom20(in *jlexer.Lexer, out *Q in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom20(out *jwriter.Writer, in QuerySelectorReturns) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom19(out *jwriter.Writer, in QuerySelectorReturns) { out.RawByte('{') first := true _ = first @@ -1718,27 +1629,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom20(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v QuerySelectorReturns) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom20(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom19(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v QuerySelectorReturns) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom20(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom19(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *QuerySelectorReturns) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom20(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom19(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *QuerySelectorReturns) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom20(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom19(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom21(in *jlexer.Lexer, out *QuerySelectorParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom20(in *jlexer.Lexer, out *QuerySelectorParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -1771,7 +1682,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom21(in *jlexer.Lexer, out *Q in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom21(out *jwriter.Writer, in QuerySelectorParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom20(out *jwriter.Writer, in QuerySelectorParams) { out.RawByte('{') first := true _ = first @@ -1793,27 +1704,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom21(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v QuerySelectorParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom21(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom20(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v QuerySelectorParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom21(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom20(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *QuerySelectorParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom21(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom20(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *QuerySelectorParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom21(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom20(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom22(in *jlexer.Lexer, out *QuerySelectorAllReturns) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom21(in *jlexer.Lexer, out *QuerySelectorAllReturns) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -1865,7 +1776,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom22(in *jlexer.Lexer, out *Q in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom22(out *jwriter.Writer, in QuerySelectorAllReturns) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom21(out *jwriter.Writer, in QuerySelectorAllReturns) { out.RawByte('{') first := true _ = first @@ -1894,27 +1805,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom22(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v QuerySelectorAllReturns) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom22(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom21(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v QuerySelectorAllReturns) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom22(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom21(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *QuerySelectorAllReturns) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom22(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom21(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *QuerySelectorAllReturns) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom22(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom21(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom23(in *jlexer.Lexer, out *QuerySelectorAllParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom22(in *jlexer.Lexer, out *QuerySelectorAllParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -1947,7 +1858,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom23(in *jlexer.Lexer, out *Q in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom23(out *jwriter.Writer, in QuerySelectorAllParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom22(out *jwriter.Writer, in QuerySelectorAllParams) { out.RawByte('{') first := true _ = first @@ -1969,27 +1880,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom23(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v QuerySelectorAllParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom23(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom22(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v QuerySelectorAllParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom23(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom22(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *QuerySelectorAllParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom23(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom22(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *QuerySelectorAllParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom23(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom22(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom24(in *jlexer.Lexer, out *PushNodesByBackendIdsToFrontendReturns) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom23(in *jlexer.Lexer, out *PushNodesByBackendIdsToFrontendReturns) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -2041,7 +1952,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom24(in *jlexer.Lexer, out *P in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom24(out *jwriter.Writer, in PushNodesByBackendIdsToFrontendReturns) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom23(out *jwriter.Writer, in PushNodesByBackendIdsToFrontendReturns) { out.RawByte('{') first := true _ = first @@ -2070,27 +1981,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom24(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v PushNodesByBackendIdsToFrontendReturns) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom24(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom23(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v PushNodesByBackendIdsToFrontendReturns) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom24(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom23(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *PushNodesByBackendIdsToFrontendReturns) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom24(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom23(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *PushNodesByBackendIdsToFrontendReturns) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom24(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom23(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom25(in *jlexer.Lexer, out *PushNodesByBackendIdsToFrontendParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom24(in *jlexer.Lexer, out *PushNodesByBackendIdsToFrontendParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -2142,7 +2053,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom25(in *jlexer.Lexer, out *P in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom25(out *jwriter.Writer, in PushNodesByBackendIdsToFrontendParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom24(out *jwriter.Writer, in PushNodesByBackendIdsToFrontendParams) { out.RawByte('{') first := true _ = first @@ -2169,27 +2080,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom25(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v PushNodesByBackendIdsToFrontendParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom25(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom24(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v PushNodesByBackendIdsToFrontendParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom25(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom24(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *PushNodesByBackendIdsToFrontendParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom25(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom24(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *PushNodesByBackendIdsToFrontendParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom25(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom24(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom26(in *jlexer.Lexer, out *PushNodeByPathToFrontendReturns) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom25(in *jlexer.Lexer, out *PushNodeByPathToFrontendReturns) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -2220,7 +2131,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom26(in *jlexer.Lexer, out *P in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom26(out *jwriter.Writer, in PushNodeByPathToFrontendReturns) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom25(out *jwriter.Writer, in PushNodeByPathToFrontendReturns) { out.RawByte('{') first := true _ = first @@ -2238,27 +2149,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom26(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v PushNodeByPathToFrontendReturns) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom26(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom25(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v PushNodeByPathToFrontendReturns) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom26(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom25(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *PushNodeByPathToFrontendReturns) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom26(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom25(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *PushNodeByPathToFrontendReturns) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom26(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom25(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom27(in *jlexer.Lexer, out *PushNodeByPathToFrontendParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom26(in *jlexer.Lexer, out *PushNodeByPathToFrontendParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -2289,7 +2200,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom27(in *jlexer.Lexer, out *P in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom27(out *jwriter.Writer, in PushNodeByPathToFrontendParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom26(out *jwriter.Writer, in PushNodeByPathToFrontendParams) { out.RawByte('{') first := true _ = first @@ -2305,27 +2216,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom27(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v PushNodeByPathToFrontendParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom27(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom26(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v PushNodeByPathToFrontendParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom27(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom26(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *PushNodeByPathToFrontendParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom27(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom26(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *PushNodeByPathToFrontendParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom27(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom26(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom28(in *jlexer.Lexer, out *PerformSearchReturns) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom27(in *jlexer.Lexer, out *PerformSearchReturns) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -2358,7 +2269,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom28(in *jlexer.Lexer, out *P in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom28(out *jwriter.Writer, in PerformSearchReturns) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom27(out *jwriter.Writer, in PerformSearchReturns) { out.RawByte('{') first := true _ = first @@ -2384,27 +2295,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom28(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v PerformSearchReturns) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom28(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom27(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v PerformSearchReturns) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom28(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom27(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *PerformSearchReturns) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom28(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom27(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *PerformSearchReturns) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom28(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom27(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom29(in *jlexer.Lexer, out *PerformSearchParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom28(in *jlexer.Lexer, out *PerformSearchParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -2437,7 +2348,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom29(in *jlexer.Lexer, out *P in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom29(out *jwriter.Writer, in PerformSearchParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom28(out *jwriter.Writer, in PerformSearchParams) { out.RawByte('{') first := true _ = first @@ -2461,27 +2372,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom29(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v PerformSearchParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom29(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom28(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v PerformSearchParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom29(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom28(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *PerformSearchParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom29(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom28(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *PerformSearchParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom29(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom28(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom30(in *jlexer.Lexer, out *MoveToReturns) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom29(in *jlexer.Lexer, out *MoveToReturns) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -2512,7 +2423,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom30(in *jlexer.Lexer, out *M in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom30(out *jwriter.Writer, in MoveToReturns) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom29(out *jwriter.Writer, in MoveToReturns) { out.RawByte('{') first := true _ = first @@ -2530,27 +2441,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom30(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v MoveToReturns) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom30(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom29(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v MoveToReturns) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom30(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom29(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *MoveToReturns) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom30(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom29(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *MoveToReturns) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom30(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom29(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom31(in *jlexer.Lexer, out *MoveToParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom30(in *jlexer.Lexer, out *MoveToParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -2585,7 +2496,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom31(in *jlexer.Lexer, out *M in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom31(out *jwriter.Writer, in MoveToParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom30(out *jwriter.Writer, in MoveToParams) { out.RawByte('{') first := true _ = first @@ -2615,27 +2526,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom31(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v MoveToParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom31(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom30(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v MoveToParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom31(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom30(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *MoveToParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom31(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom30(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *MoveToParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom31(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom30(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom32(in *jlexer.Lexer, out *MarkUndoableStateParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom31(in *jlexer.Lexer, out *MarkUndoableStateParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -2664,7 +2575,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom32(in *jlexer.Lexer, out *M in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom32(out *jwriter.Writer, in MarkUndoableStateParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom31(out *jwriter.Writer, in MarkUndoableStateParams) { out.RawByte('{') first := true _ = first @@ -2674,847 +2585,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom32(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v MarkUndoableStateParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom32(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom31(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v MarkUndoableStateParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom32(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom31(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *MarkUndoableStateParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom32(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom31(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *MarkUndoableStateParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom32(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom31(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom33(in *jlexer.Lexer, out *HighlightRectParams) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "x": - out.X = int64(in.Int64()) - case "y": - out.Y = int64(in.Int64()) - case "width": - out.Width = int64(in.Int64()) - case "height": - out.Height = int64(in.Int64()) - case "color": - if in.IsNull() { - in.Skip() - out.Color = nil - } else { - if out.Color == nil { - out.Color = new(cdp.RGBA) - } - (*out.Color).UnmarshalEasyJSON(in) - } - case "outlineColor": - if in.IsNull() { - in.Skip() - out.OutlineColor = nil - } else { - if out.OutlineColor == nil { - out.OutlineColor = new(cdp.RGBA) - } - (*out.OutlineColor).UnmarshalEasyJSON(in) - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom33(out *jwriter.Writer, in HighlightRectParams) { - out.RawByte('{') - first := true - _ = first - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"x\":") - out.Int64(int64(in.X)) - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"y\":") - out.Int64(int64(in.Y)) - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"width\":") - out.Int64(int64(in.Width)) - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"height\":") - out.Int64(int64(in.Height)) - if in.Color != nil { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"color\":") - if in.Color == nil { - out.RawString("null") - } else { - (*in.Color).MarshalEasyJSON(out) - } - } - if in.OutlineColor != nil { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"outlineColor\":") - if in.OutlineColor == nil { - out.RawString("null") - } else { - (*in.OutlineColor).MarshalEasyJSON(out) - } - } - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v HighlightRectParams) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom33(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v HighlightRectParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom33(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *HighlightRectParams) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom33(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *HighlightRectParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom33(l, v) -} -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom34(in *jlexer.Lexer, out *HighlightQuadParams) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "quad": - if in.IsNull() { - in.Skip() - out.Quad = nil - } else { - in.Delim('[') - if out.Quad == nil { - if !in.IsDelim(']') { - out.Quad = make(Quad, 0, 8) - } else { - out.Quad = Quad{} - } - } else { - out.Quad = (out.Quad)[:0] - } - for !in.IsDelim(']') { - var v22 float64 - v22 = float64(in.Float64()) - out.Quad = append(out.Quad, v22) - in.WantComma() - } - in.Delim(']') - } - case "color": - if in.IsNull() { - in.Skip() - out.Color = nil - } else { - if out.Color == nil { - out.Color = new(cdp.RGBA) - } - (*out.Color).UnmarshalEasyJSON(in) - } - case "outlineColor": - if in.IsNull() { - in.Skip() - out.OutlineColor = nil - } else { - if out.OutlineColor == nil { - out.OutlineColor = new(cdp.RGBA) - } - (*out.OutlineColor).UnmarshalEasyJSON(in) - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom34(out *jwriter.Writer, in HighlightQuadParams) { - out.RawByte('{') - first := true - _ = first - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"quad\":") - if in.Quad == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 { - out.RawString("null") - } else { - out.RawByte('[') - for v23, v24 := range in.Quad { - if v23 > 0 { - out.RawByte(',') - } - out.Float64(float64(v24)) - } - out.RawByte(']') - } - if in.Color != nil { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"color\":") - if in.Color == nil { - out.RawString("null") - } else { - (*in.Color).MarshalEasyJSON(out) - } - } - if in.OutlineColor != nil { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"outlineColor\":") - if in.OutlineColor == nil { - out.RawString("null") - } else { - (*in.OutlineColor).MarshalEasyJSON(out) - } - } - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v HighlightQuadParams) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom34(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v HighlightQuadParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom34(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *HighlightQuadParams) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom34(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *HighlightQuadParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom34(l, v) -} -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom35(in *jlexer.Lexer, out *HighlightNodeParams) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "highlightConfig": - if in.IsNull() { - in.Skip() - out.HighlightConfig = nil - } else { - if out.HighlightConfig == nil { - out.HighlightConfig = new(HighlightConfig) - } - (*out.HighlightConfig).UnmarshalEasyJSON(in) - } - case "nodeId": - (out.NodeID).UnmarshalEasyJSON(in) - case "backendNodeId": - (out.BackendNodeID).UnmarshalEasyJSON(in) - case "objectId": - out.ObjectID = runtime.RemoteObjectID(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom35(out *jwriter.Writer, in HighlightNodeParams) { - out.RawByte('{') - first := true - _ = first - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"highlightConfig\":") - if in.HighlightConfig == nil { - out.RawString("null") - } else { - (*in.HighlightConfig).MarshalEasyJSON(out) - } - if in.NodeID != 0 { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"nodeId\":") - out.Int64(int64(in.NodeID)) - } - if in.BackendNodeID != 0 { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"backendNodeId\":") - out.Int64(int64(in.BackendNodeID)) - } - if in.ObjectID != "" { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"objectId\":") - out.String(string(in.ObjectID)) - } - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v HighlightNodeParams) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom35(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v HighlightNodeParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom35(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *HighlightNodeParams) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom35(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *HighlightNodeParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom35(l, v) -} -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom36(in *jlexer.Lexer, out *HighlightFrameParams) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "frameId": - (out.FrameID).UnmarshalEasyJSON(in) - case "contentColor": - if in.IsNull() { - in.Skip() - out.ContentColor = nil - } else { - if out.ContentColor == nil { - out.ContentColor = new(cdp.RGBA) - } - (*out.ContentColor).UnmarshalEasyJSON(in) - } - case "contentOutlineColor": - if in.IsNull() { - in.Skip() - out.ContentOutlineColor = nil - } else { - if out.ContentOutlineColor == nil { - out.ContentOutlineColor = new(cdp.RGBA) - } - (*out.ContentOutlineColor).UnmarshalEasyJSON(in) - } - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom36(out *jwriter.Writer, in HighlightFrameParams) { - out.RawByte('{') - first := true - _ = first - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"frameId\":") - out.String(string(in.FrameID)) - if in.ContentColor != nil { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"contentColor\":") - if in.ContentColor == nil { - out.RawString("null") - } else { - (*in.ContentColor).MarshalEasyJSON(out) - } - } - if in.ContentOutlineColor != nil { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"contentOutlineColor\":") - if in.ContentOutlineColor == nil { - out.RawString("null") - } else { - (*in.ContentOutlineColor).MarshalEasyJSON(out) - } - } - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v HighlightFrameParams) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom36(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v HighlightFrameParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom36(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *HighlightFrameParams) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom36(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *HighlightFrameParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom36(l, v) -} -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom37(in *jlexer.Lexer, out *HighlightConfig) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "showInfo": - out.ShowInfo = bool(in.Bool()) - case "showRulers": - out.ShowRulers = bool(in.Bool()) - case "showExtensionLines": - out.ShowExtensionLines = bool(in.Bool()) - case "displayAsMaterial": - out.DisplayAsMaterial = bool(in.Bool()) - case "contentColor": - if in.IsNull() { - in.Skip() - out.ContentColor = nil - } else { - if out.ContentColor == nil { - out.ContentColor = new(cdp.RGBA) - } - (*out.ContentColor).UnmarshalEasyJSON(in) - } - case "paddingColor": - if in.IsNull() { - in.Skip() - out.PaddingColor = nil - } else { - if out.PaddingColor == nil { - out.PaddingColor = new(cdp.RGBA) - } - (*out.PaddingColor).UnmarshalEasyJSON(in) - } - case "borderColor": - if in.IsNull() { - in.Skip() - out.BorderColor = nil - } else { - if out.BorderColor == nil { - out.BorderColor = new(cdp.RGBA) - } - (*out.BorderColor).UnmarshalEasyJSON(in) - } - case "marginColor": - if in.IsNull() { - in.Skip() - out.MarginColor = nil - } else { - if out.MarginColor == nil { - out.MarginColor = new(cdp.RGBA) - } - (*out.MarginColor).UnmarshalEasyJSON(in) - } - case "eventTargetColor": - if in.IsNull() { - in.Skip() - out.EventTargetColor = nil - } else { - if out.EventTargetColor == nil { - out.EventTargetColor = new(cdp.RGBA) - } - (*out.EventTargetColor).UnmarshalEasyJSON(in) - } - case "shapeColor": - if in.IsNull() { - in.Skip() - out.ShapeColor = nil - } else { - if out.ShapeColor == nil { - out.ShapeColor = new(cdp.RGBA) - } - (*out.ShapeColor).UnmarshalEasyJSON(in) - } - case "shapeMarginColor": - if in.IsNull() { - in.Skip() - out.ShapeMarginColor = nil - } else { - if out.ShapeMarginColor == nil { - out.ShapeMarginColor = new(cdp.RGBA) - } - (*out.ShapeMarginColor).UnmarshalEasyJSON(in) - } - case "selectorList": - out.SelectorList = string(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom37(out *jwriter.Writer, in HighlightConfig) { - out.RawByte('{') - first := true - _ = first - if in.ShowInfo { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"showInfo\":") - out.Bool(bool(in.ShowInfo)) - } - if in.ShowRulers { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"showRulers\":") - out.Bool(bool(in.ShowRulers)) - } - if in.ShowExtensionLines { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"showExtensionLines\":") - out.Bool(bool(in.ShowExtensionLines)) - } - if in.DisplayAsMaterial { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"displayAsMaterial\":") - out.Bool(bool(in.DisplayAsMaterial)) - } - if in.ContentColor != nil { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"contentColor\":") - if in.ContentColor == nil { - out.RawString("null") - } else { - (*in.ContentColor).MarshalEasyJSON(out) - } - } - if in.PaddingColor != nil { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"paddingColor\":") - if in.PaddingColor == nil { - out.RawString("null") - } else { - (*in.PaddingColor).MarshalEasyJSON(out) - } - } - if in.BorderColor != nil { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"borderColor\":") - if in.BorderColor == nil { - out.RawString("null") - } else { - (*in.BorderColor).MarshalEasyJSON(out) - } - } - if in.MarginColor != nil { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"marginColor\":") - if in.MarginColor == nil { - out.RawString("null") - } else { - (*in.MarginColor).MarshalEasyJSON(out) - } - } - if in.EventTargetColor != nil { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"eventTargetColor\":") - if in.EventTargetColor == nil { - out.RawString("null") - } else { - (*in.EventTargetColor).MarshalEasyJSON(out) - } - } - if in.ShapeColor != nil { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"shapeColor\":") - if in.ShapeColor == nil { - out.RawString("null") - } else { - (*in.ShapeColor).MarshalEasyJSON(out) - } - } - if in.ShapeMarginColor != nil { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"shapeMarginColor\":") - if in.ShapeMarginColor == nil { - out.RawString("null") - } else { - (*in.ShapeMarginColor).MarshalEasyJSON(out) - } - } - if in.SelectorList != "" { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"selectorList\":") - out.String(string(in.SelectorList)) - } - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v HighlightConfig) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom37(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v HighlightConfig) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom37(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *HighlightConfig) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom37(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *HighlightConfig) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom37(l, v) -} -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom38(in *jlexer.Lexer, out *HideHighlightParams) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom38(out *jwriter.Writer, in HideHighlightParams) { - out.RawByte('{') - first := true - _ = first - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v HideHighlightParams) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom38(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v HideHighlightParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom38(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *HideHighlightParams) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom38(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *HideHighlightParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom38(l, v) -} -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom39(in *jlexer.Lexer, out *GetSearchResultsReturns) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom32(in *jlexer.Lexer, out *GetSearchResultsReturns) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -3549,9 +2640,9 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom39(in *jlexer.Lexer, out *G out.NodeIds = (out.NodeIds)[:0] } for !in.IsDelim(']') { - var v25 cdp.NodeID - (v25).UnmarshalEasyJSON(in) - out.NodeIds = append(out.NodeIds, v25) + var v22 cdp.NodeID + (v22).UnmarshalEasyJSON(in) + out.NodeIds = append(out.NodeIds, v22) in.WantComma() } in.Delim(']') @@ -3566,7 +2657,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom39(in *jlexer.Lexer, out *G in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom39(out *jwriter.Writer, in GetSearchResultsReturns) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom32(out *jwriter.Writer, in GetSearchResultsReturns) { out.RawByte('{') first := true _ = first @@ -3580,11 +2671,11 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom39(out *jwriter.Writer, in out.RawString("null") } else { out.RawByte('[') - for v26, v27 := range in.NodeIds { - if v26 > 0 { + for v23, v24 := range in.NodeIds { + if v23 > 0 { out.RawByte(',') } - out.Int64(int64(v27)) + out.Int64(int64(v24)) } out.RawByte(']') } @@ -3595,27 +2686,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom39(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v GetSearchResultsReturns) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom39(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom32(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v GetSearchResultsReturns) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom39(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom32(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *GetSearchResultsReturns) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom39(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom32(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *GetSearchResultsReturns) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom39(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom32(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom40(in *jlexer.Lexer, out *GetSearchResultsParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom33(in *jlexer.Lexer, out *GetSearchResultsParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -3650,7 +2741,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom40(in *jlexer.Lexer, out *G in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom40(out *jwriter.Writer, in GetSearchResultsParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom33(out *jwriter.Writer, in GetSearchResultsParams) { out.RawByte('{') first := true _ = first @@ -3678,27 +2769,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom40(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v GetSearchResultsParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom40(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom33(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v GetSearchResultsParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom40(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom33(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *GetSearchResultsParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom40(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom33(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *GetSearchResultsParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom40(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom33(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom41(in *jlexer.Lexer, out *GetRelayoutBoundaryReturns) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom34(in *jlexer.Lexer, out *GetRelayoutBoundaryReturns) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -3729,7 +2820,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom41(in *jlexer.Lexer, out *G in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom41(out *jwriter.Writer, in GetRelayoutBoundaryReturns) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom34(out *jwriter.Writer, in GetRelayoutBoundaryReturns) { out.RawByte('{') first := true _ = first @@ -3747,27 +2838,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom41(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v GetRelayoutBoundaryReturns) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom41(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom34(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v GetRelayoutBoundaryReturns) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom41(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom34(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *GetRelayoutBoundaryReturns) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom41(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom34(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *GetRelayoutBoundaryReturns) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom41(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom34(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom42(in *jlexer.Lexer, out *GetRelayoutBoundaryParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom35(in *jlexer.Lexer, out *GetRelayoutBoundaryParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -3798,7 +2889,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom42(in *jlexer.Lexer, out *G in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom42(out *jwriter.Writer, in GetRelayoutBoundaryParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom35(out *jwriter.Writer, in GetRelayoutBoundaryParams) { out.RawByte('{') first := true _ = first @@ -3814,27 +2905,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom42(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v GetRelayoutBoundaryParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom42(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom35(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v GetRelayoutBoundaryParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom42(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom35(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *GetRelayoutBoundaryParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom42(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom35(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *GetRelayoutBoundaryParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom42(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom35(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom43(in *jlexer.Lexer, out *GetOuterHTMLReturns) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom36(in *jlexer.Lexer, out *GetOuterHTMLReturns) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -3865,7 +2956,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom43(in *jlexer.Lexer, out *G in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom43(out *jwriter.Writer, in GetOuterHTMLReturns) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom36(out *jwriter.Writer, in GetOuterHTMLReturns) { out.RawByte('{') first := true _ = first @@ -3883,27 +2974,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom43(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v GetOuterHTMLReturns) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom43(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom36(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v GetOuterHTMLReturns) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom43(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom36(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *GetOuterHTMLReturns) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom43(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom36(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *GetOuterHTMLReturns) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom43(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom36(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom44(in *jlexer.Lexer, out *GetOuterHTMLParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom37(in *jlexer.Lexer, out *GetOuterHTMLParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -3934,7 +3025,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom44(in *jlexer.Lexer, out *G in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom44(out *jwriter.Writer, in GetOuterHTMLParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom37(out *jwriter.Writer, in GetOuterHTMLParams) { out.RawByte('{') first := true _ = first @@ -3950,27 +3041,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom44(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v GetOuterHTMLParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom44(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom37(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v GetOuterHTMLParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom44(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom37(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *GetOuterHTMLParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom44(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom37(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *GetOuterHTMLParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom44(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom37(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom45(in *jlexer.Lexer, out *GetNodeForLocationReturns) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom38(in *jlexer.Lexer, out *GetNodeForLocationReturns) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -4001,7 +3092,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom45(in *jlexer.Lexer, out *G in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom45(out *jwriter.Writer, in GetNodeForLocationReturns) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom38(out *jwriter.Writer, in GetNodeForLocationReturns) { out.RawByte('{') first := true _ = first @@ -4019,27 +3110,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom45(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v GetNodeForLocationReturns) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom45(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom38(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v GetNodeForLocationReturns) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom45(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom38(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *GetNodeForLocationReturns) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom45(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom38(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *GetNodeForLocationReturns) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom45(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom38(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom46(in *jlexer.Lexer, out *GetNodeForLocationParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom39(in *jlexer.Lexer, out *GetNodeForLocationParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -4074,7 +3165,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom46(in *jlexer.Lexer, out *G in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom46(out *jwriter.Writer, in GetNodeForLocationParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom39(out *jwriter.Writer, in GetNodeForLocationParams) { out.RawByte('{') first := true _ = first @@ -4104,163 +3195,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom46(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v GetNodeForLocationParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom46(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom39(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v GetNodeForLocationParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom46(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom39(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *GetNodeForLocationParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom46(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom39(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *GetNodeForLocationParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom46(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom39(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom47(in *jlexer.Lexer, out *GetHighlightObjectForTestReturns) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "highlight": - (out.Highlight).UnmarshalEasyJSON(in) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom47(out *jwriter.Writer, in GetHighlightObjectForTestReturns) { - out.RawByte('{') - first := true - _ = first - if (in.Highlight).IsDefined() { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"highlight\":") - (in.Highlight).MarshalEasyJSON(out) - } - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v GetHighlightObjectForTestReturns) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom47(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v GetHighlightObjectForTestReturns) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom47(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *GetHighlightObjectForTestReturns) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom47(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *GetHighlightObjectForTestReturns) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom47(l, v) -} -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom48(in *jlexer.Lexer, out *GetHighlightObjectForTestParams) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "nodeId": - (out.NodeID).UnmarshalEasyJSON(in) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom48(out *jwriter.Writer, in GetHighlightObjectForTestParams) { - out.RawByte('{') - first := true - _ = first - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"nodeId\":") - out.Int64(int64(in.NodeID)) - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v GetHighlightObjectForTestParams) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom48(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v GetHighlightObjectForTestParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom48(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *GetHighlightObjectForTestParams) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom48(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *GetHighlightObjectForTestParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom48(l, v) -} -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom49(in *jlexer.Lexer, out *GetFlattenedDocumentReturns) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom40(in *jlexer.Lexer, out *GetFlattenedDocumentReturns) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -4295,17 +3250,17 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom49(in *jlexer.Lexer, out *G out.Nodes = (out.Nodes)[:0] } for !in.IsDelim(']') { - var v28 *cdp.Node + var v25 *cdp.Node if in.IsNull() { in.Skip() - v28 = nil + v25 = nil } else { - if v28 == nil { - v28 = new(cdp.Node) + if v25 == nil { + v25 = new(cdp.Node) } - (*v28).UnmarshalEasyJSON(in) + (*v25).UnmarshalEasyJSON(in) } - out.Nodes = append(out.Nodes, v28) + out.Nodes = append(out.Nodes, v25) in.WantComma() } in.Delim(']') @@ -4320,7 +3275,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom49(in *jlexer.Lexer, out *G in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom49(out *jwriter.Writer, in GetFlattenedDocumentReturns) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom40(out *jwriter.Writer, in GetFlattenedDocumentReturns) { out.RawByte('{') first := true _ = first @@ -4334,14 +3289,14 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom49(out *jwriter.Writer, in out.RawString("null") } else { out.RawByte('[') - for v29, v30 := range in.Nodes { - if v29 > 0 { + for v26, v27 := range in.Nodes { + if v26 > 0 { out.RawByte(',') } - if v30 == nil { + if v27 == nil { out.RawString("null") } else { - (*v30).MarshalEasyJSON(out) + (*v27).MarshalEasyJSON(out) } } out.RawByte(']') @@ -4353,27 +3308,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom49(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v GetFlattenedDocumentReturns) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom49(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom40(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v GetFlattenedDocumentReturns) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom49(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom40(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *GetFlattenedDocumentReturns) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom49(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom40(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *GetFlattenedDocumentReturns) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom49(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom40(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom50(in *jlexer.Lexer, out *GetFlattenedDocumentParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom41(in *jlexer.Lexer, out *GetFlattenedDocumentParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -4406,7 +3361,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom50(in *jlexer.Lexer, out *G in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom50(out *jwriter.Writer, in GetFlattenedDocumentParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom41(out *jwriter.Writer, in GetFlattenedDocumentParams) { out.RawByte('{') first := true _ = first @@ -4432,27 +3387,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom50(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v GetFlattenedDocumentParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom50(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom41(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v GetFlattenedDocumentParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom50(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom41(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *GetFlattenedDocumentParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom50(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom41(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *GetFlattenedDocumentParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom50(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom41(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom51(in *jlexer.Lexer, out *GetDocumentReturns) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom42(in *jlexer.Lexer, out *GetDocumentReturns) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -4491,7 +3446,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom51(in *jlexer.Lexer, out *G in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom51(out *jwriter.Writer, in GetDocumentReturns) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom42(out *jwriter.Writer, in GetDocumentReturns) { out.RawByte('{') first := true _ = first @@ -4513,27 +3468,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom51(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v GetDocumentReturns) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom51(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom42(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v GetDocumentReturns) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom51(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom42(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *GetDocumentReturns) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom51(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom42(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *GetDocumentReturns) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom51(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom42(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom52(in *jlexer.Lexer, out *GetDocumentParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom43(in *jlexer.Lexer, out *GetDocumentParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -4566,7 +3521,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom52(in *jlexer.Lexer, out *G in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom52(out *jwriter.Writer, in GetDocumentParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom43(out *jwriter.Writer, in GetDocumentParams) { out.RawByte('{') first := true _ = first @@ -4592,27 +3547,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom52(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v GetDocumentParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom52(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom43(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v GetDocumentParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom52(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom43(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *GetDocumentParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom52(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom43(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *GetDocumentParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom52(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom43(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom53(in *jlexer.Lexer, out *GetBoxModelReturns) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom44(in *jlexer.Lexer, out *GetBoxModelReturns) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -4651,7 +3606,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom53(in *jlexer.Lexer, out *G in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom53(out *jwriter.Writer, in GetBoxModelReturns) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom44(out *jwriter.Writer, in GetBoxModelReturns) { out.RawByte('{') first := true _ = first @@ -4673,27 +3628,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom53(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v GetBoxModelReturns) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom53(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom44(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v GetBoxModelReturns) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom53(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom44(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *GetBoxModelReturns) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom53(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom44(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *GetBoxModelReturns) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom53(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom44(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom54(in *jlexer.Lexer, out *GetBoxModelParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom45(in *jlexer.Lexer, out *GetBoxModelParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -4724,7 +3679,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom54(in *jlexer.Lexer, out *G in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom54(out *jwriter.Writer, in GetBoxModelParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom45(out *jwriter.Writer, in GetBoxModelParams) { out.RawByte('{') first := true _ = first @@ -4740,27 +3695,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom54(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v GetBoxModelParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom54(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom45(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v GetBoxModelParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom54(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom45(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *GetBoxModelParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom54(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom45(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *GetBoxModelParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom54(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom45(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom55(in *jlexer.Lexer, out *GetAttributesReturns) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom46(in *jlexer.Lexer, out *GetAttributesReturns) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -4795,9 +3750,9 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom55(in *jlexer.Lexer, out *G out.Attributes = (out.Attributes)[:0] } for !in.IsDelim(']') { - var v31 string - v31 = string(in.String()) - out.Attributes = append(out.Attributes, v31) + var v28 string + v28 = string(in.String()) + out.Attributes = append(out.Attributes, v28) in.WantComma() } in.Delim(']') @@ -4812,7 +3767,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom55(in *jlexer.Lexer, out *G in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom55(out *jwriter.Writer, in GetAttributesReturns) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom46(out *jwriter.Writer, in GetAttributesReturns) { out.RawByte('{') first := true _ = first @@ -4826,11 +3781,11 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom55(out *jwriter.Writer, in out.RawString("null") } else { out.RawByte('[') - for v32, v33 := range in.Attributes { - if v32 > 0 { + for v29, v30 := range in.Attributes { + if v29 > 0 { out.RawByte(',') } - out.String(string(v33)) + out.String(string(v30)) } out.RawByte(']') } @@ -4841,27 +3796,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom55(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v GetAttributesReturns) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom55(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom46(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v GetAttributesReturns) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom55(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom46(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *GetAttributesReturns) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom55(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom46(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *GetAttributesReturns) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom55(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom46(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom56(in *jlexer.Lexer, out *GetAttributesParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom47(in *jlexer.Lexer, out *GetAttributesParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -4892,7 +3847,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom56(in *jlexer.Lexer, out *G in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom56(out *jwriter.Writer, in GetAttributesParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom47(out *jwriter.Writer, in GetAttributesParams) { out.RawByte('{') first := true _ = first @@ -4908,27 +3863,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom56(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v GetAttributesParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom56(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom47(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v GetAttributesParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom56(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom47(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *GetAttributesParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom56(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom47(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *GetAttributesParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom56(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom47(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom57(in *jlexer.Lexer, out *FocusParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom48(in *jlexer.Lexer, out *FocusParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -4959,7 +3914,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom57(in *jlexer.Lexer, out *F in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom57(out *jwriter.Writer, in FocusParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom48(out *jwriter.Writer, in FocusParams) { out.RawByte('{') first := true _ = first @@ -4975,27 +3930,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom57(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v FocusParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom57(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom48(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v FocusParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom57(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom48(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *FocusParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom57(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom48(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *FocusParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom57(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom48(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom58(in *jlexer.Lexer, out *EventShadowRootPushed) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom49(in *jlexer.Lexer, out *EventShadowRootPushed) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -5036,7 +3991,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom58(in *jlexer.Lexer, out *E in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom58(out *jwriter.Writer, in EventShadowRootPushed) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom49(out *jwriter.Writer, in EventShadowRootPushed) { out.RawByte('{') first := true _ = first @@ -5066,27 +4021,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom58(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v EventShadowRootPushed) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom58(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom49(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v EventShadowRootPushed) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom58(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom49(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *EventShadowRootPushed) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom58(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom49(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *EventShadowRootPushed) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom58(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom49(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom59(in *jlexer.Lexer, out *EventShadowRootPopped) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom50(in *jlexer.Lexer, out *EventShadowRootPopped) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -5119,7 +4074,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom59(in *jlexer.Lexer, out *E in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom59(out *jwriter.Writer, in EventShadowRootPopped) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom50(out *jwriter.Writer, in EventShadowRootPopped) { out.RawByte('{') first := true _ = first @@ -5145,27 +4100,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom59(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v EventShadowRootPopped) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom59(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom50(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v EventShadowRootPopped) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom59(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom50(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *EventShadowRootPopped) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom59(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom50(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *EventShadowRootPopped) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom59(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom50(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom60(in *jlexer.Lexer, out *EventSetChildNodes) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom51(in *jlexer.Lexer, out *EventSetChildNodes) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -5202,17 +4157,17 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom60(in *jlexer.Lexer, out *E out.Nodes = (out.Nodes)[:0] } for !in.IsDelim(']') { - var v34 *cdp.Node + var v31 *cdp.Node if in.IsNull() { in.Skip() - v34 = nil + v31 = nil } else { - if v34 == nil { - v34 = new(cdp.Node) + if v31 == nil { + v31 = new(cdp.Node) } - (*v34).UnmarshalEasyJSON(in) + (*v31).UnmarshalEasyJSON(in) } - out.Nodes = append(out.Nodes, v34) + out.Nodes = append(out.Nodes, v31) in.WantComma() } in.Delim(']') @@ -5227,7 +4182,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom60(in *jlexer.Lexer, out *E in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom60(out *jwriter.Writer, in EventSetChildNodes) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom51(out *jwriter.Writer, in EventSetChildNodes) { out.RawByte('{') first := true _ = first @@ -5249,14 +4204,14 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom60(out *jwriter.Writer, in out.RawString("null") } else { out.RawByte('[') - for v35, v36 := range in.Nodes { - if v35 > 0 { + for v32, v33 := range in.Nodes { + if v32 > 0 { out.RawByte(',') } - if v36 == nil { + if v33 == nil { out.RawString("null") } else { - (*v36).MarshalEasyJSON(out) + (*v33).MarshalEasyJSON(out) } } out.RawByte(']') @@ -5268,27 +4223,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom60(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v EventSetChildNodes) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom60(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom51(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v EventSetChildNodes) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom60(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom51(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *EventSetChildNodes) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom60(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom51(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *EventSetChildNodes) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom60(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom51(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom61(in *jlexer.Lexer, out *EventPseudoElementRemoved) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom52(in *jlexer.Lexer, out *EventPseudoElementRemoved) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -5321,7 +4276,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom61(in *jlexer.Lexer, out *E in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom61(out *jwriter.Writer, in EventPseudoElementRemoved) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom52(out *jwriter.Writer, in EventPseudoElementRemoved) { out.RawByte('{') first := true _ = first @@ -5347,27 +4302,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom61(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v EventPseudoElementRemoved) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom61(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom52(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v EventPseudoElementRemoved) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom61(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom52(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *EventPseudoElementRemoved) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom61(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom52(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *EventPseudoElementRemoved) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom61(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom52(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom62(in *jlexer.Lexer, out *EventPseudoElementAdded) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom53(in *jlexer.Lexer, out *EventPseudoElementAdded) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -5408,7 +4363,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom62(in *jlexer.Lexer, out *E in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom62(out *jwriter.Writer, in EventPseudoElementAdded) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom53(out *jwriter.Writer, in EventPseudoElementAdded) { out.RawByte('{') first := true _ = first @@ -5438,165 +4393,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom62(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v EventPseudoElementAdded) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom62(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom53(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v EventPseudoElementAdded) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom62(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom53(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *EventPseudoElementAdded) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom62(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom53(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *EventPseudoElementAdded) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom62(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom53(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom63(in *jlexer.Lexer, out *EventNodeHighlightRequested) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "nodeId": - (out.NodeID).UnmarshalEasyJSON(in) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom63(out *jwriter.Writer, in EventNodeHighlightRequested) { - out.RawByte('{') - first := true - _ = first - if in.NodeID != 0 { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"nodeId\":") - out.Int64(int64(in.NodeID)) - } - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v EventNodeHighlightRequested) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom63(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v EventNodeHighlightRequested) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom63(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *EventNodeHighlightRequested) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom63(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *EventNodeHighlightRequested) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom63(l, v) -} -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom64(in *jlexer.Lexer, out *EventInspectNodeRequested) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "backendNodeId": - (out.BackendNodeID).UnmarshalEasyJSON(in) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom64(out *jwriter.Writer, in EventInspectNodeRequested) { - out.RawByte('{') - first := true - _ = first - if in.BackendNodeID != 0 { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"backendNodeId\":") - out.Int64(int64(in.BackendNodeID)) - } - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v EventInspectNodeRequested) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom64(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v EventInspectNodeRequested) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom64(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *EventInspectNodeRequested) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom64(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *EventInspectNodeRequested) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom64(l, v) -} -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom65(in *jlexer.Lexer, out *EventInlineStyleInvalidated) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom54(in *jlexer.Lexer, out *EventInlineStyleInvalidated) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -5631,9 +4448,9 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom65(in *jlexer.Lexer, out *E out.NodeIds = (out.NodeIds)[:0] } for !in.IsDelim(']') { - var v37 cdp.NodeID - (v37).UnmarshalEasyJSON(in) - out.NodeIds = append(out.NodeIds, v37) + var v34 cdp.NodeID + (v34).UnmarshalEasyJSON(in) + out.NodeIds = append(out.NodeIds, v34) in.WantComma() } in.Delim(']') @@ -5648,7 +4465,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom65(in *jlexer.Lexer, out *E in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom65(out *jwriter.Writer, in EventInlineStyleInvalidated) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom54(out *jwriter.Writer, in EventInlineStyleInvalidated) { out.RawByte('{') first := true _ = first @@ -5662,11 +4479,11 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom65(out *jwriter.Writer, in out.RawString("null") } else { out.RawByte('[') - for v38, v39 := range in.NodeIds { - if v38 > 0 { + for v35, v36 := range in.NodeIds { + if v35 > 0 { out.RawByte(',') } - out.Int64(int64(v39)) + out.Int64(int64(v36)) } out.RawByte(']') } @@ -5677,27 +4494,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom65(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v EventInlineStyleInvalidated) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom65(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom54(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v EventInlineStyleInvalidated) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom65(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom54(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *EventInlineStyleInvalidated) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom65(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom54(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *EventInlineStyleInvalidated) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom65(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom54(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom66(in *jlexer.Lexer, out *EventDocumentUpdated) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom55(in *jlexer.Lexer, out *EventDocumentUpdated) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -5726,7 +4543,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom66(in *jlexer.Lexer, out *E in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom66(out *jwriter.Writer, in EventDocumentUpdated) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom55(out *jwriter.Writer, in EventDocumentUpdated) { out.RawByte('{') first := true _ = first @@ -5736,27 +4553,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom66(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v EventDocumentUpdated) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom66(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom55(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v EventDocumentUpdated) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom66(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom55(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *EventDocumentUpdated) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom66(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom55(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *EventDocumentUpdated) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom66(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom55(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom67(in *jlexer.Lexer, out *EventDistributedNodesUpdated) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom56(in *jlexer.Lexer, out *EventDistributedNodesUpdated) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -5793,17 +4610,17 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom67(in *jlexer.Lexer, out *E out.DistributedNodes = (out.DistributedNodes)[:0] } for !in.IsDelim(']') { - var v40 *cdp.BackendNode + var v37 *cdp.BackendNode if in.IsNull() { in.Skip() - v40 = nil + v37 = nil } else { - if v40 == nil { - v40 = new(cdp.BackendNode) + if v37 == nil { + v37 = new(cdp.BackendNode) } - (*v40).UnmarshalEasyJSON(in) + (*v37).UnmarshalEasyJSON(in) } - out.DistributedNodes = append(out.DistributedNodes, v40) + out.DistributedNodes = append(out.DistributedNodes, v37) in.WantComma() } in.Delim(']') @@ -5818,7 +4635,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom67(in *jlexer.Lexer, out *E in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom67(out *jwriter.Writer, in EventDistributedNodesUpdated) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom56(out *jwriter.Writer, in EventDistributedNodesUpdated) { out.RawByte('{') first := true _ = first @@ -5840,14 +4657,14 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom67(out *jwriter.Writer, in out.RawString("null") } else { out.RawByte('[') - for v41, v42 := range in.DistributedNodes { - if v41 > 0 { + for v38, v39 := range in.DistributedNodes { + if v38 > 0 { out.RawByte(',') } - if v42 == nil { + if v39 == nil { out.RawString("null") } else { - (*v42).MarshalEasyJSON(out) + (*v39).MarshalEasyJSON(out) } } out.RawByte(']') @@ -5859,27 +4676,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom67(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v EventDistributedNodesUpdated) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom67(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom56(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v EventDistributedNodesUpdated) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom67(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom56(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *EventDistributedNodesUpdated) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom67(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom56(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *EventDistributedNodesUpdated) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom67(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom56(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom68(in *jlexer.Lexer, out *EventChildNodeRemoved) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom57(in *jlexer.Lexer, out *EventChildNodeRemoved) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -5912,7 +4729,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom68(in *jlexer.Lexer, out *E in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom68(out *jwriter.Writer, in EventChildNodeRemoved) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom57(out *jwriter.Writer, in EventChildNodeRemoved) { out.RawByte('{') first := true _ = first @@ -5938,27 +4755,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom68(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v EventChildNodeRemoved) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom68(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom57(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v EventChildNodeRemoved) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom68(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom57(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *EventChildNodeRemoved) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom68(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom57(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *EventChildNodeRemoved) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom68(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom57(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom69(in *jlexer.Lexer, out *EventChildNodeInserted) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom58(in *jlexer.Lexer, out *EventChildNodeInserted) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -6001,7 +4818,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom69(in *jlexer.Lexer, out *E in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom69(out *jwriter.Writer, in EventChildNodeInserted) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom58(out *jwriter.Writer, in EventChildNodeInserted) { out.RawByte('{') first := true _ = first @@ -6039,27 +4856,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom69(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v EventChildNodeInserted) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom69(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom58(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v EventChildNodeInserted) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom69(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom58(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *EventChildNodeInserted) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom69(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom58(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *EventChildNodeInserted) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom69(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom58(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom70(in *jlexer.Lexer, out *EventChildNodeCountUpdated) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom59(in *jlexer.Lexer, out *EventChildNodeCountUpdated) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -6092,7 +4909,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom70(in *jlexer.Lexer, out *E in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom70(out *jwriter.Writer, in EventChildNodeCountUpdated) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom59(out *jwriter.Writer, in EventChildNodeCountUpdated) { out.RawByte('{') first := true _ = first @@ -6118,27 +4935,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom70(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v EventChildNodeCountUpdated) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom70(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom59(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v EventChildNodeCountUpdated) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom70(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom59(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *EventChildNodeCountUpdated) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom70(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom59(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *EventChildNodeCountUpdated) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom70(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom59(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom71(in *jlexer.Lexer, out *EventCharacterDataModified) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom60(in *jlexer.Lexer, out *EventCharacterDataModified) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -6171,7 +4988,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom71(in *jlexer.Lexer, out *E in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom71(out *jwriter.Writer, in EventCharacterDataModified) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom60(out *jwriter.Writer, in EventCharacterDataModified) { out.RawByte('{') first := true _ = first @@ -6197,27 +5014,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom71(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v EventCharacterDataModified) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom71(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom60(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v EventCharacterDataModified) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom71(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom60(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *EventCharacterDataModified) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom71(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom60(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *EventCharacterDataModified) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom71(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom60(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom72(in *jlexer.Lexer, out *EventAttributeRemoved) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom61(in *jlexer.Lexer, out *EventAttributeRemoved) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -6250,7 +5067,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom72(in *jlexer.Lexer, out *E in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom72(out *jwriter.Writer, in EventAttributeRemoved) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom61(out *jwriter.Writer, in EventAttributeRemoved) { out.RawByte('{') first := true _ = first @@ -6276,27 +5093,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom72(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v EventAttributeRemoved) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom72(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom61(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v EventAttributeRemoved) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom72(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom61(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *EventAttributeRemoved) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom72(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom61(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *EventAttributeRemoved) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom72(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom61(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom73(in *jlexer.Lexer, out *EventAttributeModified) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom62(in *jlexer.Lexer, out *EventAttributeModified) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -6331,7 +5148,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom73(in *jlexer.Lexer, out *E in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom73(out *jwriter.Writer, in EventAttributeModified) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom62(out *jwriter.Writer, in EventAttributeModified) { out.RawByte('{') first := true _ = first @@ -6365,27 +5182,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom73(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v EventAttributeModified) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom73(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom62(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v EventAttributeModified) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom73(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom62(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *EventAttributeModified) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom73(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom62(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *EventAttributeModified) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom73(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom62(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom74(in *jlexer.Lexer, out *EnableParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom63(in *jlexer.Lexer, out *EnableParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -6414,7 +5231,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom74(in *jlexer.Lexer, out *E in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom74(out *jwriter.Writer, in EnableParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom63(out *jwriter.Writer, in EnableParams) { out.RawByte('{') first := true _ = first @@ -6424,27 +5241,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom74(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v EnableParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom74(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom63(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v EnableParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom74(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom63(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *EnableParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom74(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom63(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *EnableParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom74(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom63(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom75(in *jlexer.Lexer, out *DiscardSearchResultsParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom64(in *jlexer.Lexer, out *DiscardSearchResultsParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -6475,7 +5292,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom75(in *jlexer.Lexer, out *D in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom75(out *jwriter.Writer, in DiscardSearchResultsParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom64(out *jwriter.Writer, in DiscardSearchResultsParams) { out.RawByte('{') first := true _ = first @@ -6491,27 +5308,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom75(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v DiscardSearchResultsParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom75(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom64(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v DiscardSearchResultsParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom75(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom64(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *DiscardSearchResultsParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom75(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom64(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *DiscardSearchResultsParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom75(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom64(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom76(in *jlexer.Lexer, out *DisableParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom65(in *jlexer.Lexer, out *DisableParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -6540,7 +5357,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom76(in *jlexer.Lexer, out *D in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom76(out *jwriter.Writer, in DisableParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom65(out *jwriter.Writer, in DisableParams) { out.RawByte('{') first := true _ = first @@ -6550,27 +5367,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom76(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v DisableParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom76(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom65(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v DisableParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom76(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom65(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *DisableParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom76(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom65(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *DisableParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom76(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom65(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom77(in *jlexer.Lexer, out *CopyToReturns) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom66(in *jlexer.Lexer, out *CopyToReturns) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -6601,7 +5418,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom77(in *jlexer.Lexer, out *C in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom77(out *jwriter.Writer, in CopyToReturns) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom66(out *jwriter.Writer, in CopyToReturns) { out.RawByte('{') first := true _ = first @@ -6619,27 +5436,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom77(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v CopyToReturns) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom77(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom66(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v CopyToReturns) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom77(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom66(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *CopyToReturns) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom77(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom66(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *CopyToReturns) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom77(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom66(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom78(in *jlexer.Lexer, out *CopyToParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom67(in *jlexer.Lexer, out *CopyToParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -6674,7 +5491,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom78(in *jlexer.Lexer, out *C in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom78(out *jwriter.Writer, in CopyToParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom67(out *jwriter.Writer, in CopyToParams) { out.RawByte('{') first := true _ = first @@ -6704,27 +5521,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom78(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v CopyToParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom78(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom67(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v CopyToParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom78(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom67(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *CopyToParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom78(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom67(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *CopyToParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom78(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom67(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom79(in *jlexer.Lexer, out *CollectClassNamesFromSubtreeReturns) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom68(in *jlexer.Lexer, out *CollectClassNamesFromSubtreeReturns) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -6759,9 +5576,9 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom79(in *jlexer.Lexer, out *C out.ClassNames = (out.ClassNames)[:0] } for !in.IsDelim(']') { - var v43 string - v43 = string(in.String()) - out.ClassNames = append(out.ClassNames, v43) + var v40 string + v40 = string(in.String()) + out.ClassNames = append(out.ClassNames, v40) in.WantComma() } in.Delim(']') @@ -6776,7 +5593,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom79(in *jlexer.Lexer, out *C in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom79(out *jwriter.Writer, in CollectClassNamesFromSubtreeReturns) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom68(out *jwriter.Writer, in CollectClassNamesFromSubtreeReturns) { out.RawByte('{') first := true _ = first @@ -6790,11 +5607,11 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom79(out *jwriter.Writer, in out.RawString("null") } else { out.RawByte('[') - for v44, v45 := range in.ClassNames { - if v44 > 0 { + for v41, v42 := range in.ClassNames { + if v41 > 0 { out.RawByte(',') } - out.String(string(v45)) + out.String(string(v42)) } out.RawByte(']') } @@ -6805,27 +5622,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom79(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v CollectClassNamesFromSubtreeReturns) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom79(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom68(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v CollectClassNamesFromSubtreeReturns) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom79(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom68(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *CollectClassNamesFromSubtreeReturns) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom79(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom68(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *CollectClassNamesFromSubtreeReturns) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom79(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom68(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom80(in *jlexer.Lexer, out *CollectClassNamesFromSubtreeParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom69(in *jlexer.Lexer, out *CollectClassNamesFromSubtreeParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -6856,7 +5673,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom80(in *jlexer.Lexer, out *C in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom80(out *jwriter.Writer, in CollectClassNamesFromSubtreeParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom69(out *jwriter.Writer, in CollectClassNamesFromSubtreeParams) { out.RawByte('{') first := true _ = first @@ -6872,27 +5689,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom80(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v CollectClassNamesFromSubtreeParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom80(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom69(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v CollectClassNamesFromSubtreeParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom80(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom69(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *CollectClassNamesFromSubtreeParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom80(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom69(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *CollectClassNamesFromSubtreeParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom80(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom69(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom81(in *jlexer.Lexer, out *BoxModel) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom70(in *jlexer.Lexer, out *BoxModel) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -6927,9 +5744,9 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom81(in *jlexer.Lexer, out *B out.Content = (out.Content)[:0] } for !in.IsDelim(']') { - var v46 float64 - v46 = float64(in.Float64()) - out.Content = append(out.Content, v46) + var v43 float64 + v43 = float64(in.Float64()) + out.Content = append(out.Content, v43) in.WantComma() } in.Delim(']') @@ -6950,9 +5767,9 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom81(in *jlexer.Lexer, out *B out.Padding = (out.Padding)[:0] } for !in.IsDelim(']') { - var v47 float64 - v47 = float64(in.Float64()) - out.Padding = append(out.Padding, v47) + var v44 float64 + v44 = float64(in.Float64()) + out.Padding = append(out.Padding, v44) in.WantComma() } in.Delim(']') @@ -6973,9 +5790,9 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom81(in *jlexer.Lexer, out *B out.Border = (out.Border)[:0] } for !in.IsDelim(']') { - var v48 float64 - v48 = float64(in.Float64()) - out.Border = append(out.Border, v48) + var v45 float64 + v45 = float64(in.Float64()) + out.Border = append(out.Border, v45) in.WantComma() } in.Delim(']') @@ -6996,9 +5813,9 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom81(in *jlexer.Lexer, out *B out.Margin = (out.Margin)[:0] } for !in.IsDelim(']') { - var v49 float64 - v49 = float64(in.Float64()) - out.Margin = append(out.Margin, v49) + var v46 float64 + v46 = float64(in.Float64()) + out.Margin = append(out.Margin, v46) in.WantComma() } in.Delim(']') @@ -7027,7 +5844,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom81(in *jlexer.Lexer, out *B in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom81(out *jwriter.Writer, in BoxModel) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom70(out *jwriter.Writer, in BoxModel) { out.RawByte('{') first := true _ = first @@ -7041,11 +5858,11 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom81(out *jwriter.Writer, in out.RawString("null") } else { out.RawByte('[') - for v50, v51 := range in.Content { - if v50 > 0 { + for v47, v48 := range in.Content { + if v47 > 0 { out.RawByte(',') } - out.Float64(float64(v51)) + out.Float64(float64(v48)) } out.RawByte(']') } @@ -7060,11 +5877,11 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom81(out *jwriter.Writer, in out.RawString("null") } else { out.RawByte('[') - for v52, v53 := range in.Padding { - if v52 > 0 { + for v49, v50 := range in.Padding { + if v49 > 0 { out.RawByte(',') } - out.Float64(float64(v53)) + out.Float64(float64(v50)) } out.RawByte(']') } @@ -7079,11 +5896,11 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom81(out *jwriter.Writer, in out.RawString("null") } else { out.RawByte('[') - for v54, v55 := range in.Border { - if v54 > 0 { + for v51, v52 := range in.Border { + if v51 > 0 { out.RawByte(',') } - out.Float64(float64(v55)) + out.Float64(float64(v52)) } out.RawByte(']') } @@ -7098,11 +5915,11 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom81(out *jwriter.Writer, in out.RawString("null") } else { out.RawByte('[') - for v56, v57 := range in.Margin { - if v56 > 0 { + for v53, v54 := range in.Margin { + if v53 > 0 { out.RawByte(',') } - out.Float64(float64(v57)) + out.Float64(float64(v54)) } out.RawByte(']') } @@ -7141,23 +5958,23 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom81(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v BoxModel) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom81(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom70(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v BoxModel) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom81(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpDom70(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *BoxModel) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom81(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom70(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *BoxModel) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom81(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpDom70(l, v) } diff --git a/cdp/dom/events.go b/cdp/dom/events.go index ca886ba..67b2056 100644 --- a/cdp/dom/events.go +++ b/cdp/dom/events.go @@ -10,12 +10,6 @@ import ( // ids are no longer valid. type EventDocumentUpdated struct{} -// EventInspectNodeRequested fired when the node should be inspected. This -// happens after call to setInspectMode. -type EventInspectNodeRequested struct { - BackendNodeID cdp.BackendNodeID `json:"backendNodeId,omitempty"` // Id of the node to inspect. -} - // EventSetChildNodes fired when backend wants to provide client with the // missing DOM structure. This happens upon most of the calls requesting node // ids. @@ -101,15 +95,9 @@ type EventDistributedNodesUpdated struct { DistributedNodes []*cdp.BackendNode `json:"distributedNodes,omitempty"` // Distributed nodes for given insertion point. } -// EventNodeHighlightRequested [no description]. -type EventNodeHighlightRequested struct { - NodeID cdp.NodeID `json:"nodeId,omitempty"` -} - // EventTypes all event types in the domain. var EventTypes = []cdp.MethodType{ cdp.EventDOMDocumentUpdated, - cdp.EventDOMInspectNodeRequested, cdp.EventDOMSetChildNodes, cdp.EventDOMAttributeModified, cdp.EventDOMAttributeRemoved, @@ -123,5 +111,4 @@ var EventTypes = []cdp.MethodType{ cdp.EventDOMPseudoElementAdded, cdp.EventDOMPseudoElementRemoved, cdp.EventDOMDistributedNodesUpdated, - cdp.EventDOMNodeHighlightRequested, } diff --git a/cdp/dom/types.go b/cdp/dom/types.go index d71866a..c694c06 100644 --- a/cdp/dom/types.go +++ b/cdp/dom/types.go @@ -1,16 +1,9 @@ package dom +import "github.com/mailru/easyjson" + // AUTOGENERATED. DO NOT EDIT. -import ( - "errors" - - cdp "github.com/knq/chromedp/cdp" - "github.com/mailru/easyjson" - "github.com/mailru/easyjson/jlexer" - "github.com/mailru/easyjson/jwriter" -) - // Quad an array of quad vertices, x immediately followed by y for each // point, points clock-wise. type Quad []float64 @@ -40,64 +33,3 @@ type Rect struct { Width float64 `json:"width,omitempty"` // Rectangle width Height float64 `json:"height,omitempty"` // Rectangle height } - -// HighlightConfig configuration data for the highlighting of page elements. -type HighlightConfig struct { - ShowInfo bool `json:"showInfo,omitempty"` // Whether the node info tooltip should be shown (default: false). - ShowRulers bool `json:"showRulers,omitempty"` // Whether the rulers should be shown (default: false). - ShowExtensionLines bool `json:"showExtensionLines,omitempty"` // Whether the extension lines from node to the rulers should be shown (default: false). - DisplayAsMaterial bool `json:"displayAsMaterial,omitempty"` - ContentColor *cdp.RGBA `json:"contentColor,omitempty"` // The content box highlight fill color (default: transparent). - PaddingColor *cdp.RGBA `json:"paddingColor,omitempty"` // The padding highlight fill color (default: transparent). - BorderColor *cdp.RGBA `json:"borderColor,omitempty"` // The border highlight fill color (default: transparent). - MarginColor *cdp.RGBA `json:"marginColor,omitempty"` // The margin highlight fill color (default: transparent). - EventTargetColor *cdp.RGBA `json:"eventTargetColor,omitempty"` // The event target element highlight fill color (default: transparent). - ShapeColor *cdp.RGBA `json:"shapeColor,omitempty"` // The shape outside fill color (default: transparent). - ShapeMarginColor *cdp.RGBA `json:"shapeMarginColor,omitempty"` // The shape margin fill color (default: transparent). - SelectorList string `json:"selectorList,omitempty"` // Selectors to highlight relevant nodes. -} - -// InspectMode [no description]. -type InspectMode string - -// String returns the InspectMode as string value. -func (t InspectMode) String() string { - return string(t) -} - -// InspectMode values. -const ( - InspectModeSearchForNode InspectMode = "searchForNode" - InspectModeSearchForUAShadowDOM InspectMode = "searchForUAShadowDOM" - InspectModeNone InspectMode = "none" -) - -// MarshalEasyJSON satisfies easyjson.Marshaler. -func (t InspectMode) MarshalEasyJSON(out *jwriter.Writer) { - out.String(string(t)) -} - -// MarshalJSON satisfies json.Marshaler. -func (t InspectMode) MarshalJSON() ([]byte, error) { - return easyjson.Marshal(t) -} - -// UnmarshalEasyJSON satisfies easyjson.Unmarshaler. -func (t *InspectMode) UnmarshalEasyJSON(in *jlexer.Lexer) { - switch InspectMode(in.String()) { - case InspectModeSearchForNode: - *t = InspectModeSearchForNode - case InspectModeSearchForUAShadowDOM: - *t = InspectModeSearchForUAShadowDOM - case InspectModeNone: - *t = InspectModeNone - - default: - in.AddError(errors.New("unknown InspectMode value")) - } -} - -// UnmarshalJSON satisfies json.Unmarshaler. -func (t *InspectMode) UnmarshalJSON(buf []byte) error { - return easyjson.Unmarshal(buf, t) -} diff --git a/cdp/domdebugger/easyjson.go b/cdp/domdebugger/easyjson.go index 0f873ce..bd947de 100644 --- a/cdp/domdebugger/easyjson.go +++ b/cdp/domdebugger/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package domdebugger diff --git a/cdp/domstorage/easyjson.go b/cdp/domstorage/easyjson.go index bda7d41..cdd7ddf 100644 --- a/cdp/domstorage/easyjson.go +++ b/cdp/domstorage/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package domstorage diff --git a/cdp/easyjson.go b/cdp/easyjson.go index 3aeefec..2a245e9 100644 --- a/cdp/easyjson.go +++ b/cdp/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package cdp diff --git a/cdp/emulation/easyjson.go b/cdp/emulation/easyjson.go index 38ba90c..5a218d8 100644 --- a/cdp/emulation/easyjson.go +++ b/cdp/emulation/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package emulation diff --git a/cdp/heapprofiler/easyjson.go b/cdp/heapprofiler/easyjson.go index 2fd31d7..2ee1b39 100644 --- a/cdp/heapprofiler/easyjson.go +++ b/cdp/heapprofiler/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package heapprofiler diff --git a/cdp/indexeddb/easyjson.go b/cdp/indexeddb/easyjson.go index c67f4da..b4b124c 100644 --- a/cdp/indexeddb/easyjson.go +++ b/cdp/indexeddb/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package indexeddb diff --git a/cdp/input/easyjson.go b/cdp/input/easyjson.go index dcdaea2..2524dcd 100644 --- a/cdp/input/easyjson.go +++ b/cdp/input/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package input diff --git a/cdp/inspector/easyjson.go b/cdp/inspector/easyjson.go index 0a63a59..2644b7b 100644 --- a/cdp/inspector/easyjson.go +++ b/cdp/inspector/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package inspector diff --git a/cdp/io/easyjson.go b/cdp/io/easyjson.go index 4e60d71..0f3b820 100644 --- a/cdp/io/easyjson.go +++ b/cdp/io/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package io diff --git a/cdp/layertree/easyjson.go b/cdp/layertree/easyjson.go index bd09316..404ba21 100644 --- a/cdp/layertree/easyjson.go +++ b/cdp/layertree/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package layertree diff --git a/cdp/log/easyjson.go b/cdp/log/easyjson.go index 6eb6e64..0f1c2b1 100644 --- a/cdp/log/easyjson.go +++ b/cdp/log/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package log diff --git a/cdp/memory/easyjson.go b/cdp/memory/easyjson.go index 40a5d9b..a589211 100644 --- a/cdp/memory/easyjson.go +++ b/cdp/memory/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package memory diff --git a/cdp/network/easyjson.go b/cdp/network/easyjson.go index 411af82..5b58732 100644 --- a/cdp/network/easyjson.go +++ b/cdp/network/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package network diff --git a/cdp/overlay/easyjson.go b/cdp/overlay/easyjson.go new file mode 100644 index 0000000..d1d6786 --- /dev/null +++ b/cdp/overlay/easyjson.go @@ -0,0 +1,1794 @@ +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. + +package overlay + +import ( + json "encoding/json" + cdp "github.com/knq/chromedp/cdp" + dom "github.com/knq/chromedp/cdp/dom" + runtime "github.com/knq/chromedp/cdp/runtime" + easyjson "github.com/mailru/easyjson" + jlexer "github.com/mailru/easyjson/jlexer" + jwriter "github.com/mailru/easyjson/jwriter" +) + +// suppress unused package warning +var ( + _ *json.RawMessage + _ *jlexer.Lexer + _ *jwriter.Writer + _ easyjson.Marshaler +) + +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay(in *jlexer.Lexer, out *SetSuspendedParams) { + isTopLevel := in.IsStart() + if in.IsNull() { + if isTopLevel { + in.Consumed() + } + in.Skip() + return + } + in.Delim('{') + for !in.IsDelim('}') { + key := in.UnsafeString() + in.WantColon() + if in.IsNull() { + in.Skip() + in.WantComma() + continue + } + switch key { + case "suspended": + out.Suspended = bool(in.Bool()) + default: + in.SkipRecursive() + } + in.WantComma() + } + in.Delim('}') + if isTopLevel { + in.Consumed() + } +} +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay(out *jwriter.Writer, in SetSuspendedParams) { + out.RawByte('{') + first := true + _ = first + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"suspended\":") + out.Bool(bool(in.Suspended)) + out.RawByte('}') +} + +// MarshalJSON supports json.Marshaler interface +func (v SetSuspendedParams) MarshalJSON() ([]byte, error) { + w := jwriter.Writer{} + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay(&w, v) + return w.Buffer.BuildBytes(), w.Error +} + +// MarshalEasyJSON supports easyjson.Marshaler interface +func (v SetSuspendedParams) MarshalEasyJSON(w *jwriter.Writer) { + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay(w, v) +} + +// UnmarshalJSON supports json.Unmarshaler interface +func (v *SetSuspendedParams) UnmarshalJSON(data []byte) error { + r := jlexer.Lexer{Data: data} + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay(&r, v) + return r.Error() +} + +// UnmarshalEasyJSON supports easyjson.Unmarshaler interface +func (v *SetSuspendedParams) UnmarshalEasyJSON(l *jlexer.Lexer) { + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay(l, v) +} +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay1(in *jlexer.Lexer, out *SetShowViewportSizeOnResizeParams) { + isTopLevel := in.IsStart() + if in.IsNull() { + if isTopLevel { + in.Consumed() + } + in.Skip() + return + } + in.Delim('{') + for !in.IsDelim('}') { + key := in.UnsafeString() + in.WantColon() + if in.IsNull() { + in.Skip() + in.WantComma() + continue + } + switch key { + case "show": + out.Show = bool(in.Bool()) + default: + in.SkipRecursive() + } + in.WantComma() + } + in.Delim('}') + if isTopLevel { + in.Consumed() + } +} +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay1(out *jwriter.Writer, in SetShowViewportSizeOnResizeParams) { + out.RawByte('{') + first := true + _ = first + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"show\":") + out.Bool(bool(in.Show)) + out.RawByte('}') +} + +// MarshalJSON supports json.Marshaler interface +func (v SetShowViewportSizeOnResizeParams) MarshalJSON() ([]byte, error) { + w := jwriter.Writer{} + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay1(&w, v) + return w.Buffer.BuildBytes(), w.Error +} + +// MarshalEasyJSON supports easyjson.Marshaler interface +func (v SetShowViewportSizeOnResizeParams) MarshalEasyJSON(w *jwriter.Writer) { + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay1(w, v) +} + +// UnmarshalJSON supports json.Unmarshaler interface +func (v *SetShowViewportSizeOnResizeParams) UnmarshalJSON(data []byte) error { + r := jlexer.Lexer{Data: data} + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay1(&r, v) + return r.Error() +} + +// UnmarshalEasyJSON supports easyjson.Unmarshaler interface +func (v *SetShowViewportSizeOnResizeParams) UnmarshalEasyJSON(l *jlexer.Lexer) { + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay1(l, v) +} +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay2(in *jlexer.Lexer, out *SetShowScrollBottleneckRectsParams) { + isTopLevel := in.IsStart() + if in.IsNull() { + if isTopLevel { + in.Consumed() + } + in.Skip() + return + } + in.Delim('{') + for !in.IsDelim('}') { + key := in.UnsafeString() + in.WantColon() + if in.IsNull() { + in.Skip() + in.WantComma() + continue + } + switch key { + case "show": + out.Show = bool(in.Bool()) + default: + in.SkipRecursive() + } + in.WantComma() + } + in.Delim('}') + if isTopLevel { + in.Consumed() + } +} +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay2(out *jwriter.Writer, in SetShowScrollBottleneckRectsParams) { + out.RawByte('{') + first := true + _ = first + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"show\":") + out.Bool(bool(in.Show)) + out.RawByte('}') +} + +// MarshalJSON supports json.Marshaler interface +func (v SetShowScrollBottleneckRectsParams) MarshalJSON() ([]byte, error) { + w := jwriter.Writer{} + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay2(&w, v) + return w.Buffer.BuildBytes(), w.Error +} + +// MarshalEasyJSON supports easyjson.Marshaler interface +func (v SetShowScrollBottleneckRectsParams) MarshalEasyJSON(w *jwriter.Writer) { + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay2(w, v) +} + +// UnmarshalJSON supports json.Unmarshaler interface +func (v *SetShowScrollBottleneckRectsParams) UnmarshalJSON(data []byte) error { + r := jlexer.Lexer{Data: data} + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay2(&r, v) + return r.Error() +} + +// UnmarshalEasyJSON supports easyjson.Unmarshaler interface +func (v *SetShowScrollBottleneckRectsParams) UnmarshalEasyJSON(l *jlexer.Lexer) { + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay2(l, v) +} +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay3(in *jlexer.Lexer, out *SetShowPaintRectsParams) { + isTopLevel := in.IsStart() + if in.IsNull() { + if isTopLevel { + in.Consumed() + } + in.Skip() + return + } + in.Delim('{') + for !in.IsDelim('}') { + key := in.UnsafeString() + in.WantColon() + if in.IsNull() { + in.Skip() + in.WantComma() + continue + } + switch key { + case "result": + out.Result = bool(in.Bool()) + default: + in.SkipRecursive() + } + in.WantComma() + } + in.Delim('}') + if isTopLevel { + in.Consumed() + } +} +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay3(out *jwriter.Writer, in SetShowPaintRectsParams) { + out.RawByte('{') + first := true + _ = first + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"result\":") + out.Bool(bool(in.Result)) + out.RawByte('}') +} + +// MarshalJSON supports json.Marshaler interface +func (v SetShowPaintRectsParams) MarshalJSON() ([]byte, error) { + w := jwriter.Writer{} + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay3(&w, v) + return w.Buffer.BuildBytes(), w.Error +} + +// MarshalEasyJSON supports easyjson.Marshaler interface +func (v SetShowPaintRectsParams) MarshalEasyJSON(w *jwriter.Writer) { + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay3(w, v) +} + +// UnmarshalJSON supports json.Unmarshaler interface +func (v *SetShowPaintRectsParams) UnmarshalJSON(data []byte) error { + r := jlexer.Lexer{Data: data} + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay3(&r, v) + return r.Error() +} + +// UnmarshalEasyJSON supports easyjson.Unmarshaler interface +func (v *SetShowPaintRectsParams) UnmarshalEasyJSON(l *jlexer.Lexer) { + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay3(l, v) +} +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay4(in *jlexer.Lexer, out *SetShowFPSCounterParams) { + isTopLevel := in.IsStart() + if in.IsNull() { + if isTopLevel { + in.Consumed() + } + in.Skip() + return + } + in.Delim('{') + for !in.IsDelim('}') { + key := in.UnsafeString() + in.WantColon() + if in.IsNull() { + in.Skip() + in.WantComma() + continue + } + switch key { + case "show": + out.Show = bool(in.Bool()) + default: + in.SkipRecursive() + } + in.WantComma() + } + in.Delim('}') + if isTopLevel { + in.Consumed() + } +} +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay4(out *jwriter.Writer, in SetShowFPSCounterParams) { + out.RawByte('{') + first := true + _ = first + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"show\":") + out.Bool(bool(in.Show)) + out.RawByte('}') +} + +// MarshalJSON supports json.Marshaler interface +func (v SetShowFPSCounterParams) MarshalJSON() ([]byte, error) { + w := jwriter.Writer{} + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay4(&w, v) + return w.Buffer.BuildBytes(), w.Error +} + +// MarshalEasyJSON supports easyjson.Marshaler interface +func (v SetShowFPSCounterParams) MarshalEasyJSON(w *jwriter.Writer) { + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay4(w, v) +} + +// UnmarshalJSON supports json.Unmarshaler interface +func (v *SetShowFPSCounterParams) UnmarshalJSON(data []byte) error { + r := jlexer.Lexer{Data: data} + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay4(&r, v) + return r.Error() +} + +// UnmarshalEasyJSON supports easyjson.Unmarshaler interface +func (v *SetShowFPSCounterParams) UnmarshalEasyJSON(l *jlexer.Lexer) { + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay4(l, v) +} +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay5(in *jlexer.Lexer, out *SetShowDebugBordersParams) { + isTopLevel := in.IsStart() + if in.IsNull() { + if isTopLevel { + in.Consumed() + } + in.Skip() + return + } + in.Delim('{') + for !in.IsDelim('}') { + key := in.UnsafeString() + in.WantColon() + if in.IsNull() { + in.Skip() + in.WantComma() + continue + } + switch key { + case "show": + out.Show = bool(in.Bool()) + default: + in.SkipRecursive() + } + in.WantComma() + } + in.Delim('}') + if isTopLevel { + in.Consumed() + } +} +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay5(out *jwriter.Writer, in SetShowDebugBordersParams) { + out.RawByte('{') + first := true + _ = first + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"show\":") + out.Bool(bool(in.Show)) + out.RawByte('}') +} + +// MarshalJSON supports json.Marshaler interface +func (v SetShowDebugBordersParams) MarshalJSON() ([]byte, error) { + w := jwriter.Writer{} + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay5(&w, v) + return w.Buffer.BuildBytes(), w.Error +} + +// MarshalEasyJSON supports easyjson.Marshaler interface +func (v SetShowDebugBordersParams) MarshalEasyJSON(w *jwriter.Writer) { + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay5(w, v) +} + +// UnmarshalJSON supports json.Unmarshaler interface +func (v *SetShowDebugBordersParams) UnmarshalJSON(data []byte) error { + r := jlexer.Lexer{Data: data} + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay5(&r, v) + return r.Error() +} + +// UnmarshalEasyJSON supports easyjson.Unmarshaler interface +func (v *SetShowDebugBordersParams) UnmarshalEasyJSON(l *jlexer.Lexer) { + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay5(l, v) +} +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay6(in *jlexer.Lexer, out *SetPausedInDebuggerMessageParams) { + isTopLevel := in.IsStart() + if in.IsNull() { + if isTopLevel { + in.Consumed() + } + in.Skip() + return + } + in.Delim('{') + for !in.IsDelim('}') { + key := in.UnsafeString() + in.WantColon() + if in.IsNull() { + in.Skip() + in.WantComma() + continue + } + switch key { + case "message": + out.Message = string(in.String()) + default: + in.SkipRecursive() + } + in.WantComma() + } + in.Delim('}') + if isTopLevel { + in.Consumed() + } +} +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay6(out *jwriter.Writer, in SetPausedInDebuggerMessageParams) { + out.RawByte('{') + first := true + _ = first + if in.Message != "" { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"message\":") + out.String(string(in.Message)) + } + out.RawByte('}') +} + +// MarshalJSON supports json.Marshaler interface +func (v SetPausedInDebuggerMessageParams) MarshalJSON() ([]byte, error) { + w := jwriter.Writer{} + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay6(&w, v) + return w.Buffer.BuildBytes(), w.Error +} + +// MarshalEasyJSON supports easyjson.Marshaler interface +func (v SetPausedInDebuggerMessageParams) MarshalEasyJSON(w *jwriter.Writer) { + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay6(w, v) +} + +// UnmarshalJSON supports json.Unmarshaler interface +func (v *SetPausedInDebuggerMessageParams) UnmarshalJSON(data []byte) error { + r := jlexer.Lexer{Data: data} + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay6(&r, v) + return r.Error() +} + +// UnmarshalEasyJSON supports easyjson.Unmarshaler interface +func (v *SetPausedInDebuggerMessageParams) UnmarshalEasyJSON(l *jlexer.Lexer) { + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay6(l, v) +} +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay7(in *jlexer.Lexer, out *SetInspectModeParams) { + isTopLevel := in.IsStart() + if in.IsNull() { + if isTopLevel { + in.Consumed() + } + in.Skip() + return + } + in.Delim('{') + for !in.IsDelim('}') { + key := in.UnsafeString() + in.WantColon() + if in.IsNull() { + in.Skip() + in.WantComma() + continue + } + switch key { + case "mode": + (out.Mode).UnmarshalEasyJSON(in) + case "highlightConfig": + if in.IsNull() { + in.Skip() + out.HighlightConfig = nil + } else { + if out.HighlightConfig == nil { + out.HighlightConfig = new(HighlightConfig) + } + (*out.HighlightConfig).UnmarshalEasyJSON(in) + } + default: + in.SkipRecursive() + } + in.WantComma() + } + in.Delim('}') + if isTopLevel { + in.Consumed() + } +} +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay7(out *jwriter.Writer, in SetInspectModeParams) { + out.RawByte('{') + first := true + _ = first + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"mode\":") + (in.Mode).MarshalEasyJSON(out) + if in.HighlightConfig != nil { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"highlightConfig\":") + if in.HighlightConfig == nil { + out.RawString("null") + } else { + (*in.HighlightConfig).MarshalEasyJSON(out) + } + } + out.RawByte('}') +} + +// MarshalJSON supports json.Marshaler interface +func (v SetInspectModeParams) MarshalJSON() ([]byte, error) { + w := jwriter.Writer{} + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay7(&w, v) + return w.Buffer.BuildBytes(), w.Error +} + +// MarshalEasyJSON supports easyjson.Marshaler interface +func (v SetInspectModeParams) MarshalEasyJSON(w *jwriter.Writer) { + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay7(w, v) +} + +// UnmarshalJSON supports json.Unmarshaler interface +func (v *SetInspectModeParams) UnmarshalJSON(data []byte) error { + r := jlexer.Lexer{Data: data} + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay7(&r, v) + return r.Error() +} + +// UnmarshalEasyJSON supports easyjson.Unmarshaler interface +func (v *SetInspectModeParams) UnmarshalEasyJSON(l *jlexer.Lexer) { + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay7(l, v) +} +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay8(in *jlexer.Lexer, out *HighlightRectParams) { + isTopLevel := in.IsStart() + if in.IsNull() { + if isTopLevel { + in.Consumed() + } + in.Skip() + return + } + in.Delim('{') + for !in.IsDelim('}') { + key := in.UnsafeString() + in.WantColon() + if in.IsNull() { + in.Skip() + in.WantComma() + continue + } + switch key { + case "x": + out.X = int64(in.Int64()) + case "y": + out.Y = int64(in.Int64()) + case "width": + out.Width = int64(in.Int64()) + case "height": + out.Height = int64(in.Int64()) + case "color": + if in.IsNull() { + in.Skip() + out.Color = nil + } else { + if out.Color == nil { + out.Color = new(cdp.RGBA) + } + (*out.Color).UnmarshalEasyJSON(in) + } + case "outlineColor": + if in.IsNull() { + in.Skip() + out.OutlineColor = nil + } else { + if out.OutlineColor == nil { + out.OutlineColor = new(cdp.RGBA) + } + (*out.OutlineColor).UnmarshalEasyJSON(in) + } + default: + in.SkipRecursive() + } + in.WantComma() + } + in.Delim('}') + if isTopLevel { + in.Consumed() + } +} +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay8(out *jwriter.Writer, in HighlightRectParams) { + out.RawByte('{') + first := true + _ = first + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"x\":") + out.Int64(int64(in.X)) + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"y\":") + out.Int64(int64(in.Y)) + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"width\":") + out.Int64(int64(in.Width)) + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"height\":") + out.Int64(int64(in.Height)) + if in.Color != nil { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"color\":") + if in.Color == nil { + out.RawString("null") + } else { + (*in.Color).MarshalEasyJSON(out) + } + } + if in.OutlineColor != nil { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"outlineColor\":") + if in.OutlineColor == nil { + out.RawString("null") + } else { + (*in.OutlineColor).MarshalEasyJSON(out) + } + } + out.RawByte('}') +} + +// MarshalJSON supports json.Marshaler interface +func (v HighlightRectParams) MarshalJSON() ([]byte, error) { + w := jwriter.Writer{} + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay8(&w, v) + return w.Buffer.BuildBytes(), w.Error +} + +// MarshalEasyJSON supports easyjson.Marshaler interface +func (v HighlightRectParams) MarshalEasyJSON(w *jwriter.Writer) { + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay8(w, v) +} + +// UnmarshalJSON supports json.Unmarshaler interface +func (v *HighlightRectParams) UnmarshalJSON(data []byte) error { + r := jlexer.Lexer{Data: data} + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay8(&r, v) + return r.Error() +} + +// UnmarshalEasyJSON supports easyjson.Unmarshaler interface +func (v *HighlightRectParams) UnmarshalEasyJSON(l *jlexer.Lexer) { + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay8(l, v) +} +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay9(in *jlexer.Lexer, out *HighlightQuadParams) { + isTopLevel := in.IsStart() + if in.IsNull() { + if isTopLevel { + in.Consumed() + } + in.Skip() + return + } + in.Delim('{') + for !in.IsDelim('}') { + key := in.UnsafeString() + in.WantColon() + if in.IsNull() { + in.Skip() + in.WantComma() + continue + } + switch key { + case "quad": + if in.IsNull() { + in.Skip() + out.Quad = nil + } else { + in.Delim('[') + if out.Quad == nil { + if !in.IsDelim(']') { + out.Quad = make(dom.Quad, 0, 8) + } else { + out.Quad = dom.Quad{} + } + } else { + out.Quad = (out.Quad)[:0] + } + for !in.IsDelim(']') { + var v1 float64 + v1 = float64(in.Float64()) + out.Quad = append(out.Quad, v1) + in.WantComma() + } + in.Delim(']') + } + case "color": + if in.IsNull() { + in.Skip() + out.Color = nil + } else { + if out.Color == nil { + out.Color = new(cdp.RGBA) + } + (*out.Color).UnmarshalEasyJSON(in) + } + case "outlineColor": + if in.IsNull() { + in.Skip() + out.OutlineColor = nil + } else { + if out.OutlineColor == nil { + out.OutlineColor = new(cdp.RGBA) + } + (*out.OutlineColor).UnmarshalEasyJSON(in) + } + default: + in.SkipRecursive() + } + in.WantComma() + } + in.Delim('}') + if isTopLevel { + in.Consumed() + } +} +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay9(out *jwriter.Writer, in HighlightQuadParams) { + out.RawByte('{') + first := true + _ = first + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"quad\":") + if in.Quad == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 { + out.RawString("null") + } else { + out.RawByte('[') + for v2, v3 := range in.Quad { + if v2 > 0 { + out.RawByte(',') + } + out.Float64(float64(v3)) + } + out.RawByte(']') + } + if in.Color != nil { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"color\":") + if in.Color == nil { + out.RawString("null") + } else { + (*in.Color).MarshalEasyJSON(out) + } + } + if in.OutlineColor != nil { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"outlineColor\":") + if in.OutlineColor == nil { + out.RawString("null") + } else { + (*in.OutlineColor).MarshalEasyJSON(out) + } + } + out.RawByte('}') +} + +// MarshalJSON supports json.Marshaler interface +func (v HighlightQuadParams) MarshalJSON() ([]byte, error) { + w := jwriter.Writer{} + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay9(&w, v) + return w.Buffer.BuildBytes(), w.Error +} + +// MarshalEasyJSON supports easyjson.Marshaler interface +func (v HighlightQuadParams) MarshalEasyJSON(w *jwriter.Writer) { + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay9(w, v) +} + +// UnmarshalJSON supports json.Unmarshaler interface +func (v *HighlightQuadParams) UnmarshalJSON(data []byte) error { + r := jlexer.Lexer{Data: data} + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay9(&r, v) + return r.Error() +} + +// UnmarshalEasyJSON supports easyjson.Unmarshaler interface +func (v *HighlightQuadParams) UnmarshalEasyJSON(l *jlexer.Lexer) { + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay9(l, v) +} +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay10(in *jlexer.Lexer, out *HighlightNodeParams) { + isTopLevel := in.IsStart() + if in.IsNull() { + if isTopLevel { + in.Consumed() + } + in.Skip() + return + } + in.Delim('{') + for !in.IsDelim('}') { + key := in.UnsafeString() + in.WantColon() + if in.IsNull() { + in.Skip() + in.WantComma() + continue + } + switch key { + case "highlightConfig": + if in.IsNull() { + in.Skip() + out.HighlightConfig = nil + } else { + if out.HighlightConfig == nil { + out.HighlightConfig = new(HighlightConfig) + } + (*out.HighlightConfig).UnmarshalEasyJSON(in) + } + case "nodeId": + (out.NodeID).UnmarshalEasyJSON(in) + case "backendNodeId": + (out.BackendNodeID).UnmarshalEasyJSON(in) + case "objectId": + out.ObjectID = runtime.RemoteObjectID(in.String()) + default: + in.SkipRecursive() + } + in.WantComma() + } + in.Delim('}') + if isTopLevel { + in.Consumed() + } +} +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay10(out *jwriter.Writer, in HighlightNodeParams) { + out.RawByte('{') + first := true + _ = first + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"highlightConfig\":") + if in.HighlightConfig == nil { + out.RawString("null") + } else { + (*in.HighlightConfig).MarshalEasyJSON(out) + } + if in.NodeID != 0 { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"nodeId\":") + out.Int64(int64(in.NodeID)) + } + if in.BackendNodeID != 0 { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"backendNodeId\":") + out.Int64(int64(in.BackendNodeID)) + } + if in.ObjectID != "" { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"objectId\":") + out.String(string(in.ObjectID)) + } + out.RawByte('}') +} + +// MarshalJSON supports json.Marshaler interface +func (v HighlightNodeParams) MarshalJSON() ([]byte, error) { + w := jwriter.Writer{} + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay10(&w, v) + return w.Buffer.BuildBytes(), w.Error +} + +// MarshalEasyJSON supports easyjson.Marshaler interface +func (v HighlightNodeParams) MarshalEasyJSON(w *jwriter.Writer) { + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay10(w, v) +} + +// UnmarshalJSON supports json.Unmarshaler interface +func (v *HighlightNodeParams) UnmarshalJSON(data []byte) error { + r := jlexer.Lexer{Data: data} + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay10(&r, v) + return r.Error() +} + +// UnmarshalEasyJSON supports easyjson.Unmarshaler interface +func (v *HighlightNodeParams) UnmarshalEasyJSON(l *jlexer.Lexer) { + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay10(l, v) +} +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay11(in *jlexer.Lexer, out *HighlightFrameParams) { + isTopLevel := in.IsStart() + if in.IsNull() { + if isTopLevel { + in.Consumed() + } + in.Skip() + return + } + in.Delim('{') + for !in.IsDelim('}') { + key := in.UnsafeString() + in.WantColon() + if in.IsNull() { + in.Skip() + in.WantComma() + continue + } + switch key { + case "frameId": + (out.FrameID).UnmarshalEasyJSON(in) + case "contentColor": + if in.IsNull() { + in.Skip() + out.ContentColor = nil + } else { + if out.ContentColor == nil { + out.ContentColor = new(cdp.RGBA) + } + (*out.ContentColor).UnmarshalEasyJSON(in) + } + case "contentOutlineColor": + if in.IsNull() { + in.Skip() + out.ContentOutlineColor = nil + } else { + if out.ContentOutlineColor == nil { + out.ContentOutlineColor = new(cdp.RGBA) + } + (*out.ContentOutlineColor).UnmarshalEasyJSON(in) + } + default: + in.SkipRecursive() + } + in.WantComma() + } + in.Delim('}') + if isTopLevel { + in.Consumed() + } +} +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay11(out *jwriter.Writer, in HighlightFrameParams) { + out.RawByte('{') + first := true + _ = first + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"frameId\":") + out.String(string(in.FrameID)) + if in.ContentColor != nil { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"contentColor\":") + if in.ContentColor == nil { + out.RawString("null") + } else { + (*in.ContentColor).MarshalEasyJSON(out) + } + } + if in.ContentOutlineColor != nil { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"contentOutlineColor\":") + if in.ContentOutlineColor == nil { + out.RawString("null") + } else { + (*in.ContentOutlineColor).MarshalEasyJSON(out) + } + } + out.RawByte('}') +} + +// MarshalJSON supports json.Marshaler interface +func (v HighlightFrameParams) MarshalJSON() ([]byte, error) { + w := jwriter.Writer{} + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay11(&w, v) + return w.Buffer.BuildBytes(), w.Error +} + +// MarshalEasyJSON supports easyjson.Marshaler interface +func (v HighlightFrameParams) MarshalEasyJSON(w *jwriter.Writer) { + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay11(w, v) +} + +// UnmarshalJSON supports json.Unmarshaler interface +func (v *HighlightFrameParams) UnmarshalJSON(data []byte) error { + r := jlexer.Lexer{Data: data} + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay11(&r, v) + return r.Error() +} + +// UnmarshalEasyJSON supports easyjson.Unmarshaler interface +func (v *HighlightFrameParams) UnmarshalEasyJSON(l *jlexer.Lexer) { + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay11(l, v) +} +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay12(in *jlexer.Lexer, out *HighlightConfig) { + isTopLevel := in.IsStart() + if in.IsNull() { + if isTopLevel { + in.Consumed() + } + in.Skip() + return + } + in.Delim('{') + for !in.IsDelim('}') { + key := in.UnsafeString() + in.WantColon() + if in.IsNull() { + in.Skip() + in.WantComma() + continue + } + switch key { + case "showInfo": + out.ShowInfo = bool(in.Bool()) + case "showRulers": + out.ShowRulers = bool(in.Bool()) + case "showExtensionLines": + out.ShowExtensionLines = bool(in.Bool()) + case "displayAsMaterial": + out.DisplayAsMaterial = bool(in.Bool()) + case "contentColor": + if in.IsNull() { + in.Skip() + out.ContentColor = nil + } else { + if out.ContentColor == nil { + out.ContentColor = new(cdp.RGBA) + } + (*out.ContentColor).UnmarshalEasyJSON(in) + } + case "paddingColor": + if in.IsNull() { + in.Skip() + out.PaddingColor = nil + } else { + if out.PaddingColor == nil { + out.PaddingColor = new(cdp.RGBA) + } + (*out.PaddingColor).UnmarshalEasyJSON(in) + } + case "borderColor": + if in.IsNull() { + in.Skip() + out.BorderColor = nil + } else { + if out.BorderColor == nil { + out.BorderColor = new(cdp.RGBA) + } + (*out.BorderColor).UnmarshalEasyJSON(in) + } + case "marginColor": + if in.IsNull() { + in.Skip() + out.MarginColor = nil + } else { + if out.MarginColor == nil { + out.MarginColor = new(cdp.RGBA) + } + (*out.MarginColor).UnmarshalEasyJSON(in) + } + case "eventTargetColor": + if in.IsNull() { + in.Skip() + out.EventTargetColor = nil + } else { + if out.EventTargetColor == nil { + out.EventTargetColor = new(cdp.RGBA) + } + (*out.EventTargetColor).UnmarshalEasyJSON(in) + } + case "shapeColor": + if in.IsNull() { + in.Skip() + out.ShapeColor = nil + } else { + if out.ShapeColor == nil { + out.ShapeColor = new(cdp.RGBA) + } + (*out.ShapeColor).UnmarshalEasyJSON(in) + } + case "shapeMarginColor": + if in.IsNull() { + in.Skip() + out.ShapeMarginColor = nil + } else { + if out.ShapeMarginColor == nil { + out.ShapeMarginColor = new(cdp.RGBA) + } + (*out.ShapeMarginColor).UnmarshalEasyJSON(in) + } + case "selectorList": + out.SelectorList = string(in.String()) + default: + in.SkipRecursive() + } + in.WantComma() + } + in.Delim('}') + if isTopLevel { + in.Consumed() + } +} +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay12(out *jwriter.Writer, in HighlightConfig) { + out.RawByte('{') + first := true + _ = first + if in.ShowInfo { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"showInfo\":") + out.Bool(bool(in.ShowInfo)) + } + if in.ShowRulers { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"showRulers\":") + out.Bool(bool(in.ShowRulers)) + } + if in.ShowExtensionLines { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"showExtensionLines\":") + out.Bool(bool(in.ShowExtensionLines)) + } + if in.DisplayAsMaterial { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"displayAsMaterial\":") + out.Bool(bool(in.DisplayAsMaterial)) + } + if in.ContentColor != nil { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"contentColor\":") + if in.ContentColor == nil { + out.RawString("null") + } else { + (*in.ContentColor).MarshalEasyJSON(out) + } + } + if in.PaddingColor != nil { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"paddingColor\":") + if in.PaddingColor == nil { + out.RawString("null") + } else { + (*in.PaddingColor).MarshalEasyJSON(out) + } + } + if in.BorderColor != nil { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"borderColor\":") + if in.BorderColor == nil { + out.RawString("null") + } else { + (*in.BorderColor).MarshalEasyJSON(out) + } + } + if in.MarginColor != nil { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"marginColor\":") + if in.MarginColor == nil { + out.RawString("null") + } else { + (*in.MarginColor).MarshalEasyJSON(out) + } + } + if in.EventTargetColor != nil { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"eventTargetColor\":") + if in.EventTargetColor == nil { + out.RawString("null") + } else { + (*in.EventTargetColor).MarshalEasyJSON(out) + } + } + if in.ShapeColor != nil { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"shapeColor\":") + if in.ShapeColor == nil { + out.RawString("null") + } else { + (*in.ShapeColor).MarshalEasyJSON(out) + } + } + if in.ShapeMarginColor != nil { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"shapeMarginColor\":") + if in.ShapeMarginColor == nil { + out.RawString("null") + } else { + (*in.ShapeMarginColor).MarshalEasyJSON(out) + } + } + if in.SelectorList != "" { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"selectorList\":") + out.String(string(in.SelectorList)) + } + out.RawByte('}') +} + +// MarshalJSON supports json.Marshaler interface +func (v HighlightConfig) MarshalJSON() ([]byte, error) { + w := jwriter.Writer{} + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay12(&w, v) + return w.Buffer.BuildBytes(), w.Error +} + +// MarshalEasyJSON supports easyjson.Marshaler interface +func (v HighlightConfig) MarshalEasyJSON(w *jwriter.Writer) { + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay12(w, v) +} + +// UnmarshalJSON supports json.Unmarshaler interface +func (v *HighlightConfig) UnmarshalJSON(data []byte) error { + r := jlexer.Lexer{Data: data} + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay12(&r, v) + return r.Error() +} + +// UnmarshalEasyJSON supports easyjson.Unmarshaler interface +func (v *HighlightConfig) UnmarshalEasyJSON(l *jlexer.Lexer) { + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay12(l, v) +} +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay13(in *jlexer.Lexer, out *HideHighlightParams) { + isTopLevel := in.IsStart() + if in.IsNull() { + if isTopLevel { + in.Consumed() + } + in.Skip() + return + } + in.Delim('{') + for !in.IsDelim('}') { + key := in.UnsafeString() + in.WantColon() + if in.IsNull() { + in.Skip() + in.WantComma() + continue + } + switch key { + default: + in.SkipRecursive() + } + in.WantComma() + } + in.Delim('}') + if isTopLevel { + in.Consumed() + } +} +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay13(out *jwriter.Writer, in HideHighlightParams) { + out.RawByte('{') + first := true + _ = first + out.RawByte('}') +} + +// MarshalJSON supports json.Marshaler interface +func (v HideHighlightParams) MarshalJSON() ([]byte, error) { + w := jwriter.Writer{} + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay13(&w, v) + return w.Buffer.BuildBytes(), w.Error +} + +// MarshalEasyJSON supports easyjson.Marshaler interface +func (v HideHighlightParams) MarshalEasyJSON(w *jwriter.Writer) { + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay13(w, v) +} + +// UnmarshalJSON supports json.Unmarshaler interface +func (v *HideHighlightParams) UnmarshalJSON(data []byte) error { + r := jlexer.Lexer{Data: data} + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay13(&r, v) + return r.Error() +} + +// UnmarshalEasyJSON supports easyjson.Unmarshaler interface +func (v *HideHighlightParams) UnmarshalEasyJSON(l *jlexer.Lexer) { + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay13(l, v) +} +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay14(in *jlexer.Lexer, out *GetHighlightObjectForTestReturns) { + isTopLevel := in.IsStart() + if in.IsNull() { + if isTopLevel { + in.Consumed() + } + in.Skip() + return + } + in.Delim('{') + for !in.IsDelim('}') { + key := in.UnsafeString() + in.WantColon() + if in.IsNull() { + in.Skip() + in.WantComma() + continue + } + switch key { + case "highlight": + (out.Highlight).UnmarshalEasyJSON(in) + default: + in.SkipRecursive() + } + in.WantComma() + } + in.Delim('}') + if isTopLevel { + in.Consumed() + } +} +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay14(out *jwriter.Writer, in GetHighlightObjectForTestReturns) { + out.RawByte('{') + first := true + _ = first + if (in.Highlight).IsDefined() { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"highlight\":") + (in.Highlight).MarshalEasyJSON(out) + } + out.RawByte('}') +} + +// MarshalJSON supports json.Marshaler interface +func (v GetHighlightObjectForTestReturns) MarshalJSON() ([]byte, error) { + w := jwriter.Writer{} + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay14(&w, v) + return w.Buffer.BuildBytes(), w.Error +} + +// MarshalEasyJSON supports easyjson.Marshaler interface +func (v GetHighlightObjectForTestReturns) MarshalEasyJSON(w *jwriter.Writer) { + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay14(w, v) +} + +// UnmarshalJSON supports json.Unmarshaler interface +func (v *GetHighlightObjectForTestReturns) UnmarshalJSON(data []byte) error { + r := jlexer.Lexer{Data: data} + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay14(&r, v) + return r.Error() +} + +// UnmarshalEasyJSON supports easyjson.Unmarshaler interface +func (v *GetHighlightObjectForTestReturns) UnmarshalEasyJSON(l *jlexer.Lexer) { + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay14(l, v) +} +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay15(in *jlexer.Lexer, out *GetHighlightObjectForTestParams) { + isTopLevel := in.IsStart() + if in.IsNull() { + if isTopLevel { + in.Consumed() + } + in.Skip() + return + } + in.Delim('{') + for !in.IsDelim('}') { + key := in.UnsafeString() + in.WantColon() + if in.IsNull() { + in.Skip() + in.WantComma() + continue + } + switch key { + case "nodeId": + (out.NodeID).UnmarshalEasyJSON(in) + default: + in.SkipRecursive() + } + in.WantComma() + } + in.Delim('}') + if isTopLevel { + in.Consumed() + } +} +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay15(out *jwriter.Writer, in GetHighlightObjectForTestParams) { + out.RawByte('{') + first := true + _ = first + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"nodeId\":") + out.Int64(int64(in.NodeID)) + out.RawByte('}') +} + +// MarshalJSON supports json.Marshaler interface +func (v GetHighlightObjectForTestParams) MarshalJSON() ([]byte, error) { + w := jwriter.Writer{} + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay15(&w, v) + return w.Buffer.BuildBytes(), w.Error +} + +// MarshalEasyJSON supports easyjson.Marshaler interface +func (v GetHighlightObjectForTestParams) MarshalEasyJSON(w *jwriter.Writer) { + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay15(w, v) +} + +// UnmarshalJSON supports json.Unmarshaler interface +func (v *GetHighlightObjectForTestParams) UnmarshalJSON(data []byte) error { + r := jlexer.Lexer{Data: data} + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay15(&r, v) + return r.Error() +} + +// UnmarshalEasyJSON supports easyjson.Unmarshaler interface +func (v *GetHighlightObjectForTestParams) UnmarshalEasyJSON(l *jlexer.Lexer) { + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay15(l, v) +} +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay16(in *jlexer.Lexer, out *EventNodeHighlightRequested) { + isTopLevel := in.IsStart() + if in.IsNull() { + if isTopLevel { + in.Consumed() + } + in.Skip() + return + } + in.Delim('{') + for !in.IsDelim('}') { + key := in.UnsafeString() + in.WantColon() + if in.IsNull() { + in.Skip() + in.WantComma() + continue + } + switch key { + case "nodeId": + (out.NodeID).UnmarshalEasyJSON(in) + default: + in.SkipRecursive() + } + in.WantComma() + } + in.Delim('}') + if isTopLevel { + in.Consumed() + } +} +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay16(out *jwriter.Writer, in EventNodeHighlightRequested) { + out.RawByte('{') + first := true + _ = first + if in.NodeID != 0 { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"nodeId\":") + out.Int64(int64(in.NodeID)) + } + out.RawByte('}') +} + +// MarshalJSON supports json.Marshaler interface +func (v EventNodeHighlightRequested) MarshalJSON() ([]byte, error) { + w := jwriter.Writer{} + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay16(&w, v) + return w.Buffer.BuildBytes(), w.Error +} + +// MarshalEasyJSON supports easyjson.Marshaler interface +func (v EventNodeHighlightRequested) MarshalEasyJSON(w *jwriter.Writer) { + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay16(w, v) +} + +// UnmarshalJSON supports json.Unmarshaler interface +func (v *EventNodeHighlightRequested) UnmarshalJSON(data []byte) error { + r := jlexer.Lexer{Data: data} + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay16(&r, v) + return r.Error() +} + +// UnmarshalEasyJSON supports easyjson.Unmarshaler interface +func (v *EventNodeHighlightRequested) UnmarshalEasyJSON(l *jlexer.Lexer) { + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay16(l, v) +} +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay17(in *jlexer.Lexer, out *EventInspectNodeRequested) { + isTopLevel := in.IsStart() + if in.IsNull() { + if isTopLevel { + in.Consumed() + } + in.Skip() + return + } + in.Delim('{') + for !in.IsDelim('}') { + key := in.UnsafeString() + in.WantColon() + if in.IsNull() { + in.Skip() + in.WantComma() + continue + } + switch key { + case "backendNodeId": + (out.BackendNodeID).UnmarshalEasyJSON(in) + default: + in.SkipRecursive() + } + in.WantComma() + } + in.Delim('}') + if isTopLevel { + in.Consumed() + } +} +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay17(out *jwriter.Writer, in EventInspectNodeRequested) { + out.RawByte('{') + first := true + _ = first + if in.BackendNodeID != 0 { + if !first { + out.RawByte(',') + } + first = false + out.RawString("\"backendNodeId\":") + out.Int64(int64(in.BackendNodeID)) + } + out.RawByte('}') +} + +// MarshalJSON supports json.Marshaler interface +func (v EventInspectNodeRequested) MarshalJSON() ([]byte, error) { + w := jwriter.Writer{} + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay17(&w, v) + return w.Buffer.BuildBytes(), w.Error +} + +// MarshalEasyJSON supports easyjson.Marshaler interface +func (v EventInspectNodeRequested) MarshalEasyJSON(w *jwriter.Writer) { + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay17(w, v) +} + +// UnmarshalJSON supports json.Unmarshaler interface +func (v *EventInspectNodeRequested) UnmarshalJSON(data []byte) error { + r := jlexer.Lexer{Data: data} + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay17(&r, v) + return r.Error() +} + +// UnmarshalEasyJSON supports easyjson.Unmarshaler interface +func (v *EventInspectNodeRequested) UnmarshalEasyJSON(l *jlexer.Lexer) { + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay17(l, v) +} +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay18(in *jlexer.Lexer, out *EnableParams) { + isTopLevel := in.IsStart() + if in.IsNull() { + if isTopLevel { + in.Consumed() + } + in.Skip() + return + } + in.Delim('{') + for !in.IsDelim('}') { + key := in.UnsafeString() + in.WantColon() + if in.IsNull() { + in.Skip() + in.WantComma() + continue + } + switch key { + default: + in.SkipRecursive() + } + in.WantComma() + } + in.Delim('}') + if isTopLevel { + in.Consumed() + } +} +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay18(out *jwriter.Writer, in EnableParams) { + out.RawByte('{') + first := true + _ = first + out.RawByte('}') +} + +// MarshalJSON supports json.Marshaler interface +func (v EnableParams) MarshalJSON() ([]byte, error) { + w := jwriter.Writer{} + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay18(&w, v) + return w.Buffer.BuildBytes(), w.Error +} + +// MarshalEasyJSON supports easyjson.Marshaler interface +func (v EnableParams) MarshalEasyJSON(w *jwriter.Writer) { + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay18(w, v) +} + +// UnmarshalJSON supports json.Unmarshaler interface +func (v *EnableParams) UnmarshalJSON(data []byte) error { + r := jlexer.Lexer{Data: data} + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay18(&r, v) + return r.Error() +} + +// UnmarshalEasyJSON supports easyjson.Unmarshaler interface +func (v *EnableParams) UnmarshalEasyJSON(l *jlexer.Lexer) { + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay18(l, v) +} +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay19(in *jlexer.Lexer, out *DisableParams) { + isTopLevel := in.IsStart() + if in.IsNull() { + if isTopLevel { + in.Consumed() + } + in.Skip() + return + } + in.Delim('{') + for !in.IsDelim('}') { + key := in.UnsafeString() + in.WantColon() + if in.IsNull() { + in.Skip() + in.WantComma() + continue + } + switch key { + default: + in.SkipRecursive() + } + in.WantComma() + } + in.Delim('}') + if isTopLevel { + in.Consumed() + } +} +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay19(out *jwriter.Writer, in DisableParams) { + out.RawByte('{') + first := true + _ = first + out.RawByte('}') +} + +// MarshalJSON supports json.Marshaler interface +func (v DisableParams) MarshalJSON() ([]byte, error) { + w := jwriter.Writer{} + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay19(&w, v) + return w.Buffer.BuildBytes(), w.Error +} + +// MarshalEasyJSON supports easyjson.Marshaler interface +func (v DisableParams) MarshalEasyJSON(w *jwriter.Writer) { + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpOverlay19(w, v) +} + +// UnmarshalJSON supports json.Unmarshaler interface +func (v *DisableParams) UnmarshalJSON(data []byte) error { + r := jlexer.Lexer{Data: data} + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay19(&r, v) + return r.Error() +} + +// UnmarshalEasyJSON supports easyjson.Unmarshaler interface +func (v *DisableParams) UnmarshalEasyJSON(l *jlexer.Lexer) { + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpOverlay19(l, v) +} diff --git a/cdp/overlay/events.go b/cdp/overlay/events.go new file mode 100644 index 0000000..f982676 --- /dev/null +++ b/cdp/overlay/events.go @@ -0,0 +1,26 @@ +package overlay + +// AUTOGENERATED. DO NOT EDIT. + +import ( + cdp "github.com/knq/chromedp/cdp" +) + +// EventNodeHighlightRequested fired when the node should be highlighted. +// This happens after call to setInspectMode. +type EventNodeHighlightRequested struct { + NodeID cdp.NodeID `json:"nodeId,omitempty"` +} + +// EventInspectNodeRequested fired when the node should be inspected. This +// happens after call to setInspectMode or when user manually inspects an +// element. +type EventInspectNodeRequested struct { + BackendNodeID cdp.BackendNodeID `json:"backendNodeId,omitempty"` // Id of the node to inspect. +} + +// EventTypes all event types in the domain. +var EventTypes = []cdp.MethodType{ + cdp.EventOverlayNodeHighlightRequested, + cdp.EventOverlayInspectNodeRequested, +} diff --git a/cdp/overlay/overlay.go b/cdp/overlay/overlay.go new file mode 100644 index 0000000..8a1763a --- /dev/null +++ b/cdp/overlay/overlay.go @@ -0,0 +1,449 @@ +// Package overlay provides the Chrome Debugging Protocol +// commands, types, and events for the Overlay domain. +// +// This domain provides various functionality related to drawing atop the +// inspected page. +// +// Generated by the chromedp-gen command. +package overlay + +// AUTOGENERATED. DO NOT EDIT. + +import ( + "context" + + cdp "github.com/knq/chromedp/cdp" + "github.com/knq/chromedp/cdp/dom" + "github.com/knq/chromedp/cdp/runtime" + "github.com/mailru/easyjson" +) + +// EnableParams enables domain notifications. +type EnableParams struct{} + +// Enable enables domain notifications. +func Enable() *EnableParams { + return &EnableParams{} +} + +// Do executes Overlay.enable against the provided context and +// target handler. +func (p *EnableParams) Do(ctxt context.Context, h cdp.Handler) (err error) { + return h.Execute(ctxt, cdp.CommandOverlayEnable, nil, nil) +} + +// DisableParams disables domain notifications. +type DisableParams struct{} + +// Disable disables domain notifications. +func Disable() *DisableParams { + return &DisableParams{} +} + +// Do executes Overlay.disable against the provided context and +// target handler. +func (p *DisableParams) Do(ctxt context.Context, h cdp.Handler) (err error) { + return h.Execute(ctxt, cdp.CommandOverlayDisable, nil, nil) +} + +// SetShowPaintRectsParams requests that backend shows paint rectangles. +type SetShowPaintRectsParams struct { + Result bool `json:"result"` // True for showing paint rectangles +} + +// SetShowPaintRects requests that backend shows paint rectangles. +// +// parameters: +// result - True for showing paint rectangles +func SetShowPaintRects(result bool) *SetShowPaintRectsParams { + return &SetShowPaintRectsParams{ + Result: result, + } +} + +// Do executes Overlay.setShowPaintRects against the provided context and +// target handler. +func (p *SetShowPaintRectsParams) Do(ctxt context.Context, h cdp.Handler) (err error) { + return h.Execute(ctxt, cdp.CommandOverlaySetShowPaintRects, p, nil) +} + +// SetShowDebugBordersParams requests that backend shows debug borders on +// layers. +type SetShowDebugBordersParams struct { + Show bool `json:"show"` // True for showing debug borders +} + +// SetShowDebugBorders requests that backend shows debug borders on layers. +// +// parameters: +// show - True for showing debug borders +func SetShowDebugBorders(show bool) *SetShowDebugBordersParams { + return &SetShowDebugBordersParams{ + Show: show, + } +} + +// Do executes Overlay.setShowDebugBorders against the provided context and +// target handler. +func (p *SetShowDebugBordersParams) Do(ctxt context.Context, h cdp.Handler) (err error) { + return h.Execute(ctxt, cdp.CommandOverlaySetShowDebugBorders, p, nil) +} + +// SetShowFPSCounterParams requests that backend shows the FPS counter. +type SetShowFPSCounterParams struct { + Show bool `json:"show"` // True for showing the FPS counter +} + +// SetShowFPSCounter requests that backend shows the FPS counter. +// +// parameters: +// show - True for showing the FPS counter +func SetShowFPSCounter(show bool) *SetShowFPSCounterParams { + return &SetShowFPSCounterParams{ + Show: show, + } +} + +// Do executes Overlay.setShowFPSCounter against the provided context and +// target handler. +func (p *SetShowFPSCounterParams) Do(ctxt context.Context, h cdp.Handler) (err error) { + return h.Execute(ctxt, cdp.CommandOverlaySetShowFPSCounter, p, nil) +} + +// SetShowScrollBottleneckRectsParams requests that backend shows scroll +// bottleneck rects. +type SetShowScrollBottleneckRectsParams struct { + Show bool `json:"show"` // True for showing scroll bottleneck rects +} + +// SetShowScrollBottleneckRects requests that backend shows scroll bottleneck +// rects. +// +// parameters: +// show - True for showing scroll bottleneck rects +func SetShowScrollBottleneckRects(show bool) *SetShowScrollBottleneckRectsParams { + return &SetShowScrollBottleneckRectsParams{ + Show: show, + } +} + +// Do executes Overlay.setShowScrollBottleneckRects against the provided context and +// target handler. +func (p *SetShowScrollBottleneckRectsParams) Do(ctxt context.Context, h cdp.Handler) (err error) { + return h.Execute(ctxt, cdp.CommandOverlaySetShowScrollBottleneckRects, p, nil) +} + +// SetShowViewportSizeOnResizeParams paints viewport size upon main frame +// resize. +type SetShowViewportSizeOnResizeParams struct { + Show bool `json:"show"` // Whether to paint size or not. +} + +// SetShowViewportSizeOnResize paints viewport size upon main frame resize. +// +// parameters: +// show - Whether to paint size or not. +func SetShowViewportSizeOnResize(show bool) *SetShowViewportSizeOnResizeParams { + return &SetShowViewportSizeOnResizeParams{ + Show: show, + } +} + +// Do executes Overlay.setShowViewportSizeOnResize against the provided context and +// target handler. +func (p *SetShowViewportSizeOnResizeParams) Do(ctxt context.Context, h cdp.Handler) (err error) { + return h.Execute(ctxt, cdp.CommandOverlaySetShowViewportSizeOnResize, p, nil) +} + +// SetPausedInDebuggerMessageParams [no description]. +type SetPausedInDebuggerMessageParams struct { + Message string `json:"message,omitempty"` // The message to display, also triggers resume and step over controls. +} + +// SetPausedInDebuggerMessage [no description]. +// +// parameters: +func SetPausedInDebuggerMessage() *SetPausedInDebuggerMessageParams { + return &SetPausedInDebuggerMessageParams{} +} + +// WithMessage the message to display, also triggers resume and step over +// controls. +func (p SetPausedInDebuggerMessageParams) WithMessage(message string) *SetPausedInDebuggerMessageParams { + p.Message = message + return &p +} + +// Do executes Overlay.setPausedInDebuggerMessage against the provided context and +// target handler. +func (p *SetPausedInDebuggerMessageParams) Do(ctxt context.Context, h cdp.Handler) (err error) { + return h.Execute(ctxt, cdp.CommandOverlaySetPausedInDebuggerMessage, p, nil) +} + +// SetSuspendedParams [no description]. +type SetSuspendedParams struct { + Suspended bool `json:"suspended"` // Whether overlay should be suspended and not consume any resources until resumed. +} + +// SetSuspended [no description]. +// +// parameters: +// suspended - Whether overlay should be suspended and not consume any resources until resumed. +func SetSuspended(suspended bool) *SetSuspendedParams { + return &SetSuspendedParams{ + Suspended: suspended, + } +} + +// Do executes Overlay.setSuspended against the provided context and +// target handler. +func (p *SetSuspendedParams) Do(ctxt context.Context, h cdp.Handler) (err error) { + return h.Execute(ctxt, cdp.CommandOverlaySetSuspended, p, nil) +} + +// SetInspectModeParams enters the 'inspect' mode. In this mode, elements +// that user is hovering over are highlighted. Backend then generates +// 'inspectNodeRequested' event upon element selection. +type SetInspectModeParams struct { + Mode InspectMode `json:"mode"` // Set an inspection mode. + HighlightConfig *HighlightConfig `json:"highlightConfig,omitempty"` // A descriptor for the highlight appearance of hovered-over nodes. May be omitted if enabled == false. +} + +// SetInspectMode enters the 'inspect' mode. In this mode, elements that user +// is hovering over are highlighted. Backend then generates +// 'inspectNodeRequested' event upon element selection. +// +// parameters: +// mode - Set an inspection mode. +func SetInspectMode(mode InspectMode) *SetInspectModeParams { + return &SetInspectModeParams{ + Mode: mode, + } +} + +// WithHighlightConfig a descriptor for the highlight appearance of +// hovered-over nodes. May be omitted if enabled == false. +func (p SetInspectModeParams) WithHighlightConfig(highlightConfig *HighlightConfig) *SetInspectModeParams { + p.HighlightConfig = highlightConfig + return &p +} + +// Do executes Overlay.setInspectMode against the provided context and +// target handler. +func (p *SetInspectModeParams) Do(ctxt context.Context, h cdp.Handler) (err error) { + return h.Execute(ctxt, cdp.CommandOverlaySetInspectMode, p, nil) +} + +// HighlightRectParams highlights given rectangle. Coordinates are absolute +// with respect to the main frame viewport. +type HighlightRectParams struct { + X int64 `json:"x"` // X coordinate + Y int64 `json:"y"` // Y coordinate + Width int64 `json:"width"` // Rectangle width + Height int64 `json:"height"` // Rectangle height + Color *cdp.RGBA `json:"color,omitempty"` // The highlight fill color (default: transparent). + OutlineColor *cdp.RGBA `json:"outlineColor,omitempty"` // The highlight outline color (default: transparent). +} + +// HighlightRect highlights given rectangle. Coordinates are absolute with +// respect to the main frame viewport. +// +// parameters: +// x - X coordinate +// y - Y coordinate +// width - Rectangle width +// height - Rectangle height +func HighlightRect(x int64, y int64, width int64, height int64) *HighlightRectParams { + return &HighlightRectParams{ + X: x, + Y: y, + Width: width, + Height: height, + } +} + +// WithColor the highlight fill color (default: transparent). +func (p HighlightRectParams) WithColor(color *cdp.RGBA) *HighlightRectParams { + p.Color = color + return &p +} + +// WithOutlineColor the highlight outline color (default: transparent). +func (p HighlightRectParams) WithOutlineColor(outlineColor *cdp.RGBA) *HighlightRectParams { + p.OutlineColor = outlineColor + return &p +} + +// Do executes Overlay.highlightRect against the provided context and +// target handler. +func (p *HighlightRectParams) Do(ctxt context.Context, h cdp.Handler) (err error) { + return h.Execute(ctxt, cdp.CommandOverlayHighlightRect, p, nil) +} + +// HighlightQuadParams highlights given quad. Coordinates are absolute with +// respect to the main frame viewport. +type HighlightQuadParams struct { + Quad dom.Quad `json:"quad"` // Quad to highlight + Color *cdp.RGBA `json:"color,omitempty"` // The highlight fill color (default: transparent). + OutlineColor *cdp.RGBA `json:"outlineColor,omitempty"` // The highlight outline color (default: transparent). +} + +// HighlightQuad highlights given quad. Coordinates are absolute with respect +// to the main frame viewport. +// +// parameters: +// quad - Quad to highlight +func HighlightQuad(quad dom.Quad) *HighlightQuadParams { + return &HighlightQuadParams{ + Quad: quad, + } +} + +// WithColor the highlight fill color (default: transparent). +func (p HighlightQuadParams) WithColor(color *cdp.RGBA) *HighlightQuadParams { + p.Color = color + return &p +} + +// WithOutlineColor the highlight outline color (default: transparent). +func (p HighlightQuadParams) WithOutlineColor(outlineColor *cdp.RGBA) *HighlightQuadParams { + p.OutlineColor = outlineColor + return &p +} + +// Do executes Overlay.highlightQuad against the provided context and +// target handler. +func (p *HighlightQuadParams) Do(ctxt context.Context, h cdp.Handler) (err error) { + return h.Execute(ctxt, cdp.CommandOverlayHighlightQuad, p, nil) +} + +// HighlightNodeParams highlights DOM node with given id or with the given +// JavaScript object wrapper. Either nodeId or objectId must be specified. +type HighlightNodeParams struct { + HighlightConfig *HighlightConfig `json:"highlightConfig"` // A descriptor for the highlight appearance. + NodeID cdp.NodeID `json:"nodeId,omitempty"` // Identifier of the node to highlight. + BackendNodeID cdp.BackendNodeID `json:"backendNodeId,omitempty"` // Identifier of the backend node to highlight. + ObjectID runtime.RemoteObjectID `json:"objectId,omitempty"` // JavaScript object id of the node to be highlighted. +} + +// HighlightNode highlights DOM node with given id or with the given +// JavaScript object wrapper. Either nodeId or objectId must be specified. +// +// parameters: +// highlightConfig - A descriptor for the highlight appearance. +func HighlightNode(highlightConfig *HighlightConfig) *HighlightNodeParams { + return &HighlightNodeParams{ + HighlightConfig: highlightConfig, + } +} + +// WithNodeID identifier of the node to highlight. +func (p HighlightNodeParams) WithNodeID(nodeID cdp.NodeID) *HighlightNodeParams { + p.NodeID = nodeID + return &p +} + +// WithBackendNodeID identifier of the backend node to highlight. +func (p HighlightNodeParams) WithBackendNodeID(backendNodeID cdp.BackendNodeID) *HighlightNodeParams { + p.BackendNodeID = backendNodeID + return &p +} + +// WithObjectID javaScript object id of the node to be highlighted. +func (p HighlightNodeParams) WithObjectID(objectID runtime.RemoteObjectID) *HighlightNodeParams { + p.ObjectID = objectID + return &p +} + +// Do executes Overlay.highlightNode against the provided context and +// target handler. +func (p *HighlightNodeParams) Do(ctxt context.Context, h cdp.Handler) (err error) { + return h.Execute(ctxt, cdp.CommandOverlayHighlightNode, p, nil) +} + +// HighlightFrameParams highlights owner element of the frame with given id. +type HighlightFrameParams struct { + FrameID cdp.FrameID `json:"frameId"` // Identifier of the frame to highlight. + ContentColor *cdp.RGBA `json:"contentColor,omitempty"` // The content box highlight fill color (default: transparent). + ContentOutlineColor *cdp.RGBA `json:"contentOutlineColor,omitempty"` // The content box highlight outline color (default: transparent). +} + +// HighlightFrame highlights owner element of the frame with given id. +// +// parameters: +// frameID - Identifier of the frame to highlight. +func HighlightFrame(frameID cdp.FrameID) *HighlightFrameParams { + return &HighlightFrameParams{ + FrameID: frameID, + } +} + +// WithContentColor the content box highlight fill color (default: +// transparent). +func (p HighlightFrameParams) WithContentColor(contentColor *cdp.RGBA) *HighlightFrameParams { + p.ContentColor = contentColor + return &p +} + +// WithContentOutlineColor the content box highlight outline color (default: +// transparent). +func (p HighlightFrameParams) WithContentOutlineColor(contentOutlineColor *cdp.RGBA) *HighlightFrameParams { + p.ContentOutlineColor = contentOutlineColor + return &p +} + +// Do executes Overlay.highlightFrame against the provided context and +// target handler. +func (p *HighlightFrameParams) Do(ctxt context.Context, h cdp.Handler) (err error) { + return h.Execute(ctxt, cdp.CommandOverlayHighlightFrame, p, nil) +} + +// HideHighlightParams hides any highlight. +type HideHighlightParams struct{} + +// HideHighlight hides any highlight. +func HideHighlight() *HideHighlightParams { + return &HideHighlightParams{} +} + +// Do executes Overlay.hideHighlight against the provided context and +// target handler. +func (p *HideHighlightParams) Do(ctxt context.Context, h cdp.Handler) (err error) { + return h.Execute(ctxt, cdp.CommandOverlayHideHighlight, nil, nil) +} + +// GetHighlightObjectForTestParams for testing. +type GetHighlightObjectForTestParams struct { + NodeID cdp.NodeID `json:"nodeId"` // Id of the node to get highlight object for. +} + +// GetHighlightObjectForTest for testing. +// +// parameters: +// nodeID - Id of the node to get highlight object for. +func GetHighlightObjectForTest(nodeID cdp.NodeID) *GetHighlightObjectForTestParams { + return &GetHighlightObjectForTestParams{ + NodeID: nodeID, + } +} + +// GetHighlightObjectForTestReturns return values. +type GetHighlightObjectForTestReturns struct { + Highlight easyjson.RawMessage `json:"highlight,omitempty"` +} + +// Do executes Overlay.getHighlightObjectForTest against the provided context and +// target handler. +// +// returns: +// highlight - Highlight data for the node. +func (p *GetHighlightObjectForTestParams) Do(ctxt context.Context, h cdp.Handler) (highlight easyjson.RawMessage, err error) { + // execute + var res GetHighlightObjectForTestReturns + err = h.Execute(ctxt, cdp.CommandOverlayGetHighlightObjectForTest, p, &res) + if err != nil { + return nil, err + } + + return res.Highlight, nil +} diff --git a/cdp/overlay/types.go b/cdp/overlay/types.go new file mode 100644 index 0000000..2833b68 --- /dev/null +++ b/cdp/overlay/types.go @@ -0,0 +1,73 @@ +package overlay + +// AUTOGENERATED. DO NOT EDIT. + +import ( + "errors" + + cdp "github.com/knq/chromedp/cdp" + "github.com/mailru/easyjson" + "github.com/mailru/easyjson/jlexer" + "github.com/mailru/easyjson/jwriter" +) + +// HighlightConfig configuration data for the highlighting of page elements. +type HighlightConfig struct { + ShowInfo bool `json:"showInfo,omitempty"` // Whether the node info tooltip should be shown (default: false). + ShowRulers bool `json:"showRulers,omitempty"` // Whether the rulers should be shown (default: false). + ShowExtensionLines bool `json:"showExtensionLines,omitempty"` // Whether the extension lines from node to the rulers should be shown (default: false). + DisplayAsMaterial bool `json:"displayAsMaterial,omitempty"` + ContentColor *cdp.RGBA `json:"contentColor,omitempty"` // The content box highlight fill color (default: transparent). + PaddingColor *cdp.RGBA `json:"paddingColor,omitempty"` // The padding highlight fill color (default: transparent). + BorderColor *cdp.RGBA `json:"borderColor,omitempty"` // The border highlight fill color (default: transparent). + MarginColor *cdp.RGBA `json:"marginColor,omitempty"` // The margin highlight fill color (default: transparent). + EventTargetColor *cdp.RGBA `json:"eventTargetColor,omitempty"` // The event target element highlight fill color (default: transparent). + ShapeColor *cdp.RGBA `json:"shapeColor,omitempty"` // The shape outside fill color (default: transparent). + ShapeMarginColor *cdp.RGBA `json:"shapeMarginColor,omitempty"` // The shape margin fill color (default: transparent). + SelectorList string `json:"selectorList,omitempty"` // Selectors to highlight relevant nodes. +} + +// InspectMode [no description]. +type InspectMode string + +// String returns the InspectMode as string value. +func (t InspectMode) String() string { + return string(t) +} + +// InspectMode values. +const ( + InspectModeSearchForNode InspectMode = "searchForNode" + InspectModeSearchForUAShadowDOM InspectMode = "searchForUAShadowDOM" + InspectModeNone InspectMode = "none" +) + +// MarshalEasyJSON satisfies easyjson.Marshaler. +func (t InspectMode) MarshalEasyJSON(out *jwriter.Writer) { + out.String(string(t)) +} + +// MarshalJSON satisfies json.Marshaler. +func (t InspectMode) MarshalJSON() ([]byte, error) { + return easyjson.Marshal(t) +} + +// UnmarshalEasyJSON satisfies easyjson.Unmarshaler. +func (t *InspectMode) UnmarshalEasyJSON(in *jlexer.Lexer) { + switch InspectMode(in.String()) { + case InspectModeSearchForNode: + *t = InspectModeSearchForNode + case InspectModeSearchForUAShadowDOM: + *t = InspectModeSearchForUAShadowDOM + case InspectModeNone: + *t = InspectModeNone + + default: + in.AddError(errors.New("unknown InspectMode value")) + } +} + +// UnmarshalJSON satisfies json.Unmarshaler. +func (t *InspectMode) UnmarshalJSON(buf []byte) error { + return easyjson.Unmarshal(buf, t) +} diff --git a/cdp/page/easyjson.go b/cdp/page/easyjson.go index b24910b..4f1c04f 100644 --- a/cdp/page/easyjson.go +++ b/cdp/page/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package page @@ -4441,86 +4441,7 @@ func (v *DisableParams) UnmarshalJSON(data []byte) error { func (v *DisableParams) UnmarshalEasyJSON(l *jlexer.Lexer) { easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage53(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage54(in *jlexer.Lexer, out *ConfigureOverlayParams) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "suspended": - out.Suspended = bool(in.Bool()) - case "message": - out.Message = string(in.String()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage54(out *jwriter.Writer, in ConfigureOverlayParams) { - out.RawByte('{') - first := true - _ = first - if in.Suspended { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"suspended\":") - out.Bool(bool(in.Suspended)) - } - if in.Message != "" { - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"message\":") - out.String(string(in.Message)) - } - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v ConfigureOverlayParams) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage54(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v ConfigureOverlayParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage54(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *ConfigureOverlayParams) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage54(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *ConfigureOverlayParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage54(l, v) -} -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage55(in *jlexer.Lexer, out *CaptureScreenshotReturns) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage54(in *jlexer.Lexer, out *CaptureScreenshotReturns) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -4551,7 +4472,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage55(in *jlexer.Lexer, out * in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage55(out *jwriter.Writer, in CaptureScreenshotReturns) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage54(out *jwriter.Writer, in CaptureScreenshotReturns) { out.RawByte('{') first := true _ = first @@ -4569,27 +4490,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage55(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v CaptureScreenshotReturns) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage55(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage54(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v CaptureScreenshotReturns) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage55(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage54(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *CaptureScreenshotReturns) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage55(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage54(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *CaptureScreenshotReturns) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage55(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage54(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage56(in *jlexer.Lexer, out *CaptureScreenshotParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage55(in *jlexer.Lexer, out *CaptureScreenshotParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -4624,7 +4545,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage56(in *jlexer.Lexer, out * in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage56(out *jwriter.Writer, in CaptureScreenshotParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage55(out *jwriter.Writer, in CaptureScreenshotParams) { out.RawByte('{') first := true _ = first @@ -4658,27 +4579,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage56(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v CaptureScreenshotParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage56(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage55(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v CaptureScreenshotParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage56(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage55(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *CaptureScreenshotParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage56(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage55(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *CaptureScreenshotParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage56(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage55(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage57(in *jlexer.Lexer, out *AppManifestError) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage56(in *jlexer.Lexer, out *AppManifestError) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -4715,7 +4636,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage57(in *jlexer.Lexer, out * in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage57(out *jwriter.Writer, in AppManifestError) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage56(out *jwriter.Writer, in AppManifestError) { out.RawByte('{') first := true _ = first @@ -4757,27 +4678,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage57(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v AppManifestError) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage57(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage56(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v AppManifestError) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage57(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage56(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *AppManifestError) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage57(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage56(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *AppManifestError) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage57(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage56(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage58(in *jlexer.Lexer, out *AddScriptToEvaluateOnLoadReturns) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage57(in *jlexer.Lexer, out *AddScriptToEvaluateOnLoadReturns) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -4808,7 +4729,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage58(in *jlexer.Lexer, out * in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage58(out *jwriter.Writer, in AddScriptToEvaluateOnLoadReturns) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage57(out *jwriter.Writer, in AddScriptToEvaluateOnLoadReturns) { out.RawByte('{') first := true _ = first @@ -4826,27 +4747,27 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage58(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v AddScriptToEvaluateOnLoadReturns) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage58(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage57(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v AddScriptToEvaluateOnLoadReturns) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage58(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage57(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *AddScriptToEvaluateOnLoadReturns) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage58(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage57(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *AddScriptToEvaluateOnLoadReturns) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage58(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage57(l, v) } -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage59(in *jlexer.Lexer, out *AddScriptToEvaluateOnLoadParams) { +func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage58(in *jlexer.Lexer, out *AddScriptToEvaluateOnLoadParams) { isTopLevel := in.IsStart() if in.IsNull() { if isTopLevel { @@ -4877,7 +4798,7 @@ func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage59(in *jlexer.Lexer, out * in.Consumed() } } -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage59(out *jwriter.Writer, in AddScriptToEvaluateOnLoadParams) { +func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage58(out *jwriter.Writer, in AddScriptToEvaluateOnLoadParams) { out.RawByte('{') first := true _ = first @@ -4893,23 +4814,23 @@ func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage59(out *jwriter.Writer, in // MarshalJSON supports json.Marshaler interface func (v AddScriptToEvaluateOnLoadParams) MarshalJSON() ([]byte, error) { w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage59(&w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage58(&w, v) return w.Buffer.BuildBytes(), w.Error } // MarshalEasyJSON supports easyjson.Marshaler interface func (v AddScriptToEvaluateOnLoadParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage59(w, v) + easyjsonC5a4559bEncodeGithubComKnqChromedpCdpPage58(w, v) } // UnmarshalJSON supports json.Unmarshaler interface func (v *AddScriptToEvaluateOnLoadParams) UnmarshalJSON(data []byte) error { r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage59(&r, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage58(&r, v) return r.Error() } // UnmarshalEasyJSON supports easyjson.Unmarshaler interface func (v *AddScriptToEvaluateOnLoadParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage59(l, v) + easyjsonC5a4559bDecodeGithubComKnqChromedpCdpPage58(l, v) } diff --git a/cdp/page/page.go b/cdp/page/page.go index fb79e69..c30208d 100644 --- a/cdp/page/page.go +++ b/cdp/page/page.go @@ -647,38 +647,6 @@ func (p *HandleJavaScriptDialogParams) Do(ctxt context.Context, h cdp.Handler) ( return h.Execute(ctxt, cdp.CommandPageHandleJavaScriptDialog, p, nil) } -// ConfigureOverlayParams configures overlay. -type ConfigureOverlayParams struct { - Suspended bool `json:"suspended,omitempty"` // Whether overlay should be suspended and not consume any resources. - Message string `json:"message,omitempty"` // Overlay message to display. -} - -// ConfigureOverlay configures overlay. -// -// parameters: -func ConfigureOverlay() *ConfigureOverlayParams { - return &ConfigureOverlayParams{} -} - -// WithSuspended whether overlay should be suspended and not consume any -// resources. -func (p ConfigureOverlayParams) WithSuspended(suspended bool) *ConfigureOverlayParams { - p.Suspended = suspended - return &p -} - -// WithMessage overlay message to display. -func (p ConfigureOverlayParams) WithMessage(message string) *ConfigureOverlayParams { - p.Message = message - return &p -} - -// Do executes Page.configureOverlay against the provided context and -// target handler. -func (p *ConfigureOverlayParams) Do(ctxt context.Context, h cdp.Handler) (err error) { - return h.Execute(ctxt, cdp.CommandPageConfigureOverlay, p, nil) -} - // GetAppManifestParams [no description]. type GetAppManifestParams struct{} diff --git a/cdp/profiler/easyjson.go b/cdp/profiler/easyjson.go index ff53c36..80e2b4c 100644 --- a/cdp/profiler/easyjson.go +++ b/cdp/profiler/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package profiler diff --git a/cdp/profiler/events.go b/cdp/profiler/events.go index 615dd3a..09a009b 100644 --- a/cdp/profiler/events.go +++ b/cdp/profiler/events.go @@ -7,7 +7,7 @@ import ( "github.com/knq/chromedp/cdp/debugger" ) -// EventConsoleProfileStarted sent when new profile recodring is started +// EventConsoleProfileStarted sent when new profile recording is started // using console.profile() call. type EventConsoleProfileStarted struct { ID string `json:"id,omitempty"` diff --git a/cdp/rendering/easyjson.go b/cdp/rendering/easyjson.go deleted file mode 100644 index c7e368e..0000000 --- a/cdp/rendering/easyjson.go +++ /dev/null @@ -1,354 +0,0 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. - -package rendering - -import ( - json "encoding/json" - easyjson "github.com/mailru/easyjson" - jlexer "github.com/mailru/easyjson/jlexer" - jwriter "github.com/mailru/easyjson/jwriter" -) - -// suppress unused package warning -var ( - _ *json.RawMessage - _ *jlexer.Lexer - _ *jwriter.Writer - _ easyjson.Marshaler -) - -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpRendering(in *jlexer.Lexer, out *SetShowViewportSizeOnResizeParams) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "show": - out.Show = bool(in.Bool()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpRendering(out *jwriter.Writer, in SetShowViewportSizeOnResizeParams) { - out.RawByte('{') - first := true - _ = first - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"show\":") - out.Bool(bool(in.Show)) - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v SetShowViewportSizeOnResizeParams) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpRendering(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v SetShowViewportSizeOnResizeParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpRendering(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *SetShowViewportSizeOnResizeParams) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpRendering(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *SetShowViewportSizeOnResizeParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpRendering(l, v) -} -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpRendering1(in *jlexer.Lexer, out *SetShowScrollBottleneckRectsParams) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "show": - out.Show = bool(in.Bool()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpRendering1(out *jwriter.Writer, in SetShowScrollBottleneckRectsParams) { - out.RawByte('{') - first := true - _ = first - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"show\":") - out.Bool(bool(in.Show)) - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v SetShowScrollBottleneckRectsParams) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpRendering1(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v SetShowScrollBottleneckRectsParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpRendering1(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *SetShowScrollBottleneckRectsParams) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpRendering1(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *SetShowScrollBottleneckRectsParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpRendering1(l, v) -} -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpRendering2(in *jlexer.Lexer, out *SetShowPaintRectsParams) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "result": - out.Result = bool(in.Bool()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpRendering2(out *jwriter.Writer, in SetShowPaintRectsParams) { - out.RawByte('{') - first := true - _ = first - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"result\":") - out.Bool(bool(in.Result)) - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v SetShowPaintRectsParams) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpRendering2(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v SetShowPaintRectsParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpRendering2(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *SetShowPaintRectsParams) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpRendering2(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *SetShowPaintRectsParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpRendering2(l, v) -} -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpRendering3(in *jlexer.Lexer, out *SetShowFPSCounterParams) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "show": - out.Show = bool(in.Bool()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpRendering3(out *jwriter.Writer, in SetShowFPSCounterParams) { - out.RawByte('{') - first := true - _ = first - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"show\":") - out.Bool(bool(in.Show)) - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v SetShowFPSCounterParams) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpRendering3(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v SetShowFPSCounterParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpRendering3(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *SetShowFPSCounterParams) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpRendering3(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *SetShowFPSCounterParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpRendering3(l, v) -} -func easyjsonC5a4559bDecodeGithubComKnqChromedpCdpRendering4(in *jlexer.Lexer, out *SetShowDebugBordersParams) { - isTopLevel := in.IsStart() - if in.IsNull() { - if isTopLevel { - in.Consumed() - } - in.Skip() - return - } - in.Delim('{') - for !in.IsDelim('}') { - key := in.UnsafeString() - in.WantColon() - if in.IsNull() { - in.Skip() - in.WantComma() - continue - } - switch key { - case "show": - out.Show = bool(in.Bool()) - default: - in.SkipRecursive() - } - in.WantComma() - } - in.Delim('}') - if isTopLevel { - in.Consumed() - } -} -func easyjsonC5a4559bEncodeGithubComKnqChromedpCdpRendering4(out *jwriter.Writer, in SetShowDebugBordersParams) { - out.RawByte('{') - first := true - _ = first - if !first { - out.RawByte(',') - } - first = false - out.RawString("\"show\":") - out.Bool(bool(in.Show)) - out.RawByte('}') -} - -// MarshalJSON supports json.Marshaler interface -func (v SetShowDebugBordersParams) MarshalJSON() ([]byte, error) { - w := jwriter.Writer{} - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpRendering4(&w, v) - return w.Buffer.BuildBytes(), w.Error -} - -// MarshalEasyJSON supports easyjson.Marshaler interface -func (v SetShowDebugBordersParams) MarshalEasyJSON(w *jwriter.Writer) { - easyjsonC5a4559bEncodeGithubComKnqChromedpCdpRendering4(w, v) -} - -// UnmarshalJSON supports json.Unmarshaler interface -func (v *SetShowDebugBordersParams) UnmarshalJSON(data []byte) error { - r := jlexer.Lexer{Data: data} - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpRendering4(&r, v) - return r.Error() -} - -// UnmarshalEasyJSON supports easyjson.Unmarshaler interface -func (v *SetShowDebugBordersParams) UnmarshalEasyJSON(l *jlexer.Lexer) { - easyjsonC5a4559bDecodeGithubComKnqChromedpCdpRendering4(l, v) -} diff --git a/cdp/rendering/rendering.go b/cdp/rendering/rendering.go deleted file mode 100644 index 49edf49..0000000 --- a/cdp/rendering/rendering.go +++ /dev/null @@ -1,124 +0,0 @@ -// Package rendering provides the Chrome Debugging Protocol -// commands, types, and events for the Rendering domain. -// -// This domain allows to control rendering of the page. -// -// Generated by the chromedp-gen command. -package rendering - -// AUTOGENERATED. DO NOT EDIT. - -import ( - "context" - - cdp "github.com/knq/chromedp/cdp" -) - -// SetShowPaintRectsParams requests that backend shows paint rectangles. -type SetShowPaintRectsParams struct { - Result bool `json:"result"` // True for showing paint rectangles -} - -// SetShowPaintRects requests that backend shows paint rectangles. -// -// parameters: -// result - True for showing paint rectangles -func SetShowPaintRects(result bool) *SetShowPaintRectsParams { - return &SetShowPaintRectsParams{ - Result: result, - } -} - -// Do executes Rendering.setShowPaintRects against the provided context and -// target handler. -func (p *SetShowPaintRectsParams) Do(ctxt context.Context, h cdp.Handler) (err error) { - return h.Execute(ctxt, cdp.CommandRenderingSetShowPaintRects, p, nil) -} - -// SetShowDebugBordersParams requests that backend shows debug borders on -// layers. -type SetShowDebugBordersParams struct { - Show bool `json:"show"` // True for showing debug borders -} - -// SetShowDebugBorders requests that backend shows debug borders on layers. -// -// parameters: -// show - True for showing debug borders -func SetShowDebugBorders(show bool) *SetShowDebugBordersParams { - return &SetShowDebugBordersParams{ - Show: show, - } -} - -// Do executes Rendering.setShowDebugBorders against the provided context and -// target handler. -func (p *SetShowDebugBordersParams) Do(ctxt context.Context, h cdp.Handler) (err error) { - return h.Execute(ctxt, cdp.CommandRenderingSetShowDebugBorders, p, nil) -} - -// SetShowFPSCounterParams requests that backend shows the FPS counter. -type SetShowFPSCounterParams struct { - Show bool `json:"show"` // True for showing the FPS counter -} - -// SetShowFPSCounter requests that backend shows the FPS counter. -// -// parameters: -// show - True for showing the FPS counter -func SetShowFPSCounter(show bool) *SetShowFPSCounterParams { - return &SetShowFPSCounterParams{ - Show: show, - } -} - -// Do executes Rendering.setShowFPSCounter against the provided context and -// target handler. -func (p *SetShowFPSCounterParams) Do(ctxt context.Context, h cdp.Handler) (err error) { - return h.Execute(ctxt, cdp.CommandRenderingSetShowFPSCounter, p, nil) -} - -// SetShowScrollBottleneckRectsParams requests that backend shows scroll -// bottleneck rects. -type SetShowScrollBottleneckRectsParams struct { - Show bool `json:"show"` // True for showing scroll bottleneck rects -} - -// SetShowScrollBottleneckRects requests that backend shows scroll bottleneck -// rects. -// -// parameters: -// show - True for showing scroll bottleneck rects -func SetShowScrollBottleneckRects(show bool) *SetShowScrollBottleneckRectsParams { - return &SetShowScrollBottleneckRectsParams{ - Show: show, - } -} - -// Do executes Rendering.setShowScrollBottleneckRects against the provided context and -// target handler. -func (p *SetShowScrollBottleneckRectsParams) Do(ctxt context.Context, h cdp.Handler) (err error) { - return h.Execute(ctxt, cdp.CommandRenderingSetShowScrollBottleneckRects, p, nil) -} - -// SetShowViewportSizeOnResizeParams paints viewport size upon main frame -// resize. -type SetShowViewportSizeOnResizeParams struct { - Show bool `json:"show"` // Whether to paint size or not. -} - -// SetShowViewportSizeOnResize paints viewport size upon main frame resize. -// -// parameters: -// show - Whether to paint size or not. -func SetShowViewportSizeOnResize(show bool) *SetShowViewportSizeOnResizeParams { - return &SetShowViewportSizeOnResizeParams{ - Show: show, - } -} - -// Do executes Rendering.setShowViewportSizeOnResize against the provided context and -// target handler. -func (p *SetShowViewportSizeOnResizeParams) Do(ctxt context.Context, h cdp.Handler) (err error) { - return h.Execute(ctxt, cdp.CommandRenderingSetShowViewportSizeOnResize, p, nil) -} diff --git a/cdp/runtime/easyjson.go b/cdp/runtime/easyjson.go index 4934e80..f64f21c 100644 --- a/cdp/runtime/easyjson.go +++ b/cdp/runtime/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package runtime diff --git a/cdp/runtime/events.go b/cdp/runtime/events.go index 7fda70a..bb818bc 100644 --- a/cdp/runtime/events.go +++ b/cdp/runtime/events.go @@ -9,7 +9,7 @@ import ( // EventExecutionContextCreated issued when new execution context is created. type EventExecutionContextCreated struct { - Context *ExecutionContextDescription `json:"context,omitempty"` // A newly created execution contex. + Context *ExecutionContextDescription `json:"context,omitempty"` // A newly created execution context. } // EventExecutionContextDestroyed issued when execution context is destroyed. diff --git a/cdp/schema/easyjson.go b/cdp/schema/easyjson.go index d908307..0e9c13e 100644 --- a/cdp/schema/easyjson.go +++ b/cdp/schema/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package schema diff --git a/cdp/security/easyjson.go b/cdp/security/easyjson.go index e96d2cf..80e31fb 100644 --- a/cdp/security/easyjson.go +++ b/cdp/security/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package security diff --git a/cdp/serviceworker/easyjson.go b/cdp/serviceworker/easyjson.go index 39c4042..9010e99 100644 --- a/cdp/serviceworker/easyjson.go +++ b/cdp/serviceworker/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package serviceworker diff --git a/cdp/storage/easyjson.go b/cdp/storage/easyjson.go index 8b9634c..1ffae60 100644 --- a/cdp/storage/easyjson.go +++ b/cdp/storage/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package storage diff --git a/cdp/systeminfo/easyjson.go b/cdp/systeminfo/easyjson.go index bad5ed3..4906128 100644 --- a/cdp/systeminfo/easyjson.go +++ b/cdp/systeminfo/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package systeminfo diff --git a/cdp/target/easyjson.go b/cdp/target/easyjson.go index 9508e55..ef71497 100644 --- a/cdp/target/easyjson.go +++ b/cdp/target/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package target diff --git a/cdp/tethering/easyjson.go b/cdp/tethering/easyjson.go index 1d4cbac..efe4a78 100644 --- a/cdp/tethering/easyjson.go +++ b/cdp/tethering/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package tethering diff --git a/cdp/tracing/easyjson.go b/cdp/tracing/easyjson.go index a19edfa..0a9fbc2 100644 --- a/cdp/tracing/easyjson.go +++ b/cdp/tracing/easyjson.go @@ -1,4 +1,4 @@ -// AUTOGENERATED FILE: easyjson marshaler/unmarshalers. +// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT. package tracing diff --git a/cmd/chromedp-gen/domain-gen.go b/cmd/chromedp-gen/domain-gen.go new file mode 100644 index 0000000..b1ac29f --- /dev/null +++ b/cmd/chromedp-gen/domain-gen.go @@ -0,0 +1,102 @@ +// +build ignore + +package main + +import ( + "encoding/json" + "flag" + "fmt" + "io/ioutil" + "log" + "os/exec" + "sort" +) + +var ( + flagFile = flag.String("file", "protocol.json", "path to protocol.json") + flagOut = flag.String("out", "internal/domain.go", "out file") +) + +func main() { + var v struct { + Domains []struct { + Domain string `json:"domain"` + } `json:"domains"` + } + + buf, err := ioutil.ReadFile(*flagFile) + if err != nil { + log.Fatal(err) + } + + err = json.Unmarshal(buf, &v) + if err != nil { + log.Fatal(err) + } + + var domains []string + for _, d := range v.Domains { + domains = append(domains, d.Domain) + } + sort.Strings(domains) + + var a, b string + for _, s := range domains { + a += fmt.Sprintf("Domain%s DomainType = \"%s\"\n", s, s) + b += fmt.Sprintf("case Domain%s:\n*dt = Domain%s\n", s, s) + } + + buf = []byte(fmt.Sprintf(tpl, a, b)) + err = ioutil.WriteFile(*flagOut, buf, 0644) + if err != nil { + log.Fatal(err) + } + + err = exec.Command("gofmt", "-w", "-s", *flagOut).Run() + if err != nil { + log.Fatal(err) + } +} + +const ( + tpl = `package internal + +import ( + "fmt" + "strconv" +) + +// DomainType is the Chrome domain type. +type DomainType string + +// DomainType values. +const ( +%s) + +// String satisfies Stringer. +func (dt DomainType) String() string { + return string(dt) +} + +// MarshalJSON satisfies json.Marshaler. +func (dt DomainType) MarshalJSON() ([]byte, error) { + return []byte("\"" + dt + "\""), nil +} + +// UnmarshalJSON satisfies json.Unmarshaler. +func (dt *DomainType) UnmarshalJSON(buf []byte) error { + s, err := strconv.Unquote(string(buf)) + if err != nil { + return err + } + + switch DomainType(s) { +%s + default: + return fmt.Errorf("unknown domain type %%s", string(buf)) + } + + return nil +} +` +) diff --git a/cmd/chromedp-gen/fixup/fixup.go b/cmd/chromedp-gen/fixup/fixup.go index 26bc571..ca10190 100644 --- a/cmd/chromedp-gen/fixup/fixup.go +++ b/cmd/chromedp-gen/fixup/fixup.go @@ -274,8 +274,6 @@ func FixDomains(domains []*internal.Domain) { }, ) t.Extra += templates.ExtraNodeTemplate() - - break } } diff --git a/cmd/chromedp-gen/internal/domain.go b/cmd/chromedp-gen/internal/domain.go new file mode 100644 index 0000000..0b17b9a --- /dev/null +++ b/cmd/chromedp-gen/internal/domain.go @@ -0,0 +1,144 @@ +package internal + +import ( + "fmt" + "strconv" +) + +// DomainType is the Chrome domain type. +type DomainType string + +// DomainType values. +const ( + DomainAccessibility DomainType = "Accessibility" + DomainAnimation DomainType = "Animation" + DomainApplicationCache DomainType = "ApplicationCache" + DomainBrowser DomainType = "Browser" + DomainCSS DomainType = "CSS" + DomainCacheStorage DomainType = "CacheStorage" + DomainConsole DomainType = "Console" + DomainDOM DomainType = "DOM" + DomainDOMDebugger DomainType = "DOMDebugger" + DomainDOMStorage DomainType = "DOMStorage" + DomainDatabase DomainType = "Database" + DomainDebugger DomainType = "Debugger" + DomainDeviceOrientation DomainType = "DeviceOrientation" + DomainEmulation DomainType = "Emulation" + DomainHeapProfiler DomainType = "HeapProfiler" + DomainIO DomainType = "IO" + DomainIndexedDB DomainType = "IndexedDB" + DomainInput DomainType = "Input" + DomainInspector DomainType = "Inspector" + DomainLayerTree DomainType = "LayerTree" + DomainLog DomainType = "Log" + DomainMemory DomainType = "Memory" + DomainNetwork DomainType = "Network" + DomainOverlay DomainType = "Overlay" + DomainPage DomainType = "Page" + DomainProfiler DomainType = "Profiler" + DomainRuntime DomainType = "Runtime" + DomainSchema DomainType = "Schema" + DomainSecurity DomainType = "Security" + DomainServiceWorker DomainType = "ServiceWorker" + DomainStorage DomainType = "Storage" + DomainSystemInfo DomainType = "SystemInfo" + DomainTarget DomainType = "Target" + DomainTethering DomainType = "Tethering" + DomainTracing DomainType = "Tracing" +) + +// String satisfies Stringer. +func (dt DomainType) String() string { + return string(dt) +} + +// MarshalJSON satisfies json.Marshaler. +func (dt DomainType) MarshalJSON() ([]byte, error) { + return []byte("\"" + dt + "\""), nil +} + +// UnmarshalJSON satisfies json.Unmarshaler. +func (dt *DomainType) UnmarshalJSON(buf []byte) error { + s, err := strconv.Unquote(string(buf)) + if err != nil { + return err + } + + switch DomainType(s) { + case DomainAccessibility: + *dt = DomainAccessibility + case DomainAnimation: + *dt = DomainAnimation + case DomainApplicationCache: + *dt = DomainApplicationCache + case DomainBrowser: + *dt = DomainBrowser + case DomainCSS: + *dt = DomainCSS + case DomainCacheStorage: + *dt = DomainCacheStorage + case DomainConsole: + *dt = DomainConsole + case DomainDOM: + *dt = DomainDOM + case DomainDOMDebugger: + *dt = DomainDOMDebugger + case DomainDOMStorage: + *dt = DomainDOMStorage + case DomainDatabase: + *dt = DomainDatabase + case DomainDebugger: + *dt = DomainDebugger + case DomainDeviceOrientation: + *dt = DomainDeviceOrientation + case DomainEmulation: + *dt = DomainEmulation + case DomainHeapProfiler: + *dt = DomainHeapProfiler + case DomainIO: + *dt = DomainIO + case DomainIndexedDB: + *dt = DomainIndexedDB + case DomainInput: + *dt = DomainInput + case DomainInspector: + *dt = DomainInspector + case DomainLayerTree: + *dt = DomainLayerTree + case DomainLog: + *dt = DomainLog + case DomainMemory: + *dt = DomainMemory + case DomainNetwork: + *dt = DomainNetwork + case DomainOverlay: + *dt = DomainOverlay + case DomainPage: + *dt = DomainPage + case DomainProfiler: + *dt = DomainProfiler + case DomainRuntime: + *dt = DomainRuntime + case DomainSchema: + *dt = DomainSchema + case DomainSecurity: + *dt = DomainSecurity + case DomainServiceWorker: + *dt = DomainServiceWorker + case DomainStorage: + *dt = DomainStorage + case DomainSystemInfo: + *dt = DomainSystemInfo + case DomainTarget: + *dt = DomainTarget + case DomainTethering: + *dt = DomainTethering + case DomainTracing: + *dt = DomainTracing + + default: + return fmt.Errorf("unknown domain type %s", string(buf)) + } + + return nil +} diff --git a/cmd/chromedp-gen/internal/enum.go b/cmd/chromedp-gen/internal/enum.go index 5375574..3b88d24 100644 --- a/cmd/chromedp-gen/internal/enum.go +++ b/cmd/chromedp-gen/internal/enum.go @@ -5,186 +5,6 @@ import ( "strconv" ) -// DomainType is the Chrome domain type. -type DomainType string - -/* -Accessibility -Animation -ApplicationCache -Browser -CacheStorage -Console -CSS -Database -Debugger -DeviceOrientation -DOM -DOMDebugger -DOMStorage -Emulation -HeapProfiler -IndexedDB -Input -Inspector -IO -LayerTree -Log -Memory -Network -Page -Profiler -Rendering -Runtime -Schema -Security -ServiceWorker -Storage -SystemInfo -Target -Tethering -Tracing -*/ - -// generated with: -// '<,'>s/^\(.*\)$/Domain\1 DomainType = "\1"/ -const ( - DomainAccessibility DomainType = "Accessibility" - DomainAnimation DomainType = "Animation" - DomainApplicationCache DomainType = "ApplicationCache" - DomainBrowser DomainType = "Browser" - DomainCacheStorage DomainType = "CacheStorage" - DomainConsole DomainType = "Console" - DomainCSS DomainType = "CSS" - DomainDatabase DomainType = "Database" - DomainDebugger DomainType = "Debugger" - DomainDeviceOrientation DomainType = "DeviceOrientation" - DomainDOM DomainType = "DOM" - DomainDOMDebugger DomainType = "DOMDebugger" - DomainDOMStorage DomainType = "DOMStorage" - DomainEmulation DomainType = "Emulation" - DomainHeapProfiler DomainType = "HeapProfiler" - DomainIndexedDB DomainType = "IndexedDB" - DomainInput DomainType = "Input" - DomainInspector DomainType = "Inspector" - DomainIO DomainType = "IO" - DomainLayerTree DomainType = "LayerTree" - DomainLog DomainType = "Log" - DomainMemory DomainType = "Memory" - DomainNetwork DomainType = "Network" - DomainPage DomainType = "Page" - DomainProfiler DomainType = "Profiler" - DomainRendering DomainType = "Rendering" - DomainRuntime DomainType = "Runtime" - DomainSchema DomainType = "Schema" - DomainSecurity DomainType = "Security" - DomainServiceWorker DomainType = "ServiceWorker" - DomainStorage DomainType = "Storage" - DomainSystemInfo DomainType = "SystemInfo" - DomainTarget DomainType = "Target" - DomainTethering DomainType = "Tethering" - DomainTracing DomainType = "Tracing" -) - -// String satisfies Stringer. -func (dt DomainType) String() string { - return string(dt) -} - -// MarshalJSON satisfies json.Marshaler. -func (dt DomainType) MarshalJSON() ([]byte, error) { - return []byte(`"` + dt + `"`), nil -} - -// UnmarshalJSON satisfies json.Unmarshaler. -func (dt *DomainType) UnmarshalJSON(buf []byte) error { - s, err := strconv.Unquote(string(buf)) - if err != nil { - return err - } - - switch DomainType(s) { - - // generated with: - // '<,'>s/^\(.*\)$/case Domain\1:\r\t*dt = Domain\1/ - case DomainAccessibility: - *dt = DomainAccessibility - case DomainAnimation: - *dt = DomainAnimation - case DomainApplicationCache: - *dt = DomainApplicationCache - case DomainBrowser: - *dt = DomainBrowser - case DomainCacheStorage: - *dt = DomainCacheStorage - case DomainConsole: - *dt = DomainConsole - case DomainCSS: - *dt = DomainCSS - case DomainDatabase: - *dt = DomainDatabase - case DomainDebugger: - *dt = DomainDebugger - case DomainDeviceOrientation: - *dt = DomainDeviceOrientation - case DomainDOM: - *dt = DomainDOM - case DomainDOMDebugger: - *dt = DomainDOMDebugger - case DomainDOMStorage: - *dt = DomainDOMStorage - case DomainEmulation: - *dt = DomainEmulation - case DomainHeapProfiler: - *dt = DomainHeapProfiler - case DomainIndexedDB: - *dt = DomainIndexedDB - case DomainInput: - *dt = DomainInput - case DomainInspector: - *dt = DomainInspector - case DomainIO: - *dt = DomainIO - case DomainLayerTree: - *dt = DomainLayerTree - case DomainLog: - *dt = DomainLog - case DomainMemory: - *dt = DomainMemory - case DomainNetwork: - *dt = DomainNetwork - case DomainPage: - *dt = DomainPage - case DomainProfiler: - *dt = DomainProfiler - case DomainRendering: - *dt = DomainRendering - case DomainRuntime: - *dt = DomainRuntime - case DomainSchema: - *dt = DomainSchema - case DomainSecurity: - *dt = DomainSecurity - case DomainServiceWorker: - *dt = DomainServiceWorker - case DomainStorage: - *dt = DomainStorage - case DomainSystemInfo: - *dt = DomainSystemInfo - case DomainTarget: - *dt = DomainTarget - case DomainTethering: - *dt = DomainTethering - case DomainTracing: - *dt = DomainTracing - - default: - return fmt.Errorf("unknown domain type %s", string(buf)) - } - - return nil -} - // HandlerType are the handler targets for commands and events. type HandlerType string diff --git a/cmd/chromedp-gen/main.go b/cmd/chromedp-gen/main.go index 4e0f2f3..abfd6e5 100644 --- a/cmd/chromedp-gen/main.go +++ b/cmd/chromedp-gen/main.go @@ -4,6 +4,7 @@ // Please see README.md for more information on using this tool. package main +//go:generate go run domain-gen.go //go:generate qtc -dir templates -ext qtpl import ( @@ -24,10 +25,8 @@ import ( ) func main() { - var err error - // parse flags - err = internal.FlagSet.Parse(os.Args[1:]) + err := internal.FlagSet.Parse(os.Args[1:]) if err != nil { fmt.Fprintf(os.Stderr, "error: %v\n", err) os.Exit(1) diff --git a/cmd/chromedp-gen/protocol.json b/cmd/chromedp-gen/protocol.json index 7644a05..50ad530 100644 --- a/cmd/chromedp-gen/protocol.json +++ b/cmd/chromedp-gen/protocol.json @@ -1007,25 +1007,6 @@ } ] }, - { - "name": "configureOverlay", - "parameters": [ - { - "name": "suspended", - "type": "boolean", - "optional": true, - "description": "Whether overlay should be suspended and not consume any resources." - }, - { - "name": "message", - "type": "string", - "optional": true, - "description": "Overlay message to display." - } - ], - "experimental": true, - "description": "Configures overlay." - }, { "name": "getAppManifest", "experimental": true, @@ -1321,10 +1302,112 @@ ] }, { - "domain": "Rendering", - "description": "This domain allows to control rendering of the page.", + "domain": "Overlay", + "description": "This domain provides various functionality related to drawing atop the inspected page.", + "dependencies": [ + "DOM", + "Page", + "Runtime" + ], "experimental": true, + "types": [ + { + "id": "HighlightConfig", + "type": "object", + "properties": [ + { + "name": "showInfo", + "type": "boolean", + "optional": true, + "description": "Whether the node info tooltip should be shown (default: false)." + }, + { + "name": "showRulers", + "type": "boolean", + "optional": true, + "description": "Whether the rulers should be shown (default: false)." + }, + { + "name": "showExtensionLines", + "type": "boolean", + "optional": true, + "description": "Whether the extension lines from node to the rulers should be shown (default: false)." + }, + { + "name": "displayAsMaterial", + "type": "boolean", + "optional": true + }, + { + "name": "contentColor", + "$ref": "DOM.RGBA", + "optional": true, + "description": "The content box highlight fill color (default: transparent)." + }, + { + "name": "paddingColor", + "$ref": "DOM.RGBA", + "optional": true, + "description": "The padding highlight fill color (default: transparent)." + }, + { + "name": "borderColor", + "$ref": "DOM.RGBA", + "optional": true, + "description": "The border highlight fill color (default: transparent)." + }, + { + "name": "marginColor", + "$ref": "DOM.RGBA", + "optional": true, + "description": "The margin highlight fill color (default: transparent)." + }, + { + "name": "eventTargetColor", + "$ref": "DOM.RGBA", + "optional": true, + "description": "The event target element highlight fill color (default: transparent)." + }, + { + "name": "shapeColor", + "$ref": "DOM.RGBA", + "optional": true, + "description": "The shape outside fill color (default: transparent)." + }, + { + "name": "shapeMarginColor", + "$ref": "DOM.RGBA", + "optional": true, + "description": "The shape margin fill color (default: transparent)." + }, + { + "name": "selectorList", + "type": "string", + "optional": true, + "description": "Selectors to highlight relevant nodes." + } + ], + "description": "Configuration data for the highlighting of page elements." + }, + { + "id": "InspectMode", + "type": "string", + "enum": [ + "searchForNode", + "searchForUAShadowDOM", + "none" + ] + } + ], "commands": [ + { + "name": "enable", + "description": "Enables domain notifications." + }, + { + "name": "disable", + "description": "Disables domain notifications." + }, { "name": "setShowPaintRects", "description": "Requests that backend shows paint rectangles", @@ -1379,6 +1462,202 @@ "description": "Whether to paint size or not." } ] + }, + { + "name": "setPausedInDebuggerMessage", + "parameters": [ + { + "name": "message", + "type": "string", + "optional": true, + "description": "The message to display, also triggers resume and step over controls." + } + ] + }, + { + "name": "setSuspended", + "parameters": [ + { + "name": "suspended", + "type": "boolean", + "description": "Whether overlay should be suspended and not consume any resources until resumed." + } + ] + }, + { + "name": "setInspectMode", + "description": "Enters the 'inspect' mode. In this mode, elements that user is hovering over are highlighted. Backend then generates 'inspectNodeRequested' event upon element selection.", + "parameters": [ + { + "name": "mode", + "$ref": "InspectMode", + "description": "Set an inspection mode." + }, + { + "name": "highlightConfig", + "$ref": "HighlightConfig", + "optional": true, + "description": "A descriptor for the highlight appearance of hovered-over nodes. May be omitted if enabled == false." + } + ] + }, + { + "name": "highlightRect", + "description": "Highlights given rectangle. Coordinates are absolute with respect to the main frame viewport.", + "parameters": [ + { + "name": "x", + "type": "integer", + "description": "X coordinate" + }, + { + "name": "y", + "type": "integer", + "description": "Y coordinate" + }, + { + "name": "width", + "type": "integer", + "description": "Rectangle width" + }, + { + "name": "height", + "type": "integer", + "description": "Rectangle height" + }, + { + "name": "color", + "$ref": "DOM.RGBA", + "optional": true, + "description": "The highlight fill color (default: transparent)." + }, + { + "name": "outlineColor", + "$ref": "DOM.RGBA", + "optional": true, + "description": "The highlight outline color (default: transparent)." + } + ] + }, + { + "name": "highlightQuad", + "description": "Highlights given quad. Coordinates are absolute with respect to the main frame viewport.", + "parameters": [ + { + "name": "quad", + "$ref": "DOM.Quad", + "description": "Quad to highlight" + }, + { + "name": "color", + "$ref": "DOM.RGBA", + "optional": true, + "description": "The highlight fill color (default: transparent)." + }, + { + "name": "outlineColor", + "$ref": "DOM.RGBA", + "optional": true, + "description": "The highlight outline color (default: transparent)." + } + ] + }, + { + "name": "highlightNode", + "description": "Highlights DOM node with given id or with the given JavaScript object wrapper. Either nodeId or objectId must be specified.", + "parameters": [ + { + "name": "highlightConfig", + "$ref": "HighlightConfig", + "description": "A descriptor for the highlight appearance." + }, + { + "name": "nodeId", + "$ref": "DOM.NodeId", + "optional": true, + "description": "Identifier of the node to highlight." + }, + { + "name": "backendNodeId", + "$ref": "DOM.BackendNodeId", + "optional": true, + "description": "Identifier of the backend node to highlight." + }, + { + "name": "objectId", + "$ref": "Runtime.RemoteObjectId", + "optional": true, + "description": "JavaScript object id of the node to be highlighted." + } + ] + }, + { + "name": "highlightFrame", + "description": "Highlights owner element of the frame with given id.", + "parameters": [ + { + "name": "frameId", + "$ref": "Page.FrameId", + "description": "Identifier of the frame to highlight." + }, + { + "name": "contentColor", + "$ref": "DOM.RGBA", + "optional": true, + "description": "The content box highlight fill color (default: transparent)." + }, + { + "name": "contentOutlineColor", + "$ref": "DOM.RGBA", + "optional": true, + "description": "The content box highlight outline color (default: transparent)." + } + ] + }, + { + "name": "hideHighlight", + "description": "Hides any highlight." + }, + { + "name": "getHighlightObjectForTest", + "description": "For testing.", + "parameters": [ + { + "name": "nodeId", + "$ref": "DOM.NodeId", + "description": "Id of the node to get highlight object for." + } + ], + "returns": [ + { + "name": "highlight", + "type": "object", + "description": "Highlight data for the node." + } + ] + } + ], + "events": [ + { + "name": "nodeHighlightRequested", + "description": "Fired when the node should be highlighted. This happens after call to setInspectMode.", + "parameters": [ + { + "name": "nodeId", + "$ref": "DOM.NodeId" + } + ] + }, + { + "name": "inspectNodeRequested", + "description": "Fired when the node should be inspected. This happens after call to setInspectMode or when user manually inspects an element.", + "parameters": [ + { + "name": "backendNodeId", + "$ref": "DOM.BackendNodeId", + "description": "Id of the node to inspect." + } + ] } ] }, @@ -4728,98 +5007,6 @@ } ], "description": "Rectangle." - }, - { - "id": "HighlightConfig", - "type": "object", - "properties": [ - { - "name": "showInfo", - "type": "boolean", - "optional": true, - "description": "Whether the node info tooltip should be shown (default: false)." - }, - { - "name": "showRulers", - "type": "boolean", - "optional": true, - "description": "Whether the rulers should be shown (default: false)." - }, - { - "name": "showExtensionLines", - "type": "boolean", - "optional": true, - "description": "Whether the extension lines from node to the rulers should be shown (default: false)." - }, - { - "name": "displayAsMaterial", - "type": "boolean", - "optional": true, - "experimental": true - }, - { - "name": "contentColor", - "$ref": "RGBA", - "optional": true, - "description": "The content box highlight fill color (default: transparent)." - }, - { - "name": "paddingColor", - "$ref": "RGBA", - "optional": true, - "description": "The padding highlight fill color (default: transparent)." - }, - { - "name": "borderColor", - "$ref": "RGBA", - "optional": true, - "description": "The border highlight fill color (default: transparent)." - }, - { - "name": "marginColor", - "$ref": "RGBA", - "optional": true, - "description": "The margin highlight fill color (default: transparent)." - }, - { - "name": "eventTargetColor", - "$ref": "RGBA", - "optional": true, - "experimental": true, - "description": "The event target element highlight fill color (default: transparent)." - }, - { - "name": "shapeColor", - "$ref": "RGBA", - "optional": true, - "experimental": true, - "description": "The shape outside fill color (default: transparent)." - }, - { - "name": "shapeMarginColor", - "$ref": "RGBA", - "optional": true, - "experimental": true, - "description": "The shape margin fill color (default: transparent)." - }, - { - "name": "selectorList", - "type": "string", - "optional": true, - "description": "Selectors to highlight relevant nodes." - } - ], - "description": "Configuration data for the highlighting of page elements." - }, - { - "id": "InspectMode", - "type": "string", - "experimental": true, - "enum": [ - "searchForNode", - "searchForUAShadowDOM", - "none" - ] } ], "commands": [ @@ -5220,143 +5407,20 @@ ], "description": "Requests that the node is sent to the caller given the JavaScript node object reference. All nodes that form the path from the node to the root are also sent to the client as a series of setChildNodes notifications." }, - { - "name": "setInspectMode", - "experimental": true, - "parameters": [ - { - "name": "mode", - "$ref": "InspectMode", - "description": "Set an inspection mode." - }, - { - "name": "highlightConfig", - "$ref": "HighlightConfig", - "optional": true, - "description": "A descriptor for the highlight appearance of hovered-over nodes. May be omitted if enabled == false." - } - ], - "description": "Enters the 'inspect' mode. In this mode, elements that user is hovering over are highlighted. Backend then generates 'inspectNodeRequested' event upon element selection." - }, { "name": "highlightRect", - "parameters": [ - { - "name": "x", - "type": "integer", - "description": "X coordinate" - }, - { - "name": "y", - "type": "integer", - "description": "Y coordinate" - }, - { - "name": "width", - "type": "integer", - "description": "Rectangle width" - }, - { - "name": "height", - "type": "integer", - "description": "Rectangle height" - }, - { - "name": "color", - "$ref": "RGBA", - "optional": true, - "description": "The highlight fill color (default: transparent)." - }, - { - "name": "outlineColor", - "$ref": "RGBA", - "optional": true, - "description": "The highlight outline color (default: transparent)." - } - ], - "description": "Highlights given rectangle. Coordinates are absolute with respect to the main frame viewport." - }, - { - "name": "highlightQuad", - "parameters": [ - { - "name": "quad", - "$ref": "Quad", - "description": "Quad to highlight" - }, - { - "name": "color", - "$ref": "RGBA", - "optional": true, - "description": "The highlight fill color (default: transparent)." - }, - { - "name": "outlineColor", - "$ref": "RGBA", - "optional": true, - "description": "The highlight outline color (default: transparent)." - } - ], - "description": "Highlights given quad. Coordinates are absolute with respect to the main frame viewport.", - "experimental": true + "description": "Highlights given rectangle.", + "redirect": "Overlay" }, { "name": "highlightNode", - "parameters": [ - { - "name": "highlightConfig", - "$ref": "HighlightConfig", - "description": "A descriptor for the highlight appearance." - }, - { - "name": "nodeId", - "$ref": "NodeId", - "optional": true, - "description": "Identifier of the node to highlight." - }, - { - "name": "backendNodeId", - "$ref": "BackendNodeId", - "optional": true, - "description": "Identifier of the backend node to highlight." - }, - { - "name": "objectId", - "$ref": "Runtime.RemoteObjectId", - "optional": true, - "description": "JavaScript object id of the node to be highlighted.", - "experimental": true - } - ], - "description": "Highlights DOM node with given id or with the given JavaScript object wrapper. Either nodeId or objectId must be specified." + "description": "Highlights DOM node.", + "redirect": "Overlay" }, { "name": "hideHighlight", - "description": "Hides DOM node highlight." - }, - { - "name": "highlightFrame", - "parameters": [ - { - "name": "frameId", - "$ref": "Page.FrameId", - "description": "Identifier of the frame to highlight." - }, - { - "name": "contentColor", - "$ref": "RGBA", - "optional": true, - "description": "The content box highlight fill color (default: transparent)." - }, - { - "name": "contentOutlineColor", - "$ref": "RGBA", - "optional": true, - "description": "The content box highlight outline color (default: transparent)." - } - ], - "description": "Highlights owner element of the frame with given id.", - "experimental": true + "description": "Hides any highlight.", + "redirect": "Overlay" }, { "name": "pushNodeByPathToFrontend", @@ -5632,25 +5696,6 @@ ], "description": "Returns the id of the nearest ancestor that is a relayout boundary.", "experimental": true - }, - { - "name": "getHighlightObjectForTest", - "parameters": [ - { - "name": "nodeId", - "$ref": "NodeId", - "description": "Id of the node to get highlight object for." - } - ], - "returns": [ - { - "name": "highlight", - "type": "object", - "description": "Highlight data for the node." - } - ], - "description": "For testing.", - "experimental": true } ], "events": [ @@ -5658,18 +5703,6 @@ "name": "documentUpdated", "description": "Fired when Document has been totally updated. Node ids are no longer valid." }, - { - "name": "inspectNodeRequested", - "parameters": [ - { - "name": "backendNodeId", - "$ref": "BackendNodeId", - "description": "Id of the node to inspect." - } - ], - "description": "Fired when the node should be inspected. This happens after call to setInspectMode.", - "experimental": true - }, { "name": "setChildNodes", "parameters": [ @@ -5897,16 +5930,6 @@ ], "description": "Called when distrubution is changed.", "experimental": true - }, - { - "name": "nodeHighlightRequested", - "parameters": [ - { - "name": "nodeId", - "$ref": "NodeId" - } - ], - "experimental": true } ] }, @@ -11311,7 +11334,7 @@ { "name": "context", "$ref": "ExecutionContextDescription", - "description": "A newly created execution contex." + "description": "A newly created execution context." } ], "description": "Issued when new execution context is created." @@ -11766,7 +11789,7 @@ "name": "end", "$ref": "Location", "optional": true, - "description": "End of range to search possible breakpoint locations in (excluding). When not specifed, end of scripts is used as end of range." + "description": "End of range to search possible breakpoint locations in (excluding). When not specified, end of scripts is used as end of range." }, { "name": "restrictToFunction", @@ -12753,7 +12776,7 @@ "description": "Profile title passed as an argument to console.profile()." } ], - "description": "Sent when new profile recodring is started using console.profile() call." + "description": "Sent when new profile recording is started using console.profile() call." }, { "name": "consoleProfileFinished", @@ -12977,7 +13000,7 @@ }, { "name": "lastSeenObjectId", - "description": "If heap objects tracking has been started then backend regulary sends a current value for last seen object id and corresponding timestamp. If the were changes in the heap since last event then one or more heapStatsUpdate events will be sent before a new lastSeenObjectId event.", + "description": "If heap objects tracking has been started then backend regularly sends a current value for last seen object id and corresponding timestamp. If the were changes in the heap since last event then one or more heapStatsUpdate events will be sent before a new lastSeenObjectId event.", "parameters": [ { "name": "lastSeenObjectId", diff --git a/contrib/meta.sh b/contrib/meta.sh index 2d63d6f..5b23218 100755 --- a/contrib/meta.sh +++ b/contrib/meta.sh @@ -15,7 +15,7 @@ gometalinter \ --exclude='/easyjson\.go.*(passes|copies) lock' \ --exclude='/easyjson\.go.*ineffectual assignment' \ --exclude='/easyjson\.go.*unnecessary conversion' \ - --exclude='/easyjson\.go.*\((gocyclo|golint|goconst)\)$' \ + --exclude='/easyjson\.go.*\((gocyclo|golint|goconst|staticcheck)\)$' \ --exclude='^cdp/.*Potential hardcoded credentials' \ --exclude='^cdp/cdp\.go.*UnmarshalEasyJSON.*\(gocyclo\)$' \ --exclude='^cdp/cdputil/cdputil\.go.*UnmarshalMessage.*\(gocyclo\)$' \ @@ -23,7 +23,7 @@ gometalinter \ --exclude='^cmd/chromedp-proxy/main\.go.*\(gas\)$' \ --exclude='^cmd/chromedp-gen/fixup/fixup\.go.*\(goconst\)$' \ --exclude='^cmd/chromedp-gen/internal/enum\.go.*unreachable' \ - --exclude='^cmd/chromedp-gen/main\.go.*\(gas\)$' \ + --exclude='^cmd/chromedp-gen/(main|domain-gen)\.go.*\(gas\)$' \ --exclude='^kb/gen\.go.*\((gas|vet)\)$' \ --exclude='^runner/.*\(gas\)$' \ --exclude='^handler\.go.*cmd can be easyjson\.Marshaler' \ diff --git a/handler.go b/handler.go index 2b105b3..d394b34 100644 --- a/handler.go +++ b/handler.go @@ -640,12 +640,6 @@ func (h *TargetHandler) domEvent(ctxt context.Context, ev interface{}) { case *dom.EventDistributedNodesUpdated: id, op = e.InsertionPointID, distributedNodesUpdated(e.DistributedNodes) - case *dom.EventNodeHighlightRequested: - id, op = e.NodeID, nodeHighlightRequested - - case *dom.EventInspectNodeRequested: - return - default: h.errorf("unhandled node event %s", reflect.TypeOf(ev)) return diff --git a/input_test.go b/input_test.go index dc7bdb7..189897c 100644 --- a/input_test.go +++ b/input_test.go @@ -21,12 +21,13 @@ const ( ) func TestMouseClickXY(t *testing.T) { + var err error + t.Parallel() c := testAllocate(t, "input.html") defer c.Release() - var err error err = c.Run(defaultContext, Sleep(time.Millisecond*100)) if err != nil { t.Fatal(err) diff --git a/sel_test.go b/sel_test.go index d0b0e7d..83ca3b4 100644 --- a/sel_test.go +++ b/sel_test.go @@ -12,9 +12,8 @@ func TestWaitReady(t *testing.T) { c := testAllocate(t, "js.html") defer c.Release() - var err error var nodeIDs []cdp.NodeID - err = c.Run(defaultContext, NodeIDs("#input2", &nodeIDs, ByID)) + err := c.Run(defaultContext, NodeIDs("#input2", &nodeIDs, ByID)) if err != nil { t.Fatalf("got error: %v", err) } @@ -41,9 +40,8 @@ func TestWaitVisible(t *testing.T) { c := testAllocate(t, "js.html") defer c.Release() - var err error var nodeIDs []cdp.NodeID - err = c.Run(defaultContext, NodeIDs("#input2", &nodeIDs, ByID)) + err := c.Run(defaultContext, NodeIDs("#input2", &nodeIDs, ByID)) if err != nil { t.Fatalf("got error: %v", err) } @@ -70,9 +68,8 @@ func TestWaitNotVisible(t *testing.T) { c := testAllocate(t, "js.html") defer c.Release() - var err error var nodeIDs []cdp.NodeID - err = c.Run(defaultContext, NodeIDs("#input2", &nodeIDs, ByID)) + err := c.Run(defaultContext, NodeIDs("#input2", &nodeIDs, ByID)) if err != nil { t.Fatalf("got error: %v", err) } @@ -104,11 +101,9 @@ func TestWaitEnabled(t *testing.T) { c := testAllocate(t, "js.html") defer c.Release() - var err error - var attr string - ok := false - err = c.Run(defaultContext, AttributeValue("#select1", "disabled", &attr, &ok, ByID)) + var ok bool + err := c.Run(defaultContext, AttributeValue("#select1", "disabled", &attr, &ok, ByID)) if err != nil { t.Fatalf("got error: %v", err) } @@ -155,9 +150,7 @@ func TestWaitSelected(t *testing.T) { c := testAllocate(t, "js.html") defer c.Release() - var err error - - err = c.Run(defaultContext, Click("#button3", ByID)) + err := c.Run(defaultContext, Click("#button3", ByID)) if err != nil { t.Fatalf("got error: %v", err) } @@ -202,9 +195,7 @@ func TestWaitNotPresent(t *testing.T) { c := testAllocate(t, "js.html") defer c.Release() - var err error - - err = c.Run(defaultContext, WaitVisible("#input3", ByID)) + err := c.Run(defaultContext, WaitVisible("#input3", ByID)) if err != nil { t.Fatalf("got error: %v", err) } @@ -226,9 +217,8 @@ func TestAtLeast(t *testing.T) { c := testAllocate(t, "js.html") defer c.Release() - var err error var nodes []*cdp.Node - err = c.Run(defaultContext, Nodes("//input", &nodes, AtLeast(3))) + err := c.Run(defaultContext, Nodes("//input", &nodes, AtLeast(3))) if err != nil { t.Fatalf("got error: %v", err) } diff --git a/util.go b/util.go index ce470e4..1686c1f 100644 --- a/util.go +++ b/util.go @@ -344,10 +344,6 @@ func distributedNodesUpdated(nodes []*cdp.BackendNode) nodeOp { } } -func nodeHighlightRequested(n *cdp.Node) { - // TODO -} - func insertNode(n []*cdp.Node, prevID cdp.NodeID, c *cdp.Node) []*cdp.Node { var i int var found bool